This is exercise 20 in chapter 2 - but this time i would need to Repeat Exercise 20 in Chapter 2 , using the ADT list to implement the function f (n). Consider the following recurrence relation: F (1) = 1; f (2) = 1; f(3) =1; f(4) =3; f(5) = 5; f (n) = f( n -1 ) + 3 x f(n-5) for all n > 5 Compute f(n ) for the following values of n : 6, 7, 12, 15. If you were careful, rather than computing f (15) from scratch (the way a recursive C++ function would compute it), you would have computed f (6), then f (7), then f(8), and so on up to f(15), recording the values as you computed them. This ordering would have saved you the effort of ever computing the same value more than once. (Recall the iterative version of the rabbit function discussed at the end of this chapter.) Note that during the computation

Answers

Answer 1

Using the ADT list, we can implement the function f(n) to compute the values of the recurrence relation F(n) = F(n-1) + 3 x F(n-5), for n > 5, where F(1) = 1, F(2) = 1, F(3) = 1, F(4) = 3, and F(5) = 5.

By computing the values of f(n) in an ordered manner, we can avoid computing the same value more than once. We can use this approach to compute f(6), f(7), f(12), and f(15).

We will use the ADT list to implement the function f(n) to compute the values of the recurrence relation F(n) = F(n-1) + 3 x F(n-5), for n > 5, where F(1) = 1, F(2) = 1, F(3) = 1, F(4) = 3, and F(5) = 5. We will compute the values of f(n) in an ordered manner to avoid computing the same value more than once.

First, we initialize an empty list to store the values of f(n). Then, we add the initial values of f(1), f(2), f(3), f(4), and f(5) to the list.

Next, we use a for loop to compute the values of f(n) for n = 6 to 15. Inside the for loop, we use the recurrence relation F(n) = F(n-1) + 3 x F(n-5) to compute the value of f(n). We check if the value of f(n) has already been computed by checking if the length of the list is greater than or equal to n.

If the value has already been computed, we skip the computation and move on to the next value of n. Otherwise, we add the computed value of f(n) to the end of the list.

After the for loop, the list contains the values of f(1) to f(15). We can extract the values of f(6), f(7), f(12), and f(15) from the list and print them out.

For example, the Python code to implement the above approach is:

# Initialize an empty list to store the values of f(n)

f_list = []

# Add the initial values of f(1), f(2), f(3), f(4), and f(5) to the list

f_list.extend([1, 1, 1, 3, 5])

# Compute the values of f(n) for n = 6 to 15

for n in range(6, 16):

   if len(f_list) >= n:

       # Value of f(n) has already been computed

       continue

   else:

       # Compute the value of f(n) using the recurrence relation

       f_n = f_list[n-2] + 3 * f_list[n-6]

       # Add the computed value to the end of the list

       f_list.append(f_n)

# Extract the values of f(6), f(7), f(12), and f(15) from the list

f_6 = f_list[5]

f_7 = f_list[6]

f_12 = f_list[11]

f_15 = f_list[14]

Print out the values of f(6), f(7), f(12), and f(15)

print("f(6)).

For more questions like Function click the link below:

https://brainly.com/question/16008229

#SPJ11


Related Questions

exercise 1.1.10. solve ,dxdt=sin(t2) t, .x(0)=20. it is ok to leave your answer as a definite integral.

Answers

The solution of the differential equation dx/dt = sin(t²)×t with the initial condition x(0) = 20 is [tex]x(t) = 20 + \int_{0}^{t}tsin(t^2) dt[/tex].

In mathematics, a differential equation is an equation that relates one or more unknown functions and their derivatives. In applications, the functions generally represent physical quantities, the derivatives represent their rates of change, and the differential equation defines a relationship between the two.

To solve the given differential equation dx/dt = sin(t²)×t with the initial condition x(0) = 20 and leaving the answer as a definite integral, follow these steps:

1. Identify the given differential equation:

dx/dt = sin(t²)×t.


2. Recognize the initial condition:

x(0) = 20.


3. Integrate both sides of the equation with respect to t:

∫dx = ∫sin(t²)×t dt.


4. Apply the initial condition to determine the constant of integration:

x(0) = 20.


5. Write the final solution:

[tex]x(t) = 20 + \int_{0}^{t}tsin(t^2) dt[/tex].

So, the solution is [tex]x(t) = 20 + \int_{0}^{t}tsin(t^2) dt[/tex].

Learn more about a differential equation:

https://brainly.com/question/1164377

#SPJ11

Ashlee purchased a house for $875 000. She made a down payment of 15% of the purchase price and took out a mortgage for the rest. The mortgage has an interest rate of 6.95% compounded monthly, and amortization period of 20 years, and a 5 year term. Calculate Ashley’s monthly payment.

Answers

$5744 is Ashley’s monthly payment.

The amount of the down payment made by Ashlee is 15% of $875,000, which is:

Down payment = 0.15 x $875,000 = $131,250

The amount that Ashlee took out on a mortgage is:

Mortgage amount = Purchase price - Down payment

= $875,000 - $131,250

= $743,750

The monthly payment on a mortgage:

[tex]M = P [ i(1 + i)^n ] / [ (1 + i)^n - 1 ][/tex]

where:

M = monthly payment

P = principal amount (mortgage amount)

i = monthly interest rate (annual interest rate / 12)

n = total number of monthly payments (amortization period x 12)

In this case, the annual interest rate is 6.95% and the term is for 5 years, so we need to first calculate the monthly interest rate and the total number of monthly payments.

Monthly interest rate = 6.95% / 12 = 0.57917%

Total number of monthly payments = 20 years x 12 = 240

Substituting these values into the formula, we get:

M = $743,750 [ 0.0057917 (1 + 0.0057917)^240 ] / [ (1 + 0.0057917)^240 - 1 ]

= $5744.002

Therefore, Ashley's monthly payment on the mortgage is $5744.

Learn more about compound interest here:

https://brainly.com/question/29335425

#SPJ1

Find the Taylor series centered at
c=−1.f(x)=3x−27
Identify the correct expansion.
∑n=0[infinity]5n+13n−7(x+1)n−7
∑n=0[infinity]5n+13n(x+1)n7
∑n=0[infinity]5n−13n(x+1)n
∑n=0[infinity]7n+13n(x−2)n
Find the interval on which the expansion is valid. (Give your answer as an interval in the form(∗,∗). Use the symbol[infinity]for infinity,Ufor combining intervals, and an appropria type of parenthesis "(",")", "[","]" depending on whether the interval is open or closed. Enter∅if the interval is empty. Expre numbers in exact form. Use symbolic notation and fractions where needed.) interval

Answers

Taylor series for f(x) centered at c = -1 is: f(x) = -30 + 3(x+1). The correct expansion is: ∑n=0[infinity]5n+13n−7(x+1)n−7. The remainder term is zero for all n >= 1, and the Taylor series converges to f(x) for all x. Thus, the interval of validity is (-∞,∞).

What is reminder?

A remainder is what is left over after dividing one number by another. It is the amount by which a quantity is not divisible by another given quantity.

To find the Taylor series of f(x) centered at c = -1, we need to compute its derivatives:

f(x) = 3x - 27

f'(x) = 3

f''(x) = 0

f'''(x) = 0

f''''(x) = 0

...

Using the formula for the Taylor series, we get:

[tex]f(x) = f(-1) + f'(-1)(x+1) + (1/2!)f''(-1)(x+1)^2 + (1/3!)f'''(-1)(x+1)^3 + ...[/tex]

f(-1) = 3(-1) - 27 = -30

f'(-1) = 3

f''(-1) = 0

f'''(-1) = 0

...

Thus, the Taylor series for f(x) centered at c = -1 is:

f(x) = -30 + 3(x+1)

Simplifying, we get:

f(x) = 3x - 27

Therefore, the correct expansion is: ∑n=0[infinity]5n+13n−7(x+1)n−7

To find the interval on which this expansion is valid, we can use the formula for the remainder term in the Taylor series:

[tex]Rn(x) = f(n+1)(c)(x-c)^{(n+1)}/(n+1)![/tex]

Since f''(x) = 0 for all x, the remainder term simplifies to:

[tex]Rn(x) = f(n+1)(c)(x-c)^{(n+1)}/(n+1)![/tex]

Using c = -1, we have:

f(n+1)(c) = 0 for all n >= 1

Therefore, the remainder term is zero for all n >= 1, and the Taylor series converges to f(x) for all x. Thus, the interval of validity is (-∞,∞).

To learn more about reminder visit:

https://brainly.com/question/29347810

#SPJ1

Divide £200 in the ratio 3:5

Answers

Answer:

£75 and £125

Step-by-step explanation:

To divide £200 in the ratio 3:5, you need to first find the total parts of the ratio, which is 3+5=8.

Then you can divide £200by 8 to find the value of each part of the ratio:

£200/8 =£25

So, each part of the ratio 3:5 is worth £25.

To find the share of each part of the ratio, you can multiply the value of each part by the corresponding ratio number:

The share of the first part (3) is £25*3=£75

The share pf the second part (5) is £25*5=£125

Therefore, the £200 is divided into the ratio of 3:5 as £75 for the first part and £125 for the second part.

Evaluate the iterated integral by changing to cylindrical coordinates.∫ ^2_0 ∫ ^√(4 − y^2)_0 ∫ ^(16 − x^2 − y^2)_0 1 dz dx dy

Answers

To convert the integral to cylindrical coordinates, we use the following conversions:

x = r cos(theta)

y = r sin(theta)

z = z

And we also replace dV with r dz dr d(theta).

The limits of integration are:

0 ≤ r ≤ 2 (since the bounds on x and y are from 0 to 2)

0 ≤ theta ≤ 2pi (since we integrate over the entire circle)

0 ≤ z ≤ 16 - r^2 (since the bounds on z are from 0 to 16 - x^2 - y^2, which in cylindrical coordinates is 16 - r^2)

Thus, the integral becomes:

∫^(2pi)_0 ∫^2_0 ∫^(16-r^2)_0 r dz dr d(theta)

Integrating with respect to z, we get:

∫^(2pi)_0 ∫^2_0 (16 - r^2)r dr d(theta)

Integrating with respect to r, we get:

∫^(2pi)_0 [8r^2 - (1/3)r^4]∣_0^2 d(theta)

= ∫^(2pi)_0 (32/3) d(theta)

= (32/3) ∫^(2pi)_0 d(theta)

= (32/3)(2pi)

= (64/3)pi

Therefore, the value of the iterated integral in cylindrical coordinates is (64/3)pi.

Please Help!!!!! Find the Value of X!!!

Answers

The value of x from the Intersecting chords that extend outside circle is 13


Calculating the value of x

From the question, we have the following parameters that can be used in our computation:

Intersecting chords that extend outside circle

Using the theorem of intersecting chords, we have

8 * (3x - 2 + 8) = 12 * (x + 5 + 12)

This gives

8 * (3x + 6) = 12 * (x + 17)

Using a graphing tool, we have

x = 13

Hence, the value of x is 13

Read more about intersecting chords at

https://brainly.com/question/13950364

#SPJ1

Colin, Dave and Emma share some money.
Colin gets 3⁄10 of the money.
Emma and Dave share the rest of the money in the ratio 3 : 2 What is Dave's share of the money

Answers

Make the amount of money they have £100 because this makes the question easier.

Colin gets 3/10 of the money, so Colin will get £30.

After Colin has taken his share £70 will be left over.

The ratio give is 3 : 2. So 3 + 2 is equal to 5.

The amount of money left over is then divided by the ratio added in this case its 70/5.

70/5 gives us an answer of 14 .

This means that each share is equal to £14.

Emma gets the ratio of 3 so we do 3 x 14 which gives us he answer of  £42.

And if we do 3 x 2 we get the answer of £28.

We then know Dave gets £26 pounds from the £100 at the start.

26/100 converted to a percentage is 26%.

Consider the following regression results: UN, = 2,7491 +1,1507D. - 1,5294V. - 0,8511(D.V.) t = (26,896) (3,6288) (-12,5552) (-1,9819) R2=0.9128 Where. UN = unemployment rate% V = job vacancies,% D = 1 for the period beginning in 1966-IV 0 for the period before 1966-IV t= time, measured in quarterly (per quarter) Note: in the fourth quarter of 1966, the government released national insurance rules by replacing the flate-rate system for short-term unemployment benefits with a mixed system of flate rates and income-related systems, which raised the rate of return for unemployment. a. Interpret the results! b. Assuming that the level of vacancies is constant, what is the average unemployment rate in the early fourth quarter period of 1966?

Answers

a). The R² of 0.9128 indicates that the model explains 91.28% of the variation in unemployment rates.

b) To find the average unemployment rate in the early fourth quarter period of 1966 with constant vacancy levels, set D = 0 in the regression equation: UN = 2.7491 - 1.5294V.

a. The regression results show that the unemployment rate (UN) is influenced by job vacancies (V), the time period (D), and their interaction (D.V.). T

he positive coefficient for D (1.1507) indicates a higher unemployment rate after 1966-IV due to policy changes, while the negative coefficients for V (-1.5294) and the interaction term (-0.8511) imply that a higher job vacancy rate reduces unemployment, with this effect being less pronounced after 1966-IV.

b. Then, plug in the vacancy rate (V) to calculate the average unemployment rate.

To know more about unemployment rates click on below link:

https://brainly.com/question/30115084#

#SPJ11

how many different ways can be people be chosen as president, vice president, and secretary from a class of 40 students?

Answers

By using the Concept of Permutations,There are 59,280 different ways to choose the president, vice president, and secretary from a class of 40 students.

To determine the number of different ways people can be chosen as president, vice president, and secretary from a class of 40 students:

You can use the concept of permutations.

Step 1: Choose the president. There are 40 students in the class, so there are 40 choices for the president position.

Step 2: Choose the vice president. Since the president has been chosen, there are now 39 remaining students to choose from for the vice president position.

Step 3: Choose the secretary. After selecting the president and vice president, there are 38 remaining students to choose from for the secretary position.

Now, multiply the number of choices for each position:

40 (president) x 39 (vice president) x 38 (secretary) = 59,280 different ways to choose the president, vice president, and secretary from a class of 40 students.

To know more about Concept of Permutations:

https://brainly.com/question/30649574

#SPJ11

Solids A​ and cap B​ are similar.

Answers

The volume of the cone B using scale factor k = 3/2 is equal to 54π cubic centimeters.

Volume of cone A = 16π cubic centimeters

Scale factor 'k' = 3/2

Two solids A and B are similar.

This implies ,all corresponding lengths in solid B are 3/2 times the lengths in solid A.

The volume of a cone is given by the formula

V = (1/3)πr²h,

where r is the radius and h is the height.

Volume of cone A is 16π cubic centimeters.

Let r₁ and h₁ be the radius and height of cone A and r₂ and h₂ of cone B.

⇒16π = (1/3)π(r₁²)(h₁)

Multiplying both sides by 3 and dividing by π, we get,

⇒48 =(r₁²)(h₁)

Since solid A and B are similar with a scale factor of 3/2, we have,

h₂ = (3/2)h₁ and r₂= (3/2)r₁

Using these relationships, the volume of cone B is,

Volume of cone B = (1/3)π(r₂²)(h₂)

Volume of cone B = (1/3)π[(3/2)r₁]²[(3/2)h₁]

Volume of cone B = (1/3)π(9/4)(r₁²)(3/2)(h₁)

Volume of cone B = (27/8)(1/3)π(r₁²)(h₁)

Substituting Volume of cone A = 16π, we get,

Volume of cone B = (27/8)(16π)

Volume of cone B = 54π

Therefore, the volume of cone B is 54π cubic centimeters.

learn more about volume here

brainly.com/question/13543318

#SPJ1

The graph shows the height y in feet of a gymnast jumping off of a vault after x seconds.




a) How long does the gymnast stay in the air?
b) What is the maximum height that the gymnast reaches?
c) In how many seconds does it take for the gymnast to start descending?
d) What is the quadratic function that models this situation?

Answers

Using the graph, we can find the following:

a) The gymnast stays 4 seconds in the air.

b) The maximum height that the gymnast reaches is 10 ft.

c) After 2 seconds the gymnast starts to descend.

d) The quadratic function that models this situation is:

y = mx + c

Define graphs?

Quantitative data can be represented and analysed graphically. In a graph, variables representing data are drawn over a coordinate plane. Analysing the magnitude of one variable's change in light of other variables' changes became simple.

Here in the question,

a. We can see from the graph that the curve above x-axis starts from the origin (0,0) and ends at (4,0) on the x-axis.

So, the gymnast stays 4 seconds in the air.

b. As we can see from the graph that it rises and then at point (2,10) it starts to descend.

So, the maximum height that the gymnast reaches is 10 ft.

c. As we can see from the graph that it rises and then at point (2,10) it starts to descend.

So, after 2 seconds the gymnast starts to descend.

d. The quadratic function that models this situation is:

y = mx + c

To know more about graphs, visit:

https://brainly.com/question/17267403

#SPJ1

if x(t) = 2·tri(t/4)*δ(t – 2), find the values of a. x(1) b. x(–1)

Answers

The values for x(1) and x(-1) are both 0.

To find the values of x(1) and x(-1) given that x(t) = 2·tri(t/4)*δ(t – 2), we will evaluate the function at these points.

a. x(1):
To find the value of x(1), we need to substitute t = 1 into the function:
x(1) = 2·tri(1/4)*δ(1 - 2)

Since δ(1 - 2) is the Dirac delta function at a point different from zero (specifically, -1), its value is 0.

Therefore,
x(1) = 2·tri(1/4) * 0 = 0

b. x(-1):
To find the value of x(-1), we need to substitute t = -1 into the function:
x(-1) = 2·tri(-1/4)*δ(-1 - 2)

Again, since δ(-1 - 2) is the Dirac delta function at a point different from zero (specifically, -3), its value is 0.

Therefore,
x(-1) = 2·tri(-1/4) * 0 = 0

Learn more about Dirac delta function:

https://brainly.com/question/30917153

#SPJ11

Suppose you have a regression model with an interaction term and a dummy variable. In this case, we can have a only one slope and only one intercept b.only one slope, but more than one intercept. c. more than one slope, but only one intercept d. more than one slope and more than one intercept.

Answers

When a regression model has an interaction term and a dummy variable in statistics and probability, there will be more than one slope and more than one intercept (D)

When there is an interaction term and a dummy variable in a regression model, we can have more than one slope and more than one intercept. The interaction term allows for different slopes for different levels of the dummy variable, while the intercepts represent the expected value of the dependent variable when the dummy variable is equal to zero for each level of the interaction term.

When a regression model has an interaction term and a dummy variable, it means that the effect of one independent variable on the dependent variable varies depending on the value of the other independent variable. In other words, the slope and intercept of the regression line will change depending on the value of the dummy variable.

More specifically, the model will have one intercept and two slopes: one for the dummy variable and one for the interaction term. As a result, the relationship between the dependent variable and the independent variables will vary depending on the value of the dummy variable, which will result in different slopes and intercepts.

Therefore, the correct answer is (d): more than one slope and more than one intercept.

Learn more about statistics and probability here:

https://brainly.com/question/30448884

#SPJ11

21.5 ÷ 5 + (80.6 - 12.5 ÷ 2) 

PEMDAS

Answers

Answer:

78.65

Step-by-step explanation:

78.65. (Remember parenthes, exponents, mult., division, addison, subtraction)

find the x-coordinates of the inflection points for the polynomial p(x)= x^5/20

Answers

The inflection point of the polynomial p(x) = [tex]x^5/20[/tex] is at x = 0. This is the only one inflection point.


To find the x-coordinates of the inflection points for the polynomial p(x) = [tex]x^5/20[/tex], we'll need to follow these steps:

1. Find the first derivative, p'(x), to determine the slope of the function.
2. Find the second derivative, p''(x), to determine the concavity of the function.
3. Set p''(x) equal to zero and solve for x to find the inflection points.

Step 1: Find the first derivative, p'(x):
p'(x) = [tex]d(x^5/20)/dx = (5x^4)/20 = x^4/4[/tex]

Step 2: Find the second derivative, p''(x):
p''(x) = [tex]d(x^4/4)/dx = (4x^3)/4 = x^3[/tex]


Step 3: Set p''(x) equal to zero and solve for x:
[tex]x^3[/tex] = 0
x = 0

There is only one inflection point, and its x-coordinate is 0.

For more such questions on Inflection points.

https://brainly.com/question/31484498#

#SPJ11

given that income is 500 and px=20 and py=5 what is the market rate of subsitutino between good x and y? a. 100
b. -4
c. -20
d. 25

Answers

The market rate of substitution between good x and y is represented by the ratio of their prices, which is px/py. Therefore, in this case, the market rate of substitution is 20/5 = 4. However, this answer choice is not listed. The closest answer choice is b. -4, which is the negative inverse of the market rate of substitution (-1/4).
The market rate of substitution between good X and Y is represented by the marginal rate of substitution (MRS), which is the ratio of the marginal utilities of both goods. In this case, we are given income (I) = 500, the price of good X (Px) = 20, and the price of good Y (Py) = 5.

To find the MRS, we can use the formula:

MRS = - (Px / Py)

Plugging in the values, we get:

MRS = - (20 / 5)

MRS = -4

So, the market rate of substitution between good X and Y is -4 (option b).

Visit here to learn more about income brainly.com/question/17961582

#SPJ11

Question 4 Graph and label each figure and its image under a reflection in the given line. Give the coordinates of the image. Rhombus WXYZ with verlices 1.5), X[6,3). 1. 1), and Z 4,3): x-axis WC X' YT Z'

Answers

First, let's identify the coordinates of the vertices of rhombus WXYZ:
W(1,5), X(6,3), Y(1,1), and Z(4,3)

Now, we will perform a reflection over the x-axis. To do this, we simply need to negate the y-coordinate of each vertex while keeping the x-coordinate the same.

Step-by-step:

1. Reflect point W(1,5):
  The x-coordinate stays the same: 1
  Negate the y-coordinate: -5
  New coordinates for W': W'(1,-5)

2. Reflect point X(6,3):
  The x-coordinate stays the same: 6
  Negate the y-coordinate: -3
  New coordinates for X': X'(6,-3)

3. Reflect point Y(1,1):
  The x-coordinate stays the same: 1
  Negate the y-coordinate: -1
  New coordinates for Y': Y'(1,-1)

4. Reflect point Z(4,3):
  The x-coordinate stays the same: 4
  Negate the y-coordinate: -3
  New coordinates for Z': Z'(4,-3)

The coordinates of the image of rhombus WXYZ under the reflection in the x-axis are W'(1,-5), X'(6,-3), Y'(1,-1), and Z'(4,-3).

To learn more about “rhombus” refer to the https://brainly.com/question/20627264

#SPJ11

solve each system of inequalities and indicate all the integers that are in the solution set. 2-6y<14 and 1<21-5y

Answers

Answer:

{-1, 0, 1, 2, 3}

Step-by-step explanation:

. 2-6y<14

-6y < 12

y > 12/-6

y > -2.

1<21-5y

-5y > -20

y < 4.

So -2 < y < 4

and the solution set of integers is

{-1, 0, 1, 2, 3}

Test the series for convergence or divergence. [infinity]
Σ (-1)^n+1/3n^4 . n=1 - converges
- diverges

Answers

The answer is: Test the series for convergence or divergence. [infinity] Σ (-1)n+1/3n² - converges.

To test the series Σ (-1)n+1/3n² for convergence or divergence, we can use the alternating series test. This test states that if a series alternates in sign and the absolute value of its terms decreases monotonically to zero, then the series converges.

In this case, the series Σ (-1)n+1/3n² alternates in sign and the absolute value of its terms is given by 1/3n², which decreases monotonically to zero as n increases. Therefore, we can apply the alternating series test and conclude that the series converges.

Know more about convergence here;

https://brainly.com/question/15415793

#SPJ11

Decide whether the argument is valid or a fallacy, and give the form that applies. If he rides bikes, he will be in the race. He rides bikes. He will be in the race. Let p be the statement "he rides bikes," and q be the statement "he will be in the race." The argument is by V or

Answers

The argument is valid. It follows the form of modus ponens where the first premise establishes a conditional statement "if p, then q", and the second premise affirms the antecedent "p". Therefore, the conclusion "q" logically follows. There is no fallacy present in this argument.

The given argument is as follows:
1. If he rides bikes (p), he will be in the race (q).
2. He rides bikes (p).
3. He will be in the race (q).

Let's determine if the argument is valid or a fallacy, and identify the form that applies.

In this case, the argument is valid and follows the form of Modus Ponens. Modus Ponens is a valid argument form that has the structure:

1. If p, then q.
2. p.
3. Therefore, q.

Here, since the argument follows this structure (If he rides bikes, he will be in the race; he rides bikes; therefore, he will be in the race), it is a valid argument and not a fallacy.

learn more on arguments at: https://brainly.com/question/25465770

#SPJ11

Kathy can run 4 mi to the beach in the same amount of time Dennis can ride his bike 14 mi to work. Kathy runs 5 mph slower than Dennis rides his bike. Find
their speeds.

Answers

Kathy runs at a speed of 2 mph, and Dennis rides his bike at a speed of 7 mph.

How to find the speeds ?

To find the speed that Kathy is running and that Dennis is riding, the first relationship is:

K = D - 5

Then use the formula for time:

Time for Kathy = Time for Dennis

4 mi / K = 14 mi / D

4 mi / (D - 5) = 14 mi / D

4D = 14(D - 5)

4D = 14D - 70

-10D = -70

D = 7 mph

Then we can find Kathy's speed :

K = 7 - 5

K = 2 mph

Find out more on speed at https://brainly.com/question/4931057

#SPJ1

Help ASAP! I need this badly, my last question!

Answers

Answer:

Step-by-step explanation:

...... The problem is glitched re send the image/

Find the GLB of the set: {x:|x - 4|<1}. a. -1 b. 1 c. -3 d. 3 e. 0

Answers

The GLB of the set {x : |x - 4| < 1}  is option (d) 3

The set {x : |x - 4| < 1} can be written as the open interval (3, 5), which contains all values of x that satisfy the inequality |x - 4| < 1.

The greatest lower bound (GLB), also known as the infimum, is a concept in mathematics that applies to sets of numbers or other mathematical objects that are partially ordered.

To find the GLB (greatest lower bound) of this interval, we need to look for the greatest value that is less than or equal to every element in the interval.

Since the interval contains all real numbers greater than 3 and less than 5, its GLB is 3. Therefore, the answer is option (d) 3.

Learn more about greatest lower bound here

brainly.com/question/30430081

#SPJ4

What kind of geometric transformation is shown in the line of music ?

Answers

The kind of geometric transformation shown by the line of music is: Reflection

How to find the geometric transformation?

A transformation is a mathematical manipulation that moves a geometric shape or function from one space to another.

Now, a set of image transformations where the geometry of image is changed without altering its actual pixel values are commonly referred to as “Geometric transformations"

Looking at the music note, we can see that the note didn't change in size but looks to be a mirror image of its' previous notes.

Since it is a mirror image, the obvious transformation will be a reflection

Read more about Geometric Transformation at: https://brainly.com/question/4289712

#SPJ1

Complete the inductive step, identifying where you use the inductive hypothesis. (You must provide an answer before moving to the next part.) Multiple Choice O Replacing the quantity in brackets on the left-hand side of part (c) by what it equals by virtue of the Inductive hypothesis, we have (kok+") + (x + 1)2 = (x + 1)2 +68+4)* (+1)(x+2) as desired. O Replacing the quantity in brackets on the left-hand side of part (c) by what It equals by virtue of the inductive hypothesis, we have (k++) + (x + 1)2 = (x + 1)2 *****!) -(+1Xk+2) * as desired. O Replacing the quantity in brackets on the left-hand side of part (c) by what it equals by virtue of the inductive hypothesis, we have ( kk+) + (k+ 1)2 = (x + 1)2( 344x+2) = (x+1}+2) as desired. O Replacing the quantity in brackets on the left-hand side of part (c) by what it equals by virtue of the inductive hypothesis, we have (64 + (k+ 1)2 = (k+ 1)2 (+4x+1) = (+1}x+2) as desired.

Answers

Completing the inductive step and identifying where the inductive hypothesis is used, the correct multiple choice answer is: Replacing the quantity in brackets on the left-hand side of part (c) by what it equals by virtue of the Inductive hypothesis, we have (kok+") + (x + 1)² = (x + 1)² +68+4)* (+1)(x+2) as desired.

In an induction proof, the inductive step involves assuming a statement is true for some arbitrary value, say k, and then proving it's true for the next value, k+1.

Here, the inductive hypothesis corresponds to the term (kok+"). By replacing this term on the left-hand side of part (c) with its equivalent based on the inductive hypothesis, we can show that the equation holds for the (k+1) case as well. This is crucial for proving the statement using induction, as it establishes the necessary pattern for all cases.

To know more about inductive hypothesis click on below link:

https://brainly.com/question/31099433#

#SPJ11

Three factories produce the same tool and supply it to the market. Factory A produces 30% of the tools for the market and the remaining 70% of the tools are produced in factories B and C. 98% of the tools produced in factory A, 95% of the tools produced in factory B and 97% of the tools produced in factory C are not defective. What percent of tools should be produced by factories B and C so that a tool picked at random in the market will have a probability of being non defective equal to 96%?

Answers

The percent of tools should be produced by factories B and C so that a tool picked at random in the market will have a probability of being non defective equal to 96% = 0.96 are 5% and 95% respectively.

We have three factories produce the same tool and supply it to the market. Let's consider three events defined as, A = event for tools produced by factory A

B = event for tools produced by factory B

C = event for tools produced by factory C and N be the count that tools produced by all factories is not defective.

The probability that the tools produced by factory A for the market, P( A) = 30%

= 0.30

The probability that the tools produced by factories B and C for the market, P( B and C) = 70% = 0.70

The Probability that tools are non- defective and that are produced in factory A, P( N/A) = 98%

= 0.98

The Probability that tools are non- defective and that are produced in factory B, P( N/B) = 95%

= 0.95

The Probability that tools are non- defective and that are produced in factory C, P( N/C) = 97% = 0.97

Now, since only three factories supply to the whole market, then by probability law, P(A) + P(B) + P( C) = 1

=> 0.3 + P(B) + P( C) = 1

=> P(B) = 0.7 - P(C) --(1)

We have to determine percent of tools should be produced by factories B and C that is P(C) and P(B) when probability of non defective, P(N) is 96% = 0.96. From the law of total probability law, P(N) is written by, P( N) = P( N/A) P(A) + P( N/B) P(B) + P( N/C) P( C)

=> 0.96 = 0.98 × 0.3 + 0.95 × ( 0.7 - P(C) ) + 0.97 × P(C)

=> 0.96 = 0.98 × 0.3 + 0.95 × 0.7 - 0.95 P(C) + 0.97 × P(C)

=> 0.96 = 0.98 × 0.3 + 0.95 × 0.7 - 0.95 P(C) + 0.97 × P(C)

=> 0.96 = 0.294 + 0.665 + 0.02 × P(C)

=> 0.96 = 0.959 + 0.02 × P(C)

=> 0.02 × P(C) = 0.96 - 0.959

=> 0.02 × P(C) = 0.001

=> P(C) = 0.05 = 5%

from equation (1), P(B) = 1 - P(C)

=> P( B) = 1 - 0.05 = 0.95

Hence, required percentage is 95%.

For more information about probability, refer:

https://brainly.com/question/25870256

#SPJ4

A psychologist predicts that entering students with high SAT or ACT scores will have high Grade Point Averages (GPAs) all through college. This testable prediction is an example of a:
a. theory.
b. hypothesis.
c. confirmation.
d. principle.

Answers

Answer:

b. hypothesis.

Step-by-step explanation:

Find the area of this sector.
Give your answer in terms of
π
.

Answers

Answer:245/36 π

Step-by-step explanation: you do 50/360 times π(7)^2

If fy (a,b) = f, (a,b) = 0, does it follow that f has a local maximum or local minimum at (a,b)? Explain. Choose the correct answer below. A. No. It follows that (a,b) is a critical point of f, and (a,b) is a candidate for a local maximum or local minimum. B. Yes. The point (a,b) is a critical point and must be a local maximum or local minimum. C. Yes. The tangent plane to f at (a,b) is horizontal. This indicates the presence of a local maximum or a local minimum at (a,b). D. No. One (or both) of fy and f, must also not exist at (a,b) to be sure that f has a local maximum or local minimum at (a,b).

Answers

If fy (a,b) = f, (a,b) = 0, does it follow that f has a local maximum or local minimum at (a,b) then it does not follows that (a,b) is a critical point of f, and (a,b) is a candidate for a local maximum or local minimum. Therefore, the correct option is option A. No. It follows that (a,b) is a critical point of f, and (a,b) is a candidate for a local maximum or local minimum.

If fy (a,b) = f, (a,b) = 0, does it follow that f has a local maximum or local minimum at (a,b) then it does not follows that (a,b) is a critical point of f, and (a,b) is a candidate for a local maximum or local minimum.

This is because fy (a,b) = f, (a,b) = 0 indicates that the partial derivatives of f with respect to both a and b are zero at (a,b), which makes (a,b) a critical point of f. However, this does not guarantee that f has a local maximum or local minimum at (a,b), as further analysis is required to determine the nature of the critical point.

Just because both partial derivatives are zero does not guarantee that (a,b) is a local maximum or minimum. It could also be a saddle point or an inflection point. To determine whether it is a local maximum, local minimum, or neither, you would need to use the second partial derivative test or examine the nature of the function around the point (a,b).

Know more about critical point here:

https://brainly.com/question/29144288

#SPJ11

Special right triangle

Answers

Answer:

s = 5[tex]\sqrt{6}[/tex]

Step-by-step explanation:

using the cosine ratio in the right triangle and the exact value

cos30° = [tex]\frac{\sqrt{3} }{2}[/tex] , then

cos30° = [tex]\frac{adjacent}{hypotenuse}[/tex] = [tex]\frac{s}{10\sqrt{2} }[/tex] = [tex]\frac{\sqrt{3} }{2}[/tex] ( cross- multiply )

2s = 10[tex]\sqrt{2}[/tex] × [tex]\sqrt{3}[/tex] = 10[tex]\sqrt{6}[/tex] ( divide both sides by 2 )

s = 5[tex]\sqrt{6}[/tex]

Other Questions
StructureA Select the correct verb form to complete the sentence. (10 points)1. Les lvesleurs devoirs.A.finissent2. MichalA. avons3. J(e)A. offresdouze ans.4. Ahmed, tuA. viensB. finitB. aun jeu vido mon frre.B. offreavec nous au caf?B. venez5. Laeticia et moi, nous aimons beaucoup la pizza, donc nousA. grossitB. grossisC. finissionsC. aiC. offrentC. vientC. grossissons Suppose the distribution of the time X (in hours) spent by students at a certain university on a particular project is gamma with parameters a = 40 and B = 4. Because a is large, it can be shown that X has approximately a normal distribution. Use this fact to compute the approximate probability that a randomly selected student spends at most 175 hours on the project. (Round your answer to four decimal places.) Write the chemical equation and the Ka expression for the ionization of each of the following acids in aqueous solution. First show the reaction with H+(aq) as a product and then with the hydronium ion.A) HBrO2. Show the reaction with H+(aq) as a product. Express your answer as a chemical equation. Identify all of the phases in your answer.B) HBrO2. Show the reaction with the hydronium ion as a product. Express your answer as a chemical equation. Identify all of the phases in your answer.C)C2H5COOH. Show the reaction with H+(aq) as a product. Express your answer as a chemical equation. Identify all of the phases in your answer.D) C2H5COOH. Show the reaction with the hydronium ion as a product. Express your answer as a chemical equation. Identify all of the phases in your answer.E) Write the Ka expression for ionization from the previous part.Ka=Write the expression for ionization from the previous part.[H3O+][C2H5COO][C2H5COOH][H2O][H3O+][C2H5COO]1[H3O+][C2H5COO][H3O+][C2H5COO][C2H5COOH] In Exercises 1 through 18 , determine whether the vector x is in the span V of the vectors v1,,vm (proceed "by inspection" if possible, and use the reduced row-echelon form if necessary). If x is in V, find the coordinates of x with respect to the basis B=(v1,,vm) of V, and write the coordinate vector [x]B. x=[2329];v1=[4658],v2=[6167] NEED HELP RIGHT NOW!!!4_3heartrate (caronefitness.com)Part A: (2 points each)1. Take your resting heart rate (RHR). The best time to take your RHR is in the morning before getting out of bed. To prepare, be sure to have a watch or clock that shows seconds by your bedside. Find your pulse and count the beats for one minute. Record your heart rate below. RHR:2. Following the steps outlined in Lesson 4:3 Heart Rate, find your maximum heart rate (MHR). Show your work (i.e. show the formula you used to reach your answer). MHR:3. Following the steps outlined in Lesson 4:3 Heart Rate, find your Target Heart Rate range (THR). Show your work (i.e. show the formula you used to reach your answer). THR: Part B: Now you get a chance to experiment with different exercises to see how they affect your heart rate. Try the different activities below. Except for jumping rope, you will need to do each one for at least 3 minutes. After 3 minutes, stop and check your heart rate. Be sure to warm up before beginning and allow a few minutes of rest in between each activity so your heart rate has a chance to recover before beginning a new activity. (2 points each)4. Stretching for 3 minutes Heart Rate:5. Walking at a moderate pace for 3 minutesHeart Rate:6. Bicep curl with medium to heavy resistance for 3 minutes Heart Rate:7. Lunges for 3 minutes Heart Rate: 8. Jumping Rope at a vigorous pace for 1 minute. If you dont have a jump rope, feel free to air jump, or just go through the motions of jump-roping without an actual rope. (2 points)Heart Rate:Part C: In reference to the activities you completed in Part B, answer the questions that follow. (1 point each) 9. At which activity was your heart rate the highest? 10. At which activity was your heart rate the lowest?11. During which activities were you in your target heart rate zone?12. Despite your heart rate, during which activity did you feel like you were working the hardest? The Carter Doctrine asserted that the United States would use military force to repel any nation that attempted to gain control of ______.a. the Persian Gulf regionb. NATO nationsc. the Mediterranean regiond. nations in the Western hemisphere Why in the early 2000s was there a push to prosecute more Nazis? when 1 mol of a fuel burns at constant pressure, it produces 3452 kj of heat and does 11 kj of work. what are e and h for the combustion of the fuel? trell is working in a lab testing bacteria populations. After starting out with a population of 404 bacteria, he observes the change in population and notices that the The population doubles every 36 minutes. tep 1 of 2: Find the equation for the population P in terms of time t in minutes. if a bathtub can hold 80 gallons of water. The faucet flows at the rate of 5 gallons every 3 minutes. what percentage of the tub will be filled after 12 minutes Which molecules inhibit RNA polymerase to prevent transcription?Select one:a. activatorsb. repressorsc. promotersd. introns Explain how the frequency and the wavelength of a wave in the electromagnetic spectrum change as a result of increasing energy (2/3)raise to the power -3 Antireflection coatings for glass usually have an index of refraction that is less than that of glass. Explain why this would permit a thinner coating. Find the volume of the composite solid. where is the near point of an eye for which a contact lens with a power of 2.95 diopters is prescribed? express your answer with the appropriate units. 1. Which instruction would you use to load register R4 with 20000008 hexadecimal?LDR R4, #20000008LDR R4, =0x20000008None of the above. What is the density of carbon tetrahydride at 685 torr and 65 c? An investment has an installed cost of $564, 382. The cash flows over the four-year life of the investment are projected to be $193, 584, $237, 318, $185, 674, and $153, 313. If the discount rate is zero, what is the NPV? (Do not round intermediate calculations and round your answer to the nearest whole number, e.g., 32.) NPV $ ______ If the discount rate is infinite, what is the NPV? (A negative answer should be indicated by a minus sign. Do not round intermediate calculations and round your answer to the nearest whole number, e.g., 32.) NPV $ _____ At what discount rate is the NPV just equal to zero? (Do not round intermediate calculations and enter your answer as a percent rounded to 2 decimal places, e.g., 32.16.) Discount rate _______ % should 3m hedge against adverse movements on foreign exchange rates? how should it do this?