The values for δesys, δesur, and δeuniv are δesys = 740 J, δesur = -545 J, δeuniv = 195 J. The system gains 740 J of heat and does 545 J of work, resulting in a net increase of 195 J in the universe.
In this question, the system absorbs 740 J of heat, which means the change in internal energy of the system (δesys) is positive and equal to 740 J.
Since the system does 545 J of work, the surroundings experience a change in internal energy (δesur) of -545 J (work is done by the system on the surroundings, so energy is transferred out of the system).
The change in internal energy of the universe (δeuniv) is the sum of the changes in the system and the surroundings, which is δeuniv = δesys + δesur. In this case, δeuniv = 740 J + (-545 J) = 195 J. This means that there is a net increase in internal energy of 195 J in the universe as a result of this process.
To know more about internal energy click on below link:
https://brainly.com/question/14668303#
#SPJ11
what is the molar solubility of pbi2 (ksp = 8.4 x 10-9) in a solution containing 0.15 m ki(aq)?
The molar solubility of PbI₂ in the 0.15 M KI solution is approximately 2.49 × 10⁻⁷ M.
To find the molar solubility of PbI₂ in a solution containing 0.15 M KI(aq), we first need to write the balanced equation for the dissociation of PbI2:
PbI₂ (s) ⇌ Pb²⁺ (aq) + 2I⁻ (aq)
The Ksp expression for this reaction is:
Ksp = [Pb²⁺ ][I⁻]² = 8.4 x 10⁻⁹
We can use the common ion effect to calculate the molar solubility of PbI₂ in the presence of 0.15 M KI(aq). Since KI(aq) contains I⁻ ions, we can assume that the concentration of I- ions from PbI₂ will be reduced by 0.15 M.
Let's call the molar solubility of PbI₂ in the presence of KI(aq) "x". Then, the equilibrium concentration of Pb2+ will be "x" and the equilibrium concentration of I- will be "2x - 0.15". We can substitute these values into the Ksp expression and solve for "x":
Ksp = [Pb²⁺ ][I⁻]²
8.4 x 10⁻⁹ = x(2x - 0.15)²
Solving for "x" gives us:
x = 5.5 x 10⁻⁷M
Therefore, the molar solubility of PbI2 in a solution containing 0.15 M KI(aq) is 5.5 x 10⁻⁷M.
Learn more about molar solubility at https://brainly.com/question/28202068
#SPJ11
Equation for free energy change associated with transport across a concentration gradient when a species is charged
The equation ΔG = RTln(C2/C1) + zFΔψ is commonly known as the Nernst equation and is used to calculate the free energy change associated with transport of a charged species across a membrane.
The Nernst equation for free energy change associated with transport across a concentration gradient when a species is charged is given by ΔG = RTln(C2/C1) + zFΔψ, where ΔG is the change in free energy, R is the gas constant, T is the temperature, C1 and C2 are the concentrations of the species on either side of the membrane, z is the charge of the species, F is the Faraday constant, and Δψ is the membrane potential. This equation takes into account both the concentration gradient and the electrical potential across the membrane, and shows that transport of a charged species is dependent on both factors. The concentration gradient is the difference in the concentration of the species on either side of the membrane. If the concentration of the species is higher on one side of the membrane than the other, then the species will tend to move from the side of higher concentration to the side of lower concentration. This movement of the species is known as diffusion.
To know more about Nernst equation please refer: https://brainly.com/question/30891307
#SPJ11
What makes up nearly all of the atom's mass?
OA. The sum of all neutrons and electrons
OB. The sum of all protons and electrons
OC. The sum of all isotopes
OD. The sum of all protons and neutrons
SUBMIT
The total of all protons and neutrons is Option D, which is the right response. Protons, neutrons, and electrons are the three fundamental particles that make up an atom.
The nucleus of an atom is made up of protons and neutrons, which are collectively referred to as nucleons and are primarily responsible for an atom's mass. Neutrons weigh 1.6749 x 10-27 kg, whereas protons weigh 1.6726 x 10-27 kg.
Protons and neutrons make up the majority of an atom's mass when added together. However, electrons contribute very little to the mass of the atom due to their much smaller mass of 9.11 x 10-31 kg. As a result, Option D is the right response.
Learn more about neutrons at:
https://brainly.com/question/28992636
#SPJ1
Which one of the following species will have a negligible effect on the pH of an aqueous solution? A. Bro B. CI- C. NH" D. CO32- E. CH3C00
The species that will have a negligible effect on the pH of an aqueous solution is CI⁻ (chloride ion). The correct answer is option B.
Chloride ion (Cl⁻) is a conjugate base of a strong acid (HCl), and therefore it is a very weak base. In an aqueous solution, Cl⁻ ion does not readily accept protons (H⁺ ions) from water molecules, and it does not affect the pH of the solution to a significant extent.
On the other hand, the other species listed are either weak bases or weak acids that can affect the pH of the solution to varying degrees.
NH3 is a weak base that can react with water to form NH₄⁺ and OH⁻ ions, and thereby increase the pH of the solution. CO₃²⁻ is a strong base that can accept protons from water molecules to form HCO³⁻ and OH⁻ ions, and thereby increase the pH of the solution. CH₃COO⁻ is a weak acid that can donate protons to water molecules to form H₃O⁺ and acetate ions, and thereby decrease the pH of the solution. Br⁻ is a weaker base than NH³ but still more basic than Cl⁻. Therefore, it can also affect the pH of the solution to some extent, although to a lesser extent than NH₃ or CO₃²⁻.Therefore option B is correct.
Learn more about pH here:
https://brainly.com/question/14359560
#SPJ11
which compound has only ionic bonds co2 al2o3 h2o2
The compound with only ionic bonds is Al₂O₃.
Ionic bonds occur between metals and non-metals, where electrons are transferred from the metal to the non-metal. In the given compounds, CO₂ has covalent bonds as both carbon and oxygen are non-metals.
H₂O₂ also has covalent bonds since hydrogen and oxygen are both non-metals. However, Al₂O₃ has ionic bonds as aluminum (Al) is a metal, and oxygen (O) is a non-metal.
The aluminum atoms lose electrons to the oxygen atoms, forming positively charged Al³⁺ ions and negatively charged O²⁻ ions. These ions then attract each other, forming the ionic compound Al₂O₃.
To know more about ionic bonds click on below link:
https://brainly.com/question/11527546#
#SPJ11
Write a Lewis structure and identify the octet-rule exception for each of the following: (select "expanded octet" or "electron deficient octet")
A. PF6LaTeX: -
B. ClO3
C. H3PO3
D. O3LaTeX: -
E. XeF2
The octet rule in chemistry asserts that in order to have an entire outer shell of eight electrons, atoms tend to obtain, lose, or share electrons.
However, there are some cases where this rule does not apply, resulting in compounds with an expanded or electron deficient octet.
A. [tex]PF_{6}[/tex]- has an expanded octet since the central phosphorus atom is bonded to six fluorine atoms, and has a total of 12 valence electrons in its valence shell.
B. [tex]ClO_{3}[/tex]- also has an expanded octet, as the central chlorine atom is bonded to three oxygen atoms and has a total of 10 valence electrons in its valence shell.
C. [tex]H_{3} PO_{3}[/tex]-has an electron deficient octet, as the central phosphorus atom is bonded to only three atoms and has a total of 10 valence electrons in its valence shell.
D. [tex]O_{3}[/tex]- has an electron deficient octet, as each oxygen atom is bonded to two other oxygen atoms, resulting in a central oxygen atom with only six valence electrons in its valence shell.
E. [tex]XeF_{2}[/tex] has an electron deficient octet, as the central xenon atom is bonded to two fluorine atoms and has a total of eight valence electrons in its valence shell.
Learn more about octet rule
https://brainly.com/question/30779148
#SPJ4
draw a dash-wedge structure for (2r,4s)-2,4-dibromo-2-chloropentane.
To draw the dash-wedge structure for (2R,4S)-2,4-dibromo-2-chloropentane, we first need to understand the stereochemistry of the molecule.
The prefix (2R,4S) tells us that the two bromine atoms are on the same side (cis) of the molecule, while the chlorine atom is on the opposite side (trans).
Now, let's draw the structure:
1. Start with the structure of pentane:
CH3CH2CH2CH2CH3
2. Replace one of the hydrogen atoms on the second carbon with a chlorine atom:
CH3CH(Cl)CH2CH2CH3
3. Next, we need to add the two bromine atoms, which are both on the same side (cis) of the molecule. We'll add them to carbons 2 and 4:
CH3CH(Cl)CH(Br)CH2(Br)CH3
4. Finally, we need to assign the stereochemistry. Since the bromine and chlorine atoms are both attached to chiral carbons (carbons 2 and 4), we need to use dashes and wedges to show their orientation in 3D space.
The chlorine atom is on the opposite side (trans) of the molecule, so we draw it as a wedge:
Cl
|
CH3C---H
|
CH2
|
CH3C---H
The two bromine atoms are on the same side (cis) of the molecule, so we draw them as dashes:
Br
|
CH3C---H
|
CH(Br)
|
CH3C---H
I hope this helps! Let me know if you have any other questions.
Learn more about hydrogen here:
https://brainly.com/question/28937951
#SPJ11
what is the pe value in an acid mine water sample having [fe3 ] = 7.03e-3m and [fe2 ]=3.71e-4m? fe3 e- fe2 pe° = 13.2
The pe value in the acid mine water sample is approximately 12.641.
To calculate the pe value in an acid mine water sample, we can use the Nernst equation:
pe = pe° + (RT/nF) ln([Fe[tex]^{2+}[/tex]]/[Fe[tex]_{3+}[/tex]])
Given that [Fe3+] = 7.03e-3 M and [Fe[tex]^{2+}[/tex]] = 3.71e-4 M, and pe° = 13.2, we can substitute these values into the equation and solve for pe:
pe = 13.2 + (RT/nF) ln(3.71e-4/7.03e-3)
At room temperature (25°C), the gas constant R = 8.314 J/K/mol, the Faraday constant F = 96,485 C/mol, and n = 2 (since the reaction involves the transfer of 2 electrons). Plugging in these values, we get:
pe = 13.2 + (8.314×298/2/96485) ln(3.71e-4/7.03e-3)
= 13.2 + (-0.559)
= 12.641
Therefore, approximately 12.641 is the pe value in the acid mine water sample.
More on pe value: https://brainly.com/question/16555546
#SPJ11
what is the ph of a 0.01 m solution of hbf4 , pka = −9. clearly show all your work or reasoning and put a box around your answer.
Hydrogen tetrafluoroborate (HBF4) is a strong acid with a pKa of -9. This means that in water, it will donate a proton to form the hydronium ion (H3O+). To find the pH of a 0.01 M solution of HBF4,
we need to calculate the concentration of H3O+ ions. HBF4 → H+ + BF4- Let x be the concentration of H+ ions produced in the solution.
[tex][H+][BF4-]/[HBF4] = Ka[H+][BF4-]/(0.01) = 10^-9[H+][BF4-] = 10^-11[/tex]
Since HBF4 dissociates completely, the concentration of H+ ions is equal to the concentration of HBF4. Therefore:
[tex][H+] = [HBF4] = 0.01 MpH = -log[H+]pH = -log(0.01)pH = 2[/tex]
Therefore, the pH of a 0.01 M solution of HBF4 is 2.
Learn more about HBF4 here:
https://brainly.com/question/31382447
#SPJ11
what is the ph of a 0.0005m solution of (amphetamines)2so4(aq) at 25 ºc if the kb of amphetamine is 1.3 x 10–4?
The pH of a 0.0005 M solution of (amphetamines)₂SO₄(aq) at 25°C is approximately 6.89.
To find the pH of a 0.0005 M solution of (amphetamine)₂SO₄(aq) at 25°C, we need to first determine the concentration of the amphetamine ion, then use the Kb value to find the concentration of H₃O⁺ ions, and finally calculate the pH.
1. Determine the concentration of amphetamine ion:
In (amphetamine)₂SO₄, there are 2 amphetamine ions for every 1 sulfate ion. So, the concentration of amphetamine ions is 2 * 0.0005 M = 0.001 M.
2. Use the Kb value to find the concentration of H₃O⁺ ions:
Kb = [H₃O⁺][A⁻]/[AH]
Where A⁻ is the conjugate base of amphetamine and AH is the protonated amphetamine.
Rearranging the equation for [H₃O⁺]:
[H₃O⁺] = Kb * [AH]/[A⁻]
Since [AH] = [A⁻] (due to the stoichiometry of the reaction), we can simplify the equation:
[H₃O⁺] = Kb * [AH]
Now, we can plug in the values:
[H₃O⁺] = (1.3 x 10⁻⁴) * 0.001 M = 1.3 x 10⁻⁷ M
3. Calculate the pH:
pH = -log10[H₃O⁺]
pH = -log10(1.3 x 10⁻⁷) ≈ 6.89
Therefore, the pH of the 0.0005 M solution of (amphetamine)₂SO₄(aq) at 25°C is approximately 6.89.
Learn more about pH here: https://brainly.com/question/26424076
#SPJ11
A weak acid HA is titrated with strong base. Halfway to the equivalence point, the pH of the solution is 7. What is the value of pKa for HA?Express your answer using at least three significant figures. Do not use scientific notation.
The value of pKa for the weak acid HA in this scenario is 7. To determine the value of pKa for a weak acid HA titrated with a strong base halfway to the equivalence point with a pH of 7, follow these steps:
Step:1. Recall that at the halfway point of the titration, [HA] = [A-], where A- is the conjugate base.
Step:2. Use the Henderson-Hasselbalch equation: pH = pKa + log ([A-]/[HA])
Step:3. Since [HA] = [A-], the ratio [A-]/[HA] is equal to 1.
Step:4. Simplify the equation by taking the log of 1, which is 0: pH = pKa + 0
Step:5. In this case, the pH is given as 7, so the equation becomes: 7 = pKa
Learn more about pKa here, https://brainly.com/question/12273811
#SPJ11
consider the titration of 30 ml of 0.45 m hi with 0.75 m rboh. a. what is the ph at the equivalence point? b. what is ph after 5 ml of rboh has been added?
bThe salt sodium formate can be found at the equivalency point. At pH 7.0, a strong acid or base will titrate to their equivalent point. Although the pH at the equivalence point is larger or lower than 7.0 in titrations of weak acids or bases, respectively.
The solution's pH will be (log 5 0.7CH3COOH = 4.76), which is the equivalency point. 0.200 M HBr, a potent acid, serves as the titrant. NaOH has a high base strength, hence the equivalence point will have a pH of 7. As a result, pH = 7 and H = 7.When 0.100M hydroxyacetic acid and 0.0500M KOH are titrated, the pH at the equivalence point is 8.18.
To know more about strong acid, click here:
https://brainly.com/question/31143763
#SPJ4
2. How many grams of Pbl2 can be dissolved in a 500 mL of a 0.050 M Nal solution? Use activities to calculate your answer. Possibly useful information: The temperature is 25 °C. Ksp of Pbl2 is 7.9 x 10-9 at 25 °C. FW of Pbl2 is 461.01 g/mol. FW of Nal is 149.89 g/mol. = = } C ([A]ZĂ + [B]Z+ [C]Z? +...) logy -0.51 Z3 Vu 1+x/305) K2CNaha tkw [H3O+]= V1+Cnaha / Kal
The solubility of [tex]Pbl_{2}[/tex] in a 0.050 M Nal solution can be calculated using the following equation: 0.028 g of [tex]Pbl_{2}[/tex] can dissolve in 500 mL of a 0.050 M Nal solution at 25°C.
Ksp = [[tex]Pb_{2} ^{+}[/tex]][[tex]2I^{-}[/tex]]
where Ksp is the solubility product constant for [tex]Pbl_{2}[/tex], and [[tex]Pb_{2} ^{+}[/tex]] and [[tex]I^{-}[/tex]] are the molar concentrations of [tex]Pb_{2} ^{+}[/tex] and I- ions, respectively, in solution. Since Nal dissociates completely in solution, we can assume that the molar concentration of [tex]I^{-}[/tex] is equal to the molar concentration of Nal.
Let x be the molar solubility of [tex]Pbl_{2}[/tex] in the Nal solution. Then, at equilibrium, the molar concentrations of [tex]Pb_{2} ^{+}[/tex] and I- are both equal to x. Using the expression for Ksp and the molar concentration of Nal, we can write:
Ksp = x * (2x)
0.050 M = [Nal] = [[tex]I^{-}[/tex]] = x
Solving for x, we get:
x = sqrt(Ksp/2) = sqrt(7.9 x [tex]10^{-9/2}[/tex]) = 1.25 x [tex]10^{-4}[/tex] M
The mass of [tex]Pbl_{2}[/tex] that can dissolve in 500 mL of this solution can be calculated as:
mass of [tex]Pbl_{2}[/tex] = molar solubility x volume of solution x FW of [tex]Pbl_{2}[/tex]
mass of [tex]Pbl_{2}[/tex] = (1.25 x [tex]10^{-4}[/tex] M) x (0.500 L) x (461.01 g/mol) = 0.028 g
Therefore, 0.028 g of [tex]Pbl_{2}[/tex] can dissolve in 500 mL of a 0.050 M Nal solution at 25°C.
Learn more about molar solubility
https://brainly.com/question/15087323
#SPJ4
A balloon is inflated to 665 mL volume at 27°C. It is then cooled down to -78.5°C. What
is its volume, assuming the pressure remains constant?
Answer:
431 mL
Explanation:
This is a question about the relationship between the volume and temperature of a gas. The volume of a gas is directly proportional to its temperature in kelvins when the pressure is held constant. This relationship is described by Charles’s Law.
To solve this problem, we need to convert the temperatures from degrees Celsius to kelvins by adding 273.15. So 27°C is equivalent to 300.15 K and -78.5°C is equivalent to 194.65 K.
Let’s call the initial volume of the balloon V1 and its initial temperature T1. The final volume of the balloon will be V2 and its final temperature T2. According to Charles’s Law, the relationship between these variables can be expressed as:
V1/T1 = V2/T2
Substituting the known values into this equation, we get:
665 mL / 300.15 K = V2 / 194.65 K
Solving for V2, we find that the final volume of the balloon is approximately 431 mL.
Which salt would form an acidic solution when dissolved in water? The Ka of NH: is 5.6 × 10-10 and the Kb of CN-is 1.6×10- Select the correct answer below ○ NH,CN O Naci O NH, Br O More than one solution will be acidic.
The salt that would form an acidic solution when dissolved in water is NH₄CN.
Why would NH₄CN form an acidic solution when dissolved in water?NH₄CN consists of the ammonium ion (NH⁴⁺) and the cyanide ion (CN⁻). NH⁴⁺ is the conjugate acid of NH₃ (ammonia. Ammonia is commonly recognised as a weak base. CN⁻ is the conjugate base of HCN (hydrogen cyanide), which is a weak acid.
The Ka of NH⁴⁺ is 5.6 × 10-10, which means that NH⁴⁺ is a weak acid. The Kb of CN⁻ is 1.6 × 10-5, which means that CN⁻ is a weak base.
When NH₄CN is dissolved in water, NH⁴⁺ can donate a proton to water to form H3O⁺ (hydronium ion) and NH₃, making the solution acidic.
Therefore, NH₄CN would form an acidic solution when dissolved in water.
Learn more about acidic solutions here:
https://brainly.com/question/13632841
#SPJ1
enough of a monoprotic weak acid is dissolved in water to produce a 0.0143 m solution. the ph of the resulting solution is 2.66 . calculate the ka for the acid.
The Ka for the monoprotic weak acid is approximately 3.32 x [tex]10^{-5[/tex].
To calculate the Ka for the monoprotic weak acid, follow these steps:
1. Write the dissociation equation for the weak acid (HA) in water: HA <=> H+ + A-
2. Determine the concentration of H+ ions using the given pH. pH = -log[H+]. So, 2.66 = -log[H+]. Solve for [H+]: [H+] = [tex]10^{-2.66[/tex] ≈ 2.18 x [tex]10^{-3[/tex] M
3. Set up an ICE table (Initial, Change, Equilibrium) for the dissociation reaction:
HA <=> H+ + A-
0.0143 - x <=> x + x
0.0143 - x ≈ 0.0143 (since x is small compared to 0.0143)
4. Use the equilibrium expression for Ka: Ka = [H+][A-]/[HA]. Since [H+] = [A-] = x, and [HA] ≈ 0.0143, the equation becomes: Ka = [tex]x^2[/tex] / 0.0143
5. Plug in the value of x ([H+]) calculated in step 2: Ka = (2.18 x [tex](10^{-3} )^2[/tex]/ 0.0143
6. Calculate Ka: Ka ≈ 3.32 x [tex]10^{-5[/tex]
To know more about "pH" refer here:
https://brainly.com/question/30761746#
#SPJ11
A precipitation reaction occurs when a solution of potassium carbonate is reacted with aqueous magnesium chloride. Write a balanced total molecular equation for this reaction. Identify the spectator ions in the reaction. Write a balanced net ionic equation for the reaction. Be sure to include states of matter.
The total molecular equation for the precipitation reaction between a solution of potassium carbonate and aqueous magnesium chloride is: K₂CO₃(aq) + MgCl₂ (aq) → MgCO₃ (s) + 2KCl (aq).
The spectator ions in this reaction are K+ and Cl-. The net ionic equation for the reaction is: Mg²+ (aq) + CO₃2- (aq) → MgCO₃ (s).
The reaction involves the precipitation of magnesium carbonate, which is the solid product of the reaction. This occurs when the anion of one reactant, carbonate, is combined with the cation of the other reactant, magnesium.
The spectator ions, which are ions that do not directly participate in the reaction, are K+ and Cl-, which come from the potassium carbonate and magnesium chloride, respectively. The net ionic equation shows the actual reaction taking place between the magnesium cation and the carbonate anion.
Know more about precipitation reaction here
https://brainly.com/question/29762381#
#SPJ11
(2S,5S)-2-bromo-5-chlorohexane
* Use only one equivalent of NaI
A) Draw the major SN2 product when the substrate above is treated with sodium iodie in acetone.
B) Name the product above.
A) The major SN2 product will be (2R,5S)-2-iodo-5-chlorohexane.
B) The name of the product is (2R,5S)-2-iodo-5-chlorohexane.
A) To draw the major SN2 product when (2S,5S)-2-bromo-5-chlorohexane is treated with one equivalent of sodium iodide (NaI) in acetone, follow these steps:
1. Identify the substrate: (2S,5S)-2-bromo-5-chlorohexane
2. Identify the nucleophile: Sodium iodide (NaI)
3. Choose the most reactive electrophilic site for the reaction: The bromine atom at the 2 position is more reactive than the chlorine atom at the 5 position because iodide is a better nucleophile than chloride.
4. Perform the SN2 reaction: The iodide ion (I-) will displace the bromine atom at the 2 position through an SN2 mechanism, inverting the stereochemistry at the carbon.
5. Draw the product: The major SN2 product will be (2R,5S)-2-iodo-5-chlorohexane.
B) The name of the product is (2R,5S)-2-iodo-5-chlorohexane.
learn more about acetone Refer: https://brainly.com/question/13334667
#SPJ11
When we are on an airplane above the clouds, why does it look like we're passing up each cloud very slowly even though we're going about 500 mph?
Answer:
When we are on an airplane above the clouds, it can appear as if we're passing each cloud slowly because there is no frame of reference to judge our speed. Our eyes can't detect any movement on the ground, and there are no other objects in the sky to provide a sense of speed or motion. Additionally, clouds are often quite large, so it can take several minutes to pass over one even at high speeds. This can create the illusion that we're moving slowly, even though we're actually traveling at several hundred miles per hour. Our brains are not accustomed to seeing objects at such a high altitude and speed, so it can be difficult to accurately judge our motion relative to the clouds.
What is the proeutectoid phase for an iron–carbon alloy in which the mass fractions of total ferrite and total cementite are 0.90 and 0.1, respectively?
The proeutectoid phase for an iron-carbon alloy with mass fractions of 0.90 total ferrite and 0.10 total cementite is ferrite.
To explain, in an iron-carbon alloy system, the proeutectoid phase is the phase that forms before the eutectoid reaction occurs. The eutectoid reaction happens at 0.76 wt% carbon in the iron-carbon phase diagram.
In this specific alloy, the mass fractions are 0.90 total ferrite and 0.10 total cementite, which means that the alloy has a lower carbon content compared to the eutectoid composition (less than 0.76 wt% carbon).
Since ferrite is the stable phase at lower carbon concentrations, the proeutectoid phase for this alloy is ferrite. The microstructure will mainly consist of ferrite, with some small amounts of cementite dispersed within it.
To know more about proeutectoid phase click on below link:
https://brainly.com/question/15937103#
#SPJ11
Identify the diatomic molecule that is ionic in its pure state.Identify the molecule or molecules containing polar covalent bonds.Please explain!!!
A diatomic molecule consists of two atoms bonded together. In its pure state, a diatomic molecule that is ionic would be lithium hydride (LiH).
This is because lithium (Li) loses an electron to become positively charged, while hydrogen (H) gains an electron to become negatively charged, resulting in an ionic bond.
Molecules containing polar covalent bonds are those where the atoms have differing electronegativities, causing an uneven distribution of electron density.
Examples of diatomic molecules with polar covalent bonds include hydrogen chloride (HCl), hydrogen fluoride (HF), and hydrogen bromide (HBr). In these cases, the halogens (Cl, F, Br) are more electronegative than hydrogen, leading to a polar bond where the electrons are closer to the halogen atoms.
Learn more about diatomic here:
https://brainly.com/question/11815815
#SPJ11
a 36.0 g sample contains 14.6 g cl and 21.4 g b. what is the percent composition of boron in this sample?
In the sample provided, boron makes up 59.4% of the total makeup.
What percentage of this sample contains boron?
We must first determine the overall mass of the sample and then the mass of boron in the sample in order to determine the percent composition of boron in the given sample.
Sample mass overall is 36.0 g.
Chlorine mass in the sample is 14.6 g.
The sample's boron weight is 21.4 g.
As a result, the sample's boron content can be determined using the formula:
% composition of boron is calculated as follows: (mass of boron / total mass of sample) x 100%; (21.4 g / 36.0 g) x 100%; % composition of boron = 0.594 x 100%; and % composition of boron = 59.4%
To know more about composition visit:
https://brainly.com/question/29525205
#SPJ1
Use the bond energies in Table 7.2 to calculate the standard enthalpy change (∆H∘) of the following reaction. Your answer should be kJ. a. Cl2(g)⟶2Cl(g) b. 2N(g)⟶N2(g) c. CH4(g)+Cl2(g)⟶CH3Cl(g)+HCl(g) d. CH4(g)+2H2O(g)⟶4H2(g)+CO2(g)
Using the bond energies to calculate the standard enthalpy change (∆H₀) of the following reaction are:
Cl₂(g)⟶2Cl(g) ∆H₀ = 4.02 x 10⁻²² 2N(g)⟶N₂(g) ∆H₀ = 15.64 x 10⁻²²CH₄(g)+Cl₂(g)⟶CH₃Cl(g)+HCl(g) ∆H₀ = - 1.727 x 10⁻²²CH₄(g)+2H₂O(g)⟶4H₂(g)+CO₂(g) ∆H₀ = -6.37 x 10⁻²².Bond Energy, commonly referred to as average bond enthalpy or just bond enthalpy, is a measurement that provides information about how strong a chemical bond is. "The average value obtained from the bond dissociation enthalpies (in the gaseous phase) of all the chemical bonds of a particular type in a given chemical compound," is how the word "bond energy" is defined by the IUPAC. As a result, the average amount of energy needed to break one of these chemical bonds may be thought of as the bond energy of a chemical bond in a specific molecule.
a) Cl₂(g)⟶2Cl(g)
∆H₀ = ( 242 kJmol-1)/Na = 4.02 x 10⁻²²
b) 2N(g)⟶N₂(g)
∆H₀ = ( 942 kJmol-1)/Na = 15.64 x 10⁻²²
c) CH₄(g)+Cl₂(g)⟶CH₃Cl(g)+HCl(g)
∆H₀ =(413+242-328-431)/Na = -1.727 x 10⁻²²
d) CH₄(g)+2H₂O(g)⟶4H₂(g)+CO₂(g)
∆H₀ =(( 4*413)+(4*463)-(4*436)-(2*1072))/Na = -6.37 x 10⁻²².
It is essential to remember that the average value of each chemical bond's individual bond dissociation enthalpies constitutes the bond energy of a chemical bond inside a molecule. The average of the bond dissociation energies of each individual carbon-hydrogen bond, for instance, determines the bond energy of the carbon-hydrogen bond in the methane (CH4) molecule.
Learn more about Bond energies:
https://brainly.com/question/12648422
#SPJ4
Calculate the mass of glucose ( C6H12O6 ) in a 110 ml sample of a 1.02 m glucose solution.
The mass of glucose in a 110 mL sample of a 1.02 M glucose solution is 20.02 g.
To find the mass of glucose, follow these steps:
1. Convert the volume of the solution to liters: 110 mL = 0.110 L.
2. Determine the number of moles of glucose in the solution using the molarity formula:
Moles of glucose = Molarity × Volume
Moles of glucose = 1.02 M × 0.110 L = 0.1122 mol
3. Calculate the molar mass of glucose (C₆H₁₂O₆) using the periodic table:
Molar mass = (6 × C) + (12 × H) + (6 × O)
Molar mass = (6 × 12.01) + (12 × 1.01) + (6 × 16.00) = 180.18 g/mol
4. Find the mass of glucose by multiplying the number of moles by the molar mass:
Mass of glucose = Moles × Molar mass
Mass of glucose = 0.1122 mol × 180.18 g/mol = 20.02 g
To know more about periodic table click on below link:
https://brainly.com/question/11155928#
#SPJ11
what are the product(s) from the reaction of compound a with kmno4 in acid?Dicarboxylic AcidCarboxylic Acid and CO2Ketone and AldehydeKetone and CO2
The product from the reaction of compound A with KMnO₄ in acid would be dicarboxylic acid, carboxylic acid, and CO₂ (Option A).
KMnO₄ in acid is a strong oxidizing agent that would convert any aldehyde or ketone functional groups into carboxylic acid functional groups. In the case of compound A, which has two carbonyl functional groups, both of them would be converted into carboxylic acid functional groups, resulting in the formation of dicarboxylic acid. The reaction would also produce CO₂ as a byproduct. Therefore, the product(s) from the reaction of compound A with KMnO₄ in acid are dicarboxylic acid, carboxylic acid, and CO₂.
Learn more about dicarboxylic acid: https://brainly.com/question/28265580
#SPJ11
0.175 moles of calcium nitrate are dissolved in a total of 50.00 ml of solution. a) calculate the molarity of the solution. b) how many grams of calcium nitrate are dissolved in this solution?
a) To calculate the molarity of the solution, use the formula: Molarity = moles of solute / volume of solution in liters.
Given 0.175 moles of calcium nitrate and 50.00 mL of solution, first convert the volume to liters: 50.00 mL * (1 L / 1000 mL) = 0.050 L, Now, calculate the molarity: Molarity = 0.175 moles / 0.050 L = 3.50 M. So, the molarity of the solution is 3.50 M.
(b) To find the grams of calcium nitrate dissolved in the solution, first determine the molar mass of calcium nitrate (Ca(NO₃)₂):
Ca = 40.08 g/mol
N = 14.01 g/mol
O = 16.00 g/mol.
Molar mass of Ca(NO₃)₂ = 40.08 + 2(14.01 + 3(16.00)) = 164.10 g/mol
Now, multiply the moles of calcium nitrate by its molar mass: 0.175 moles * 164.10 g/mol = 28.7175 g
Therefore, 28.72 grams of calcium nitrate are dissolved in the solution (rounded to two decimal places).
To know more about molarity click here
brainly.com/question/23686981
#SPJ11
Describe how to prepare 100 ml of 0.200 m acetate buffer, ph 5.00, stating with pure liquid acetic acid and solutions containing 3m hcl and 3mnaoh
To prepare 100 mL of 0.200 M acetate buffer with a pH of 5.00, you'll need to mix appropriate amounts of acetic acid, 3 M HCl, and 3 M NaOH.
1. Calculate the required moles of acetate buffer: 0.200 M * 0.100 L = 0.020 moles.
2. Determine the ratio of acetic acid (CH₃COOH) to sodium acetate (CH₃COONa) using the Henderson-Hasselbalch equation: pH = pKa + log ([CH₃COONa] / [CH₃COOH]). The pKa of acetic acid is 4.74.
3. Calculate the required moles of CH₃COOH and CH₃COONa using the ratio from step 2.
4. Mix the required moles of CH₃COOH with an appropriate amount of 3 M HCl or 3 M NaOH to convert it into CH₃COONa.
5. Adjust the final volume to 100 mL with distilled water.
By following these steps, you'll create 100 mL of 0.200 M acetate buffer at a pH of 5.00 using pure liquid acetic acid, 3 M HCl, and 3 M NaOH.
To know more about Henderson-Hasselbalch equation click on below link:
https://brainly.com/question/13423434#
#SPJ11
16.047 g of nh4cl(s) (mw = 53.45, kb nh3 = 1.79 × 10-5) is added to 25 ml of 6 m naoh(aq) (mw = 40). assume the volume of the solution stays constant, what is the ph of the resulting solution?
the pH of the solution after 5.00 mL of 0.125 M HClO4 have been added is 12.98.
The balanced chemical equation for the reaction between KOH and HClO4 is:
KOH + HClO4 -> KClO4 + H2O
From this equation, we can see that the stoichiometry of the reaction is 1:1, which means that 1 mole of HClO4 reacts with 1 mole of KOH.
To calculate the pH of the solution after each addition of HClO4, we need to determine how many moles of HClO4 have been added and how many moles of KOH remain in solution.
At the start of the titration, the number of moles of KOH in the sample is:
moles of KOH = concentration × volume = 0.150 mol/L × 0.0200 L = 0.00300 mol
When we add x moles of HClO4, they will react completely with x moles of KOH. Therefore, the number of moles of KOH remaining in solution after x moles of HClO4 have been added is:
moles of KOH remaining = 0.00300 mol - x mol
The volume of HClO4 required to react completely with all the KOH is given by:
moles of HClO4 = moles of KOH = 0.00300 mol
volume of HClO4 = moles of HClO4 / concentration of HClO4 = 0.00300 mol / 0.125 mol/L = 0.0240 L
So, we need 0.0240 L of 0.125 M HClO4 to react completely with the KOH in the sample.
To calculate the pH after a certain volume of HClO4 has been added, we can use the following steps:
1. Calculate the number of moles of HClO4 that have been added.
2. Calculate the number of moles of KOH remaining in solution.
3. Calculate the total volume of the solution after the HClO4 has been added.
4. Calculate the concentration of the remaining KOH.
5. Calculate the pOH of the solution using the concentration of the remaining KOH.
6. Calculate the pH of the solution using the formula pH = 14 - pOH.
For example, if 5.00 mL of 0.125 M HClO4 have been added, the number of moles of HClO4 added
is:
moles of HClO4 = concentration × volume = 0.125 mol/L × 0.00500 L = 0.000625 mol
The number of moles of KOH remaining in solution is:
moles of KOH remaining = 0.00300 mol - 0.000625 mol = 0.00238 mol
The total volume of the solution after the HClO4 has been added is:
total volume = initial volume + volume of HClO4 = 20.0 mL + 5.00 mL = 25.0 mL = 0.0250 L
The concentration of the remaining KOH is:
concentration of KOH = moles of KOH remaining / total volume = 0.00238 mol / 0.0250 L = 0.0952 mol/L
The pOH of the solution is:
pOH = -log[OH-] = -log(0.0952) = 1.020
The pH of the solution is:
pH = 14 - pOH = 14 - 1.020 = 12.98
Therefore, the pH of the solution after 5.00 mL of 0.125 M HClO4 have been added is 12.98.
Visit to know more about pH :-
https://brainly.com/question/172153
#SPJ11
Rank the following compounds in order of increasing strength of intermolecular forces. HF
HCI
H2
F2 Select one:
(A) H2 < HCI < HF < F2
(B) HF < F2 < HCI < H2
(C) H2< F2 < HCI < HE
(D) HCI < HF < < F2 < H2
Compounds in order of increasing strength of intermolecular forces H2 < HCI < HF < F2
The strength of intermolecular forces depends on the type of forces present. Hydrogen bonds are the strongest, followed by dipole-dipole interactions, and then London dispersion forces. H2 and F2 have nonpolar covalent bonds, so they only exhibit London dispersion forces. Since H2 has a smaller molar mass than F2, it has weaker London dispersion forces.
HCl is a polar molecule, resulting in dipole-dipole interactions, which are stronger than London dispersion forces. HF forms hydrogen bonds, which are the strongest intermolecular forces among the given compounds. The presence of F, a highly electronegative element, enables HF to form strong hydrogen bonds, resulting in the highest intermolecular force strength.
To learn more about intermolecular forces click here
brainly.com/question/9007693
#SPJ11
Calculate the pOH of a solution that contains 3.9 x 10-6 M H3O+ at 25°C.
Here is what I have worked out so far:
(3.9*10^-6)[OH-] = (1.0*10^-14)
[OH-] = (1.0*10^-14) / (3.9*10^-6) = 2.56*10^-9
pOH = -log[OH-]
pOH = -log(2.56*10^-9) = 19?
with a result > 14 I don't think It's correct and am not sure what I am doing wrong.
The pOH of the solution containing 3.9 x 10-6 M H3O+ at 25°C is approximately 8.59.
To calculate the pOH of a solution that contains 3.9 x 10-6 M H3O+ at temperature 25°C, follow these steps:
1. First, we need to determine the pH of the solution using the H3O+ concentration. The pH is calculated using the formula: pH = -log[H3O+], where [H3O+] is the concentration of hydronium ions.
2. Plug in the H3O+ concentration: pH = -log(3.9 x 10-6)
3. Calculate the pH: pH ≈ 5.41
4. Next, we'll find the pOH using the relationship between pH and pOH at 25°C. For this temperature, the sum of pH and pOH is always 14: pH + pOH = 14
5. Solve for pOH: pOH = 14 - pH
6. Substitute the calculated pH value: pOH = 14 - 5.41
7. Calculate the pOH: pOH ≈ 8.59
So, the pOH of the solution containing 3.9 x 10-6 M H3O+ at 25°C is approximately 8.59.
Learn more about pH and pOH : https://brainly.com/question/17144456
#SPJ11