Explanation:
a formula giving the proportions of the elements present in a compound but not the actual numbers or arrangement of atoms.
Answer:
The answer is A
Explanation:
its is the chemical formula in which the subscripts are given in the smallest ratio
Students in Mr. Garcia's class were having a race! No, not running. Instead they rolled tennis balls down a wooden track. The tennis balls have the same mass and diameter. Using the data table, decide which ball had the MOST kinetic energy.
Answer:
it's entertaining. Energy though is the answer
what was transferred from the hydrochloric acid to the water molecule
A proton (H⁺) is transferred from the hydrochloric acid to the water molecule.
What is Bronsted-Lowry theory?Bronsted-Lowry theory is used to classify acids and bases.
Acid: is a substance that donates H⁺.Base: is a substance that accepts H⁺.Hydrochloric acid is an acid and when it reacts with water, it transfers an H⁺ ion, according to the following equation.
HCl + H₂O ⇒ Cl⁻ + H₃O⁺
A proton (H⁺) is transferred from the hydrochloric acid to the water molecule.
Learn more about Bronsted-Lowry theory here: https://brainly.com/question/4083753
Knowing that the solubility of a salt at 80°C is 45g/100 g of H,O, calculate the mass of water required for dissolve 250 g of this salt at 80º C.
The mass of water required will be approximately [tex] \bf = 555.6\: g [/tex].
To solve this question, just make a simple rule of three between the amount of salt dissolved at 80ºC and the mass of water:[tex]\qquad[/tex] 45g of salt [tex] \sf \longrightarrow[/tex] 100g of H₂O
[tex]\qquad[/tex] 250g of salt [tex] \sf \longrightarrow[/tex] x g of H₂O
[tex]\qquad[/tex] [tex]\red{\twoheadrightarrow\bf45\times x = 250\times 100}[/tex]
[tex]\qquad[/tex] [tex]\twoheadrightarrow\sf45x=25000[/tex]
[tex]\qquad[/tex] [tex]\twoheadrightarrow\sf x=\cancel{\dfrac{25000}{45}}[/tex]
[tex]\qquad[/tex] [tex]\red{\twoheadrightarrow\bf x = 555.6\:g}[/tex]
Therefore, knowing that the solubility of a salt at 80ºC is 45g/100g of water (H₂O), the mass of water needed to dissolve 250g of this salt at 80ºC will be [tex] \red{\bf = 555.6\: g }[/tex]__________________________________________________
"uses for simple machines" whats a piano that needs to be moved up to a third floor apartment
Answer:
Pulley
Explanation:
You can't the piano up the stairs, you need to something to bring it up
What role does each type of chemical play in the firework
Answer: Antimony: Antimony is used to create firework glitter effects. Barium: Barium is used to create green colors in fireworks,
Explanation:
Answer:
Explanation:Antimony: Antimony is used to create firework glitter effects. Barium: Barium is used to create green colors in fireworks,
Part A
Before you design your model village, write down the problems you observed in task 1. What were the largest risks to the community? What happened to the homes?
The largest risks while designing a model to withstand a village include that the model does not mitigate the effects of the tsunami or only mitigates the effects partially, which would cause damages to the homes.
Designing a model to withstand the effect of any natural phenomenon such as an earthquake, fire or tsunami is not an easy task and will require the following cycle:
Designing the model.Testing the model.Making changes or designing a new model.In the case of a model for tsunamis, it is likely the following problems occur:
The model does not protect the houses from tsunamis.The model does not protect the houses completely.This would lead to negative effects such as:
Damages in the houses.Dead or injured people.Destruction of infrastrcture.Note: This question is incomplete because the context is missing; here is the missing part.
Protecting Your Model Village from Tsunamis this task, you will design a model village to withstand the effects of a tsunami.
Learn more about tsunami in: https://brainly.com/question/1126317
how much usable energy is extracted from one glucose molecule
We can extract 3×3 power 3 from glucose molecules
How much heat is required to warm 50.0 g of ice from -10.0oC to 0.00oC, melt the ice, warm the water from 0.00oC to 100.0oC, boil the water, and heat the steam to
120.0oC ?
a 209,000 J
b 199,000 J
c 1.67 x 106 J
d 152,000 J
The total heat required to convert the ice to steam is 155,000 J.
The given parameters:
Mass of the ice, m = 50 gInitial temperature of the ice, t = -10 ⁰CFinal temperature of the ice, T = 0⁰C, 100⁰C and 120⁰CSpecific heat capacity of water = 4.184 J/g⁰CHeat of fusion of ice, = 333.55 J/gHeat of vaporization, = 2,230 J/gThe heat required to raise the temperature to 0⁰C is calculated as;
[tex]Q = mc\Delta t\\\\Q_1 = 50 \times 4.184 \times (0 - (-10))\\\\Q_1 = 2092 \ J[/tex]
The heat required to melt the ice is calculated as follows;
[tex]Q_2 = mL_f\\\\Q_2 = 50 \times 333.55 \\\\Q_2 = 16,677.5 \ J[/tex]
The heat raise the temperature to 100⁰C is calculated as;
[tex]Q_3 = 50 \times 4.184 \times (100 - 0)\\\\Q_3 = 20,920 \ J[/tex]
The heat required to boil the water is calculated as follows;
[tex]Q_4 = mL_v\\\\Q_4 = 50 \times 2230\\\\4_4 = 111,500 \ J[/tex]
The heat raise the temperature to 120⁰C is calculated as;
[tex]Q_5 = 50 \times 4.184 \times (120 - 100)\\\\Q_5 = 4,184 \ J[/tex]
The total heat required is calculated as follows;
[tex]Q_t = Q_1 + Q_2 + Q_3 + Q_4 + Q _5 \\\\Q_t = 2092 + 16,677.5 + 20,920 + 111,500 + 4,184\\\\Q_t = 155,373.5 \ J\\\\Q_t \approx 155,000 \ J[/tex]
Learn more about heat capacity here: https://brainly.com/question/16559442
how can knowledge of percent composition help you as a consumer ? how can you promote responsible consumerism ?
Answer:
it is a nice question....my mind tells me that the first is it use me as a good vibes and can use to anything the second i will do my best too absorbe it.
Explanation:
Hope this help...
Mercury is an environmental pollutant that is produced by the burning of
fossil fuels and can be toxic to wildlife and humans. What does this show
about the impact of chemicals on the environment?
A. The harm chemicals could have on the environment outweighs the
benefits that people get from the chemicals.
B. People cannot control the negative effects of chemicals on the
environment.
C. All chemicals that people introduce into the environment are
harmful.
D. The beneficial effects people get from chemicals may have
unintended harmful effects on the environment,
The amount of energy involved when an electron is acquired by a neutral gaseous atom is what?
Write the charges for each part of this equation.
Answer:
the Aluminium Al have +3 charges and idion have I) have - 2 charges
Which statement does NOT describe subduction zones?
A.
Earthquakes and volcanoes occur at these boundaries.
B.
Old crust is recycled into Earth's mantle.
C.
Volcanic mountains can form at these boundaries.
D.
New crust forms by seafloor spreading
Saliva, produced by glands in the mouth, plays an important role in the digestion of food. Saliva contains a chemical, called amylase, that breaks down starch in the food we eat. A scientist conducts an experiment to investigate at which temperatures amylase works the best. He hypothesizes that the reaction will occur fastest if the amylase reaction is conducted near the normal human body temperature of 37ºC (degrees Celsius). In order to test his hypothesis, the scientist measures the reaction rate, which is how fast the amylase breaks down the starch at six different temperatures. The reaction rate is rated on a scale of 0 to 10, with 0 meaning no reaction and 10 meaning the fastest reaction. The results are recorded in the data table.
AMYLASE REACTION RATE BY TEMPERATURE
Temperature (ºC)
Reaction Rate
0
2
20 4
40 10
60 8
80 2
100 0
Based on the data, should the scientist accept or reject his hypothesis?
Answer:
The digestive functions of saliva include moistening food, and helping to create a food bolus, so it can be swallowed easily. Saliva contains the enzyme amylase that breaks some starches down into maltose and dextrin. Thus, digestion of food occurs within the mouth, even before food reaches the stomach.
Explanation:
why does water boil at a lower temperature at higher altitudes
report the elements half life. if we start with 100g of your element (platinum) how long will it take to have 6.26g?
Answer:
did u get the answer yet
Explanation:
(iii) Give two reasons why the electrolyte contains cryolite
Answer:
The mixture of cryolite and aluminum oxide has a lower melting point than pure aluminum oxide. This means a lower amount of energy is required to establish effective conditions for electrolysis and thus makes it more cost effective.
Explanation:
How can one determine if a compound is ionic or covalent?
Answer:
If a compound is made from a metal and a non-metal, its bonding will be ionic. If a compound is made from two non-metals, its bonding will be covalent.
Select the correct answer. In which situation is chemical energy being converted to another form of energy? A. a lamp plugged into the electric grid B. a fluttering flag C. a floating wooden log D. a burning candle
Answer:
D. A burning candle. (chemical energy into energy of heat and light, i.e. thermal and wave)
Explanation:
comment and tell me if it right.
The situation in which chemical energy being converted to another form of energy is a burning candle.
So, option D is correct one.
What is chemical energy?The energy produce by the chemical reaction is called chemical energy.
Example: burning of candle.
Give the example of energy conversion.When lamp plugged into electric grid then electrical energy is converted into light energy.When candle is burn then chemical energy is converted into light energy.No energy takes place during a fluttering flag and a floating wooden log.learn more about chemical energy,
https://brainly.com/question/1371184
#SPJ2
pls help :)))))))pop
Answer:
c-a-b
Explanation:
50 points for anyone who answeres properly. How does a structure of a triglyceride differ from the reaction of fructose?
Triglycerides and fructose are both monomers, but they differ in how they bond to other monomers.
Fructose forms large polymers by the process of hydrolysis, while a triglyceride forms monomers by the process of dehydration.
Fructose is a form of carbohydrate, while a triglyceride is a lipid.
A triglyceride is a polymer, while fructose is a monomer.
Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.
What are triglycerides and fructose?Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.
Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.
Therefore, option C. fructose is sugar and triglyceride is fat is correct.
Learn more about triglycerides and fats here:
https://brainly.com/question/17576593
#SPJ2
25.0g of iron is heated to 100.0 and then placed in 50.0 g of water in a insulated calorimeter. the initial temperature of the water is 38.00. the specific heat of water is 4.181j/g and the specific heat if iron is 0.45j/g. what is the final temp of the water and the iron?
Answer:
Approximately [tex]41.2\; {\rm ^{\circ} C}[/tex].
Explanation:
Let [tex]t\; {\rm ^{\circ} C}[/tex] be the final temperature of the water and the iron.
Temperature of the water would be increase by [tex](t - 38.00)\; {\rm ^{\circ} C}[/tex].
Temperature of the iron would be reduced by [tex](100.0 - t)\; {\rm ^{\circ} C}[/tex].
Let [tex]c[/tex] denote the specific heat of each material. Let [tex]m[/tex] denote the mass of the material. For a temperature change of [tex]\Delta t[/tex], the energy change involved would be:
[tex]Q = c\, m \, \Delta t[/tex].
The energy that the water need to absorb would be:
[tex]\begin{aligned}& Q(\text{water, absorbed}) \\ =\; & c(\text{water}) \, m(\text{water})\, \Delta t (\text{water}) \\ =\; & 4.181\; {\rm J \cdot g^{-1} \cdot K^{-1}} \times 50\; {\rm g} \times (t - 38.00)\; {\rm ^{\circ} C} \\ =\; & (209.05\, t - 7943.9)\; {\rm J} \end{aligned}[/tex].
The energy that the iron would need to release would be:
[tex]\begin{aligned}& Q(\text{iron, released}) \\ =\; & c(\text{iron}) \, m(\text{iron})\, \Delta t (\text{iron}) \\ =\; & 0.45\; {\rm J \cdot g^{-1} \cdot K^{-1}} \times 25.0\; {\rm g} \times (100.0 - t)\; {\rm ^{\circ} C} \\ =\; & (1125 - 11.25 \, t)\; {\rm J} \end{aligned}[/tex].
Since this calorimeter is insulated, the energy that the iron had released would be equal to the energy that the water had absorbed:
[tex]Q(\text{water, absorbed}) = Q(\text{iron, released})[/tex].
[tex]209.05\, t - 7943.9 = 1125 - 11.25\, t[/tex].
[tex]t \approx 41.2[/tex].
Thus, the final temperature of the water and the iron would be approximately [tex]41.2\; {\rm ^{\circ} C}[/tex].
PLEASE HELP!!
Explain the physical and chemical properties of water, including its different phase changes. Why is water so critical for human life?
Submission
Almost 99% of the Earth's atmosphere is made up of two gases. What ere the two gases and the percents of each?
Answer:
21% oxygen and 78%nitrogen
Explanation:
Answer:
Nitrogen and Oxygen
Explanation:
nitrogen - 78 %
oxygen - 21%
what is the empirical formula of butenedioic acid
why do you think polar aprotic solvents increase the rate of an sn2 reaction
How many atoms are in 11.5g of Hg
PLEASE HELP!!!
ILL MARK AS BRAINIEST AND GIVE YOU 30 POINTS!!!
Answer:
did u get it yet
Explanation:
A student is trying to classify an unidentified, solid gray material as a metal or a nonmetal. Which question will best help the student classify the material?.
The question that will best help the student to classify the material is; "is the material malleable or ductile?"
Generally, materials can be classified as metals or non metals. There are properties that are particular to metals and there are properties that are particular to nonmetals and these properties can be used to identify each one of the materials.
The question that will best help the student to classify the material is; "is the material malleable or ductile?" These metallic properties.
Learn more:
https://brainly.com/question/1659592
Missing parts;
A student is trying to classify an unidentified, solid gray material as a metal or a nonmetal. Which question will best help the student classify the material? A. Is the material malleable or ductile? B. Does the material feel hard to the touch? C. Will the material float in water? D. Does the material feel rough or smooth?
Where are nonmetals located in the periodic table?
Question 8 options:
along the upper left side
in the middle
along the upper right side
along the bottom
Answer: They are located along the upper right side of the periodic table.
Explanation: Malleability is a physical property that some elements of matter have that can be broken down into sheets to give them a certain shape without breaking. This physical property belongs to plasticity. It is a characteristic that some metals have, sheets of said metal can be obtained. The heat needs to be increased, some examples are gold, platinum, zinc, tin, etc.