Potassium cyanide is a toxic substance, and the median lethal dose depends on the mass of the person or animal that ingests it. The median lethal dose of KCN for a person weighing 215 lb (97.5 kg ) is 8.84×10−3 mol .

What volume of a 0.0250 M KCN solution contains 8.84×10−3 mol of KCN?

Express the volume to three significant figures and include the appropriate units.

Answers

Answer 1

Answer:

0.354L

Explanation:

Given parameters:

Molarity of KCN  = 0.025M

Number of moles  = 8.84 x 10⁻³mol

Unknown:

Volume of KCN  = ?

Solution:

The molarity of a substance is expressed as;

       Molarity  = [tex]\frac{number of moles }{volume }[/tex]  

 Volume of KCN   = [tex]\frac{number of moles }{molarity}[/tex]

Now insert the parameters and solve;

  Volume of KCN  = [tex]\frac{0.00884}{0.025}[/tex]   = 0.354L


Related Questions

What is the mass of one electron in grams if an electron has the charge of
-1.6022 x 10-19C and lg = -1.76 x 108 C.

Answers

The mass of one electron : 9.103 x 10⁻²⁸ g

Further explanation

Electrons are a part of the atomic nucleus particles (including protons and neutrons), and are negatively charged (-1)

An electron has the charge of  -1.6022 x 10⁻¹⁹C

1 g =  -1.76 x 10⁸ C

so the mass of one electron :

[tex]\tt \dfrac{1.6022\times 10^{-19}}{1.76\times 10^8}=9.103\times 10^{-28}~g[/tex]

_________feedback is a type of feedback in which a system is triggered to produce an output.

Answers

Answer:

positive

Explanation:

Answer:

Positive feedback is a type of feedback in which a system is triggered to produce an output.





Explanation:

Have a great rest of your day
#TheWizzer

7. Which of the following is unlikely to
happen to zinc?
A) It is rolled into sheets.
B) It is used to coat a steel hull.
C) It is used in a battery.
D) It is used as an insulator.

Answers

Answer:D) it is used as an insulator

Explanation:

What is the pressure inside a 2.0 L bottle filled with 0.25 mol of carbon dioxide gas at 25 °C?

Answers

Answer:

3.1atm

Explanation:

Given parameters:

Volume of gas = 2L

Number of moles  = 0.25mol

Temperature  = 25°C = 25 + 273  = 298K

Unknown:

Pressure of the gas = ?

Solution:

To solve this problem, we use the ideal gas equation.

This is given as;

       PV  = nRT

P is the pressure

V is the volume

n is the number of moles

R is the gas  constant  = 0.082atmdm³mol⁻¹K⁻¹

T is the temperature

          P  = [tex]\frac{nRT}{V}[/tex]  

 Now insert the parameters and solve;

         P  = [tex]\frac{0.25 x 0.082 x 298}{2}[/tex]   = 3.1atm

Which container has gas stored at the highest temperature

Answers

Answer: 3

Explanation:

Answer:

kinetic energy

Explanation:

may be iam not sure

Use the equation below to solve the problem that follows.

2H2 (g) + O2 (g) → 2H2O (g)

When David reacts 13.8 grams of hydrogen gas with excess oxygen, 87.0 grams of water are formed. Calculate his percent yield of water.

Answers

Percent yield = 70%

Further eplanation

Percent yield is the comparison of the amount of product obtained from a reaction with the amount you calculated

General formula:

Percent yield = (Actual yield / theoretical yield )x 100%

An actual yield is the amount of product actually produced by the reaction. A theoretical yield is the amount of product that you calculate from the reaction equation according to the product and reactant coefficients

Reaction

2H₂ (g) + O₂ (g) → 2H₂O (g)

mass of H₂O (theoretical) :

[tex]\tt mass=mol\times MW(mol~ratio~H_2O\div H_2=2\div 2)\\\\mass=(\dfrac{2}{2}\times \dfrac{13.8}{2})\times 18~g/mol\\\\mass=124.2~g[/tex]

percent yield

[tex]\tt \%yield=\dfrac{87}{124.2}\times 100\%=\boxed{\bold{70\%}}[/tex]

if you had a chance to get a scholarship abroad?what would you do?​

Answers

Answer:

I Would bc it's the better opportunity

Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid

Examples
A. Air
B. seawater
C. marshmallow

Answers

Answer:

sea water

Explanation:

a sea water can match the following

What is filtration .
Will mark as brainliest

Answers

Answer:

the action or process of filtering something or in chemistry separating suspended solid matter from a liquid causing latter to pass through the pores is some substance

It is the action or process of filtering something.

HELPP ME

express with equations the transformations marked on the scheme

Answers

Further explanation

The reaction equation is the chemical formula of reagents and product substances

A reaction coefficient is a number in the chemical formula of a substance involved in the reaction equation. The reaction coefficient is useful for equalizing reagents and products.

Transformations :

1. CaO + H₂O⇒Ca(OH)₂

2. CaO + CO₂⇒CaCO₃

3. Ca(OH)₂+ 2HCl⇒CaCl₂+2H₂O

4. Ca(OH)₂+H₂CO₃⇒CaCO₃+2H₂O

5. CaCO₃⇒CaO+CO₂

Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0°C to water at 89.0°C.

Answers

Answer:

Q = 4019.4 J

Explanation:

Given data:

Mass of ice = 20.0 g

Initial temperature = -10°C

Final temperature = 89.0°C

Amount of heat required = ?

Solution:

specific heat capacity of ice is 2.03 J/g.°C

Formula:

Q = m.c. ΔT

Q = amount of heat absorbed or released

m = mass of given substance

c = specific heat capacity of substance

ΔT = change in temperature

ΔT = T2 - T1

ΔT =  89.0°C - (-10°C)

ΔT = 99°C

Q = 20.0 g ×2.03 J/g.°C × 99°C

Q = 4019.4 J

SECOND SCIENCE WORKSHEET:
Answer the following:
1:
Which type of cell has a cell wall?
2: What is the smallest part of any substance?
3:
What is used to see tiny objects?
4: What name is given to a substance where all the atoms are the
same?
5: What does the safety symbol with flames mean?
6: What gives the ability to do work?
7: Which part of the cell controls all cell activity?
8: By what process does a liquid change to a gas?
I

Answers

Answer:

1 animal cell

2?

3 mircoscope

4?

5 it means whenever you becareful

The diagram is a model of one way that materials move into a cell.


Which Sentence explains what happens in last step?

A. a vacuole carries particles into the cell
B. The cell membrane surrounds particles outside the cell.
C. Phospholipids in the cell membrane allow particles to pass through
D. Transport proteins push particles out of cell.

Answers

Answer:

B. The cell membrane surrounds particles outside the cell.

Explanation:

The last step is when the cell membrane completely surrounds particles outside the cell.

This process is often known as endocytosis.

endocytosis is the process whereby a cell ingests materials by engulfing them using the cell membrane. In this process, the cell membrane completely covers the food.

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

How many molecules of CO2 are contained in 4.40g of CO2

Answers

Answer:

6.02 x 10²²molecules

Explanation:

Given parameters:

Mass of CO₂  = 4.4g

Unknown:

Number of molecules in CO₂  = ?

Solution:

To find the number of molecules in the given mass, we have to find the number of moles in the compound first;

   Number of moles  = [tex]\frac{mass}{molar mass}[/tex]  

Molar mass of CO₂  = 12 + 2(16) = 44g/mol

Insert the parameters and solve;

   Number of moles  = [tex]\frac{4.4g}{44g/mol}[/tex]   =  0.1mol

  1 mole of a substance contains 6.02 x 10²³molecules

  0.1 mole of CO₂ will contain 0.1 x 6.02 x 10²³molecules

                                                 = 6.02 x 10²²molecules

An unbalanced chemical equation is shown:

2NaN3 → 2Na + N2

Which of the following statements explains why the equation is not balanced?

Four molecules of N2 should be produced during the decomposition.
Three molecules of N2 should be produced during the decomposition.
Four molecules of N2 should be produced during the synthesis reaction.
Three molecules of N2 should be produced during the synthesis reaction.

Answers

The correct statement is B. Three molecules of N₂ should be produced during the decomposition. :)

Answer: b

Explanation: I took the quiz

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

PLZ ANSWER! MULTIPLE CHOICE!! MUST BE CORRECT!! I CANNOT GET THIS WRONG.

Answers

The answer is B, the second choice

OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS

What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer

Answers

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

Please help me with my Chemistry homework!! I have so much homework to do for other classes and I’m so stressed so even answering one question would be amazing!!!

1. A graduated cylinder had an initial volume of water of 22 mL. After an iron nail is dropped into the cylinder, the water rises to 38 mL. What is the volume of the nail?

2. Ms.Chavez dropped a gold ring into a graduated cylinder filled with water. The water level was originally at 20 mL. Now the water is at 25mL. Ms.Chavez knows that means the volume of the ring is 5 mL. What else would she have to do to find the density of her ring? Explain.

3. A simple of liquid propanol has a volume of 20.0 cm*^3 and a mass of 15.0 g. What is the density of propanol? Write only your answer below.

Answers

1. 16 mL

2. She need to find the mass, as density is mass divided by volume.

3. 0.75 g/cm^3

Astronomers observed that the orbit of Uranus was not uniform. Therefore, they hypothesized the existence of another planet. This is an example of scientific investigation being led by _____.

Inductive Reasoning
Deductive Reasoning

Answers

Answer:

This is an example of scientific investigation being led by inductive reasoning.

Explanation:

Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.

The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.

What is 13.48cm+7.6cm rounded to the correct number of significant figures?

Answers

The lowest amount of significant figures has to be what the answer is...

7.6cm is 2 sig figs where 13.48 is 4, so the answer can only really be as precise as the smallest one (7.6)

7.6 + 13.48 = 21.08cm

Put it into 2 sig figs makes it
=21 cm (2s.f) <— don’t forget to write 2 sig figs next to it because otherwise it is a false answer

Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?

Answers

Answer:

N2O

Explanation:

hope am right.....

Arrange the elements in order of increasing ionization energy. Use the
periodic table to identify their positions on the table.
Drag each tile to the correct box.
Hola
Tiles
chlorine
fluorine
gallium
phosphorus
Sequence

Answers

Answer:

Gallium - Phosphorous - Fluorine - Chlorine

Explanation:

Answer:

Gallium < Phosphorus < Chlorine < Fluorine

Explanation:

<3

The average speeds of gas molecules in cylinders A, B, C, and D are 0.001 m/s, 0.05 m/s, 0.1 m/s, and 0.5 m/s respectively. Which cylinder contains gas that is closest to absolute zero?​

Answers

Answer:

cylindar a

Explanation:

I took the test

Answer:

A

Explanation:

What is arcade in south Center

Answers

Answer: game stop and mind games

Explanation:

i live near there

the process that breaks down rocks

Answers

Weathering is the breaking down or dissolving of rocks and minerals on earths surface!

How do scientist respond to experimental observations that don’t match current theories?

Answers

Answer: The results of the experimental observations should coincide with the facts of the current theories.

Explanation:

The scientific theory can be defined as the well defined as supported explanation for a natural phenomena. It is based upon the facts observed and also supported by the evidences obtained from the experimental trials.

If the experimental observations do not match with the concept of current scientific theory then the scientific either perform the experiment with the same scientific methodology or can switch to another scientific methodology to satisfy the facts of the current theories.

Why is our mindset more important when you try to learn remotely than when you are learning face to face?

Answers

Answer:

It is more important because of the freedom.

Explanation:

While at home you can do your work of course... but you could lay down, take a nap. You could get on the game, play around. You could draw, and fiddle and dance and do WHATEVER you want with no teacher to stop you so you have to be your own motivation. You have to be your own teacher or its VERY easy to fail.

Calculate the gravitational force between two objects when they are 0.75m apart each object has a mass of 5.00kg

Answers

Answer:

0.000000000666863

Explanation:

F = GMm/R²

Other Questions
lemon made 8 5/8 cups of lemonade. she drank 4 3/8 cups of the lemonade. how many cups of lemonade does she have left Maurice made a model of the steel tabletop his model measures 7 inches by 13 inches is the model simular to the original Read and choose the correct option to complete the sentence.Mis suegros van a ________ las reservaciones de su viaje en la agencia Mar y Sol. (1 point) acomer bempacar cestar dhacer Who was the last Confederate soldier to surrender?A.Frederick DouglassB.Sen. James Henry LaneC.Gen. Stand WatieD.Col. William Quantrill A golfer hits the ball off the tee at an angle of thirty-five degrees from the horizontal with a speed of 46 m/s. It lands on the green, which is elevated 5.50 m higher than the tee. How much time elapsed from when the ball was hit to when it landed on the green? Suppose your community has 3580 people this year. The population is growing 2.5% each year. a. Write an exponential function to model the population. b. What will the population be in 3 years? c. Graph the function and give the domain and range. How does the authors overall tone support his argument that play is an essential part of education? Be sure to identify or name the tone specifically. "The seriousness of play is shown in the standard of effort and achievement that it holds up. The strictest schoolmaster of the old nose-to-the-grindstone school never secured the whole-hearted effort that is seen on the ball field every afternoon. A small boy throws a ball so as to curve in a way which a few years ago was thought to be impossible, another hits it with a round stick, while a third urchin in the distance runs as fast as he can and catches it. When you consider how little of the course of the ball the third boy saw before he started to run, and take into accountor better still experiencethe other difficulties involved in the whole performance, you will realize that such feats, though seen every day on every ball field, are somewhat remarkable. At least things equally difficult done by boys in their Reduce the fraction and find the domain. [tex]\frac{a(x-2y)}{b(2y-x)}[/tex]Thanks! Help I mark brainliest Job 1:1 defines Job as a man "who was perfect and upright, and one that feared God and eschewed evil." The word perfect, often used in Scripture, usually means "spiritually mature." Job is called upright, which indicates that he was in fellowship with God. He is said to have feared God. In Scriptural parlance, this word demonstrates Job's trust in God, his preoccupation with God. He had faith in Him, and he rested in that faith. "And [he] eschewed [or turned away from] evil." Evil is negativity to God. Evil is the essence of Satan; whereas grace is the essence of God. Job turned away from evil. God knew Job's heart and knew he could be trusted with disaster. He had integrity before God, and God doubled His blessing on Job in the end. Main Idea? Susan B. Anthony quotes the preamble of the US Constitution in her speech "On Women's Right to Vote" tooffer evidence that women deserve to vote.state a reason that women have little freedom.outline her reasoning about why women should vote.rebut the counterclaim that women already have freedom. What would be the amino acid sequence for the mRNA strand AGGCAGUUG? ITS A PSYCHOLOGY QUESTION BTWHeinzs Dilemma - Was Heinz justified in his decision? Why or why not? What is the temperature of a gas if the container has a volume of 2,300 mL, with a pressure of 932 mmHg and 3.51 moles? i do not tell a lie change into passive voice Two containers P and Q are filled with different amounts of water. Each container has a small hole. The graph shows the amount of water, V milliliters, left in each container after x minutes.Explain what the y-intercept means in this scenario. Write a system of equations to describe the situation below, solve using elimination, and fill in the blanks.An employee at a construction company is ordering interior doors for some new houses that are being built. There are 2 one-story houses and 4 two-story houses on the west side of the street, which require a total of 64 doors. On the east side, there are 5 one-story houses and 4 two-story houses, which require a total of 88 doors. Assuming that the floor plans for the one-story houses are identical and so are the two-story houses, how many doors does each type of house have?Each one-story house has doors, and each two-story house has doors. Find (fog)(x).f(x) = 6xg(x) = x + 3Write your answer as a polynomial in simplest form.(fog)(x) = ???? Which of the following is the missing value? a. 0.27 b. 0.30 c. 0.37 d. 0.50 Lickety Sweet's Candy Store sells candy by the ounce. Maura paid $3.48 for a 12-ounce bag of hard watermelon candies and $1.28 for an 8-ounce bag of chewy chocolate candies. How much more do the watermelon candies cost per ounce than the chocolate candies?