What is arcade in south Center

Answers

Answer 1

Answer: game stop and mind games

Explanation:

i live near there


Related Questions

Which is the molecular shape of water, H20, according to the VSEPR theory?
A. Bent
B. Tetrahedral
C. trigonal pyramidal
D. Trigonal planar

Answers

Answer:

the answer is A

Explanation:

which description of salt is a chemical property?

No combustion

Odourless

salty taste

solid does not conduct electricity

Answers

Answer: No combustion

Explanation:

Calculate the speed for a car that went a distance of 150 kilometers in 2 hours time. btw this is science

Answers

Answer:

The speed of the car is 75 km per hour

Explanation:

Speed is distance over time so 150 km divided by 2 hours is 75km per hour.

Please mark brainliest!!! Thanks.

Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?

Answers

Answer:

N2O

Explanation:

hope am right.....

For a certain chemical reaction, the bond energy of the reactants is 43 kJ, and 35 kJ of energy is released. For energy to be conserved, what is the bond energy of the products?

Answers

Answer:

78kJ

Explanation:

Energy change = Energy in (reactants) - Energy out (products)

According to this question, energy is released, meaning that the reaction is EXOTHERMIC. Hence, the energy change will be negative (-) i.e bond energy of reactants is greater than bond energy of products.

Energy in = bond energy of reactants = 43kJ

Energy out = bond energy of products = ?

Energy change of exothermic reaction = -35kJ

Therefore;

-35kJ = 43kJ - x

x = 35kJ + 43kJ

x = 78kJ

The bond energy of the products is 78kJ.

Which things are larger than cells? Put an X next to (or highlight) the things that are generally larger than a typical animal or plant cell.


_____thickness of a leaf ____grain of salt
_____atom _____protein molecule
_____width of hair x DNA
_____piece of sawdust _____eye of an ant
_____Water molecule _____tiny seed
_____bread crumb _____larva of a tiny fruit fly
_____bacteria _____period at end of sentence _____ virus
_____speck of pepper _____chromosome _____ frog embryo _____dust mite _____point of a pin _____ flea egg

Answers

Answer:

Explanation:

x thickness of a leaf x grain of salt

_____atom _____protein molecule

x width of hair x DNA

x piece of sawdust x eye of an ant

_____Water molecule x tiny seed

x bread crumb x larva of a tiny fruit fly

x bacteria x period at end of sentence _____ virus

x speck of pepper _____chromosome x frog embryo x dust mite xpoint of a pin x flea egg

How are convalent molecules named?

Answers

Covalent compounds are named by using numerical prefixes to identify the number of atoms in the molecule. E.g. Mono, Di, tri, tetra, etc.

In the naming, never use mono- for the first element.

The first element keeps its name.

The second element always end in the suffix -ide.

Drop the double vowel for the prefix and the element of the second element in the compound.

Hope this helped!

Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid

Examples
A. Air
B. seawater
C. marshmallow

Answers

Answer:

sea water

Explanation:

a sea water can match the following

Which best describes why NH4+ can form an ionic bond with CF?

Its outermost shell gains one or more electrons from CF.

Its positive charge is attracted to the negative charge of Cr.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cr.

Answers

Answer:

Its positive charge is attracted to the negative charge of Cl-

Note: The correct question is given below:

Which best describes why NH4+ can form an ionic bond with Cl-?

Its outermost shell gains one or more electrons from Cl-.

Its positive charge is attracted to the negative charge of Cl-.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cl-.

Its positive charge is attracted to the negative charge of Cl-.

Explanation:

An ammonium ion is a positively charged ion which is composed of a molecule of ammonia and a hydrogen ion which are in a coordinate covalent bond due to the lone pair of electrons of the nitrogen atom in the molecule ammonia. The chloride ion however, has an extra electron which gives it a negative charge.

An ionic bond is formed between two oppositely charged ions by a transfer of electrons from one atom to another. It usually occurs between non-metals and metals. However, that formed between ammonium ion and chloride ion is between non-metals entirely.

Due to electrostatic attraction between the oppositely charged ions, an ionic bond is formed between ammonium ion, NH4+, and chloride ion, Cl-.

Suggest a change of state, other than ice melting, that is an endothermic
process.​

Answers

Answer:

Vaporization and Sublimation

Explanation:

Answer:

Well there's solid states, liquid states, and gas states in matter.

The “rise” of the muffin is caused by the release of ___________ gas trapped in the mix as it is heated. carbon dioxide hydrogen oxygen helium

Answers

Answer:

Carbon dioxide

Explanation:

In the making of the muffins, there are many ingredients are used including flour, egg, butter, sugar, and flavoring of fruits. There is also a raising agent, the baking powder or baking soda used that reacts with the batter.

This reaction form bubbles of carbon dioxide, trapped in the air spaces during the baking and muffin raises. Carbon dioxide makes muffins light, by lifting the batter as it bakes.

Astronomers observed that the orbit of Uranus was not uniform. Therefore, they hypothesized the existence of another planet. This is an example of scientific investigation being led by _____.

Inductive Reasoning
Deductive Reasoning

Answers

Answer:

This is an example of scientific investigation being led by inductive reasoning.

Explanation:

Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.

The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.

OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS

What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer

Answers

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

3. What crime had James Kater been convicted of in 1969?
A. Sexual assault of a 15-year-old girl.
B. Theft of a 1976 Opel model green car.
C. Abduction and assault of a 13-year-old girl,
D. Second degree murder of a 18 year-old female.

Answers

letter C he abducted a 13year old

When is electrolysis used to extract metal?

Answers

Answer:

Explanation:

electrolysis is the technique that use direct current to drive a non spontaneous chemical reaction chemical reaction is the gain or lose of electron this technique is use to extract metal from theirs ores

How many molecules are there in 8.25 moles of CaHia?

Answers

The number of molecules : 4.967 x 10²⁴

Further explanation  

A mole is a number of particles(atoms, molecules, ions)  in a substance

This refers to the atomic total of the 12 gr C-12  which is equal to 6.02.10²³, so 1 mole = 6.02.10²³ particles  

Can be formulated :

N = n x No

N = number of particles

n = mol

No = 6.02.10²³ = Avogadro's number

8.25 moles of C₈H₁₈

The number of molecules :

[tex]\tt 8.25\times 6.02\times 10^{23}=4.967\times 10^{24}[/tex]

pls I need help give away 11 points
A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons. What is the overall charge of the particle?
0
+2
-2
+18

Answers

Answer:

The charge is +2

Explanation:

Protons are positive, electrons are negative. 10-8=2.

+2 :)

A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons, the overall charge of the particle is +2. Therefore, the correct option is option B.

What is atom?

The smallest unit of matter that may be split without producing electrically charged particles is the atom. It is also the smallest piece of substance with chemical element-like characteristics. As a result, the atom serves as the fundamental unit of chemistry.

Space makes up the majority of an atom. The remainder is made up of a cloud of electrons with negative charges around a positive-charged nucleus made up of protons and neutrons. Compared to electrons, that are the lightest positive ions in nature, the nucleus is tiny and dense. A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons, the overall charge of the particle is +2.

Therefore, the correct option is option B.

To know more about atom, here:

https://brainly.com/question/29712157

#SPJ6

7. Which of the following is unlikely to
happen to zinc?
A) It is rolled into sheets.
B) It is used to coat a steel hull.
C) It is used in a battery.
D) It is used as an insulator.

Answers

Answer:D) it is used as an insulator

Explanation:

carbon and tin are both in the fourth column of the table which would you expect to have the greater electronegativity

Answers

Answer: Carbon

Explanation:

electronegativity decreases when you go down a column

The study of chemical bonds is called chemistry.

The correct answer is carbon.

The more negative charge present on an atom shows the electronegativity.

The attraction of the nucleus to the proton is also referred to as electronegativity.

The smaller the radius more the electronegativity.

Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.

For more information, refer to the link:-

https://brainly.com/question/12985618

_________feedback is a type of feedback in which a system is triggered to produce an output.

Answers

Answer:

positive

Explanation:

Answer:

Positive feedback is a type of feedback in which a system is triggered to produce an output.





Explanation:

Have a great rest of your day
#TheWizzer

What information can a foliated metamorphic rock provide you about the conditions under which it formed?

Answers

A foliated rock forms when the minerals are realigned due to the presence of high temperature and pressure. The minerals align in such a way that the axes are directed to where the pressure was applied.

a gas tank is under 1 atm pressure at room temperature. if the temperature halved,what will happen to the pressure ​

Answers

Answer:

The pressure will also be halved.

Explanation:

Gay-Lussac's law states that the relationship between temperature and pressure is directly proportional to each other. If the temperature goes up, so will the pressure.

AS HEIGHT INCREASES SO DOES

Answers

Answer:

potential energy (im positive that its right)

What is the correct name for the following compound: P2Br5

Answers

Answer:

Diphosphorus pentabromide is the official name.

Explanation:

what is the electical charge on the nucleus of the boron atom ?

Answers

Boron have 5 protons and only 4 electrons, which means that it has a positive charge.
(The charge is +1)

Hope this helped!

How many moles of hydrogen
are in 3.7 moles of C8H11 NO2?

Answers

40.7 because I know

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

Describe how the molecular models you assembled are similar to real molecules.
They model how real molecules are.

Answers

Answer:

Atoms models are bigger but they don not match the true or positive way of atoms. to make them visible scientists make their models that resembled with the real ones.

Explanation:

Molecules are microscopic entities and only can be seen under a  microscope.

the process that breaks down rocks

Answers

Weathering is the breaking down or dissolving of rocks and minerals on earths surface!

Choose the balanced chemical equation below that best represents the following reaction:

When baking soda (NaHCO3) reacts with hydrochloric acid (HCl), carbon dioxide bubbles (CO2) are created, along with water (H2O) and sodium chloride (NaCl).




NaCl + H2O → NaHCO3 +CO2 + HCl


CO2 +H2O + NaCl → NaHCO3 + HCl


NaHCO3 + HCl → CO2 + H2O + NaCl


HCl + NaCl + H2O → NaHCO3 +CO2

Answers

The balanced chemical equation :

NaHCO₃ + HCl → CO₂ + H₂O + NaCl

Further explanation

A balanced chemical reaction shows that the number of atoms of the reactant and the number of atoms of the product is the same

When baking soda (NaHCO3) reacts with hydrochloric acid (HCl), carbon dioxide bubbles (CO2) are created, along with water (H2O) and sodium chloride (NaCl) .

This statement shows that

Reactants (located to the left of the reaction)

Baking soda (NaHCO₃) and Hydrochloric acid (HCl)

product (located to the right of the reaction)

Carbon dioxide(CO₂),water  (H₂O) and Sodium chloride (NaCl).

So the reaction :

NaHCO₃ + HCl → CO₂ + H₂O + NaCl

Other Questions
What two major events occur during meiosis that give the new cells genetic variation x three * 101 three = 2001012three Which of the following words does not describe Mrs. Morningstar?enojadaduragrandedulce Gena wants to estimate the quotient of 21.87 divided by 4.79. Which expression shows the best expression to estimate the quotient using front-end estimation?a) -214b) -215c) -204d) -205p.s, Daily question! What's your favorite song? which of the following best describes how john c calhoun's speech relates to the events of the missouri crisisAnswer:it provides context regarding the racial beliefs held by some of the supporters of expanding slavery into new territories Which graph shows a linear function? fill in the complementary bases according to the base-pair rule. a | t | c | c | g | a | t | a | g | c | t | t | a | g 10. An electric scooter manufacturer estimates that the cost C in dollars) of producing xscooters is given by C(x) = 600+ 0.05x + 0.0002x%. Find the production level, to the nearestunit, that will minimize the average cost (x) per unit.A. 1733 scootersB.1250 scootersC. 600 scootersD.1500 scooters Evaluate the expression 9x for x= 2.9x = when x = 2.(Simplify your answer.) Determine the meaning of the word adamant All of the following are effects of Columbuss voyages except ____________.a.Spanish colonization in the Americasb.Europeans gained advanced technologyc.encouragement of further Spanish exploration of the Americasd.Europeans became aware of the existence of North and South America what was the significance of the elections of 1824 What's a social issue from I hear America singing What is the ones digit of 5120 + 2301 + 456? a car accelerates at a constant rate from 15 m/s to 25 m/s while it travels a distance of 125 m. How long does it take to achieve this speed? Find the slope of a line parallel to each given line.y= -1/4x -4pls help asap 0.52 0.25 0.75 0.620 0.062 from smallest to largest what is the altitude of polaris in the night sky at elmira? Unit test Select two ratios that are equivalent to 2 : 12. Choose 2 answers: A 6:40 B 12:2 C 3:24 D 1:6 E 8:48 What are the advantages and disadvantages of Dynamic Multimedia (PowerPoint presentation, website) and Text Media (newspaper article, formal report)?