Pleaseeeee helppp meeee

Pleaseeeee Helppp Meeee

Answers

Answer 1

Subtracting 8 times the first row to the second row we will get the matrix.

[tex]\left[\begin{array}{ccc}1&10&-23\\0&-83&249\end{array}\right][/tex]

How to get a zero in row 2, column 1?

To get that, you will need to take row 2 and subtract 8 times row 1, then the values of each column will be:

Remember that the rows are the horizontal vectors and the columns are the vertical ones.

8 - 8*1 = 0

-3 - 8*10 = -83

65 - 8*-23 = 249

Then the new matrix will be:

[tex]\left[\begin{array}{ccc}1&10&-23\\0&-83&249\end{array}\right][/tex]

That is the matrix with a zero in row 2, column 1.

Learn more about matrices at:

https://brainly.com/question/11989522

#SPJ1


Related Questions

PLEASE HELP!! WILL GIVE BRAINLEST AND 100 POINTS FOR CORRECT ANSWER ONLY !!

(Enlarge photo)

Answers

Answer:B

Step-by-step explanation:the triangle has 3 sides

Planes T and X are parallel. Plane T contains line a. Plane X contains line b.

Planes T and X are parallel. Plane T contains line a and plane X contains line b.







Which best explains the relationship between lines a and b?

Answers

If planes T and X are parallel, then lines a and b must also be parallel.

CAN SOMEONE HELP WITH THIS QUESTION?

Answers

Answer:

 39 1/3 = 118/3 square units

Step-by-step explanation:

You want the area under the curve y = -x² +9x on the interval [3, 5].

Integral

The fundamental theorem of calculus tells us the integral of the function will be its anti-derivative. That is, for f(x) = -x² +9x, we want the function F(x) whose derivative is f(x). The reverse of the power rule for derivatives can be used:

  [tex]F(x)=-\dfrac{x^3}{3}+9\dfrac{x^2}{2}[/tex]

Area

The area of interest is ...

  F(5) -F(3) = -1/3(5³ -3³) +9/2(5² -3²) = -98/3 +72

  F(5) -F(3) = 39 1/3

The area under the curve between x=3 and x=5 is 39 1/3 square units.

george and jenna each completed a 12 miles run. this graph shows the total distance in miles that genna ran over time

Answers

In the first hour of their run, Jenna ran 1 mile more than George.

Given graph shows the data on Jenna's running status.

It shows that Jenna ran 12 miles in 2 hours of time.

Jenna's running status in the first one hour = 12/2 = 6 miles.

Given that George ran at a constant of 5 miles per hour.

To find out how many miles will Jenna ran more than George in the first one hour = 6 -5 = 1 mile.

From the above analysis, we can conclude that the Jenna will run 6 miles in the first one hour and George will run 5 miles in the first one hour. So, Jenna will run 1 mile more than George.

To know more about graph analysis,

https://brainly.com/question/28737035

#SPJ1

Given question is not having enough information, the complete question is attached below,

The diameter of the lead in a pencil p must be within 0.01 millimeters of 1 millimeter

Answers

The diameter of the lead in a pencil p must be within 0.01 millimetre of 1 millimeter. In the form of inequality, this can be expressed as 0.01<p<1.

A mathematical expression with values that on the left and right are not equal is referred to as having an inequality. In essence, an inequality examines any two values as well as demonstrates whether one is bigger than, less than, or neither greater nor less than the comparable quantity. Numbers are compared using inequalities to determine the range of quantities that fall inside the parameters of a variable. The diameter of the lead in a pencil p must be within 0.01 millimetre of 1 millimeter. This can be expressed as 0.01<p<1 inequality.

To know more about inequality, here:

https://brainly.com/question/30228778

#SPJ1

Your question is incomplete but most probably your full question was,

The diameter of the lead in a pencil p must be within 0.01 millimetre of 1 millimeter. Express this statement of an inequality.

Juan catches 80% of the passes thrown to him in football. If the quarterback throws to him 15 times during a game, what is the probability he will catch atleast 10 of them?

Answers

the probability that Juan will catch at least 10 passes out of 15 is approximately 0.9951, or about 99.51%.

We may utilise the binomial distribution formula to resolve this issue:

P(X ≥ 10) = 1 - P(X < 10)

where P(X 10) is the likelihood that Juan catches fewer than 10 passes and X is the total number of passes he catches.

By applying the binomial distribution formula, we may determine P(X 10):

P(X < 10) = Σ(k=0 to 9) [(15 select k)×(0.8)k×(0.2)×(15-k)]

where (15 select k) is the binomial coefficient and (0.8)k×(0.2)(15-k) is the probability of catching k passes and missing (15-k) passes, and (15 choose k) is the number of possibilities to choose k items out of 15.

P(X 10) can be calculated using a calculator or a spreadsheet and is roughly equal to 0.0049.

P(X 10) is therefore equal to 1 - P(X 10) 1 - 0.0049 0.9951.

So the probability that Juan will catch at least 10 passes out of 15 is approximately 0.9951, or about 99.51%.

learn more about Probability here:

https://brainly.com/question/30034780

Solve the equation. Write the solution set with the exact values given in terms of common or natural logarithms. Also give approximate solutions to at least 4 decimal places.

539=13^r+9

Answers

The solution for r is:

r = ln(539)/ln(13) - 9

And an estimation is:

r = -6.5478

How to solve the exponential equation?

Remember the rule for logarithms of powers:

ln(x^n) = n*ln(x)

Now let's look at our equation, here we have:

539 = 13^(r + 9)

We want to solve this equation for r, to do so, we can apply the natural logarithm in both sides:

ln(539) = ln( 13^(r + 9))

Using the rule we can rewrite this as:

ln(539)= (r + 9)*ln(13)

Now just solve the equation for r:

r = ln(539)/ln(13) - 9

And an approximate solution is:

r = -6.5478

Learn more about logarithms at.

https://brainly.com/question/13473114

#SPJ1

Find the value of x, y, and z in the parallelogram below.

Answers

The values of x , y and z in the parallelogram are 12, -20 and -33 respectively

How to find the angles of a parallelogram?

A parallelogram is a quadrilateral with opposite side equal to each other and opposite sides parallel to each other.

The opposite angles of parallelogram are equal . Consecutive angles in a parallelogram are supplementary .

Therefore,

-4y + 5 = 85

-4y = 85 - 5

-4y = 80

divide both sides by -4

y = 80 / -4

y = - 20

Therefore, let's find x and z as follows:

8x - 1 + 85 = 180

8x = 180 - 84

8x = 96

divide both sides by 8

x = 96 / 8

x = 12

Let's find z

- 3z - 4 + 85 = 180

-3z = 180 - 81

-3z = 99

divide both sides by -3

z = 99 / -3

z = -33

learn more on parallelogram here: https://brainly.com/question/29621055

#SPJ1

A survey found that​ women's heights are normally distributed with mean 63.3 in. and standard deviation 3.8 in. The survey also found that​ men's heights are normally distributed with mean 67.3 in. and standard deviation 3.8 in. Most of the live characters employed at an amusement park have height requirements of a minimum of 56 in. and a maximum of 64 in. Complete parts​ (a) and​ (b) below.

a. Find the percentage of men meeting the height requirement. What does the result suggest about the genders of the people who are employed as characters at the amusement​ park?
The percentage of men who meet the height requirement is ?

Answers

The percentage of men who meet the height requirement is 19.09%. This result suggests that a relatively small proportion of men meet the height requirements for the characters at the amusement park.

To find the percentage of men who meet the height requirement, we need to calculate the probability that a randomly selected man has a height between 56 and 64 inches.

Using the z-score formula, we can standardize the height range as follows:

z = (64 - 67.3) / 3.8 = -0.87

z = (56 - 67.3) / 3.8 = -3.00

Using a standard normal distribution table, we can find that the area to the left of z = -0.87 is 0.1922 and the area to the left of z = -3.00 is 0.0013.

Therefore, the percentage of men meeting the height requirement is:

P(-0.87 < Z < -3.00) = P(Z < -0.87) - P(Z < -3.00) = 0.1922 - 0.0013 = 0.1909 or 19.09%.

It suggests that the park may be employing more women than men as characters, as the mean height for women is below the maximum height requirement.

To learn more about distribution click on,

https://brainly.com/question/18722937

#SPJ1

3
Please help
Question in image

Answers

Answer:

  A.  12

Step-by-step explanation:

You want to know the length of tangent PQ, given that secant QS has segments QR = 8 and RS = 10. Points P, R, and S are on the circle. Point Q is external to the circle.

Secant relation

The relevant relation is ...

  PQ² = QR·QS

  x² = (8)(8+10) = 144

  x = √144 = 12

The value of x is 12.

<95141404393>

A net of a square pyramid is shown below.
What is the surface area, in square centimeters, of the pyramid?

Answers

Answer:

Option (B) 86.7 is the correct answer.

Step-by-step explanation :

Dividing the given diagram in 5 parts :

Firstly finding the area of one right angle triangle :

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{1}{2} \times b \times h}[/tex]

↠ b (base) = 5.1 cm↠ h (height) = 5.95 cm

substituting all the given values in the formula :

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{1}{2} \times 5.1 \times 5.95}[/tex]

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{1 \times 5.1 \times 5.95}{2}}[/tex]

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{5.1 \times 5.95}{2}}[/tex]

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{30.345}{2}}[/tex]

[tex]\dashrightarrow\sf{Area_{(\triangle)} = 15.1725\: {cm}^{2}}[/tex]

Hence, the area of right angle triangle is 15.1725 cm².

[tex]\begin{gathered} \end{gathered}[/tex]

Here we have 4 right angle triangle with equal base and height and we have already find the area of one right angle triangle. So, the area of 4 triangle will be :

[tex]\dashrightarrow\sf{Area_{(\triangle)} = 15.1725 \: {cm}^{2}}[/tex]

[tex]\dashrightarrow\sf{Area \: of \: 4{(\triangle)} = 15.1725 \times 4}[/tex]

[tex]\dashrightarrow\sf{Area \: of \: 4{(\triangle)} = 60.69 \: {cm}^{2}}[/tex]

Hence, the area of 4 right angle triangles is 60.69 cm².

[tex]\begin{gathered} \end{gathered}[/tex]

Now, we have to find the area of square

[tex]\longrightarrow\sf{Area_{(Square)} = {a}^{2}}[/tex]

↠ a (side) = 5.1 cm

Substituting the given value in the formula :

[tex]\longrightarrow\sf{Area_{(Square)} = {(5.1)}^{2}}[/tex]

[tex]\longrightarrow\sf{Area_{(Square)} = {(5.1 \times 5.1)}}[/tex]

[tex]\longrightarrow\sf{Area_{(Square)} = 26.01 \: {cm}^{2}}[/tex]

Hence, the area of square is 26.01 cm².

[tex]\begin{gathered} \end{gathered}[/tex]

Now, calculating the total area :

[tex]{\sf{\implies{Total \: Area = Area_{(\triangle)} + Area_{(Square)}}}}[/tex]

↠ Area of triangle = 60.69 cm²↠ Area of square = 26.01 cm².

[tex]{\sf{\implies{Total \: Area = 60.69 + 26.01}}}[/tex]

[tex]{\sf{\implies{Total \: Area = 86.7 \: {cm}^{2}}}}[/tex]

Hence, the total area of given diagram is 86.7 cm².

———————————————

Answer:

Option (B) 86.7 is the correct answer.

Step-by-step explanation :

Dividing the given diagram in 5 parts :

Firstly finding the area of one right angle triangle :

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{1}{2} \times b \times h}[/tex]

↠ b (base) = 5.1 cm↠ h (height) = 5.95 cm

substituting all the given values in the formula :

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{1}{2} \times 5.1 \times 5.95}[/tex]

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{1 \times 5.1 \times 5.95}{2}}[/tex]

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{5.1 \times 5.95}{2}}[/tex]

[tex]\dashrightarrow\sf{Area_{(\triangle)} = \dfrac{30.345}{2}}[/tex]

[tex]\dashrightarrow\sf{Area_{(\triangle)} = 15.1725\: {cm}^{2}}[/tex]

Hence, the area of right angle triangle is 15.1725 cm².

[tex]\begin{gathered} \end{gathered}[/tex]

Here we have 4 right angle triangle with equal base and height and we have already find the area of one right angle triangle. So, the area of 4 triangle will be :

[tex]\dashrightarrow\sf{Area_{(\triangle)} = 15.1725 \: {cm}^{2}}[/tex]

[tex]\dashrightarrow\sf{Area \: of \: 4{(\triangle)} = 15.1725 \times 4}[/tex]

[tex]\dashrightarrow\sf{Area \: of \: 4{(\triangle)} = 60.69 \: {cm}^{2}}[/tex]

Hence, the area of 4 right angle triangles is 60.69 cm².

[tex]\begin{gathered} \end{gathered}[/tex]

Now, we have to find the area of square

[tex]\longrightarrow\sf{Area_{(Square)} = {a}^{2}}[/tex]

↠ a (side) = 5.1 cm

Substituting the given value in the formula :

[tex]\longrightarrow\sf{Area_{(Square)} = {(5.1)}^{2}}[/tex]

[tex]\longrightarrow\sf{Area_{(Square)} = {(5.1 \times 5.1)}}[/tex]

[tex]\longrightarrow\sf{Area_{(Square)} = 26.01 \: {cm}^{2}}[/tex]

Hence, the area of square is 26.01 cm².

[tex]\begin{gathered} \end{gathered}[/tex]

Now, calculating the total area :

[tex]{\sf{\implies{Total \: Area = Area_{(\triangle)} + Area_{(Square)}}}}[/tex]

↠ Area of triangle = 60.69 cm²↠ Area of square = 26.01 cm².

[tex]{\sf{\implies{Total \: Area = 60.69 + 26.01}}}[/tex]

[tex]{\sf{\implies{Total \: Area = 86.7 \: {cm}^{2}}}}[/tex]

Hence, the total area of given diagram is 86.7 cm².

———————————————

PLEASE SOMEONE HELPP!!!!
i know that answer Is −12
8
1

but i need explain! 100points, plus 5 Stars+ brainliest
[tex] - 3 \frac{3}{4} - x = -6 \frac{1}{6} [/tex]

THIS IS MATH FOR 7TH GRADE!!

Answers

Answer:

[tex]x=2\frac{5}{12}[/tex]

Step-by-step explanation:

Given equation:

[tex]-3\frac{3}{4}-x=-6\frac{1}{6}[/tex]

Begin by adding x to both sides of the equation:

[tex]-3\frac{3}{4}-x+x=-6\frac{1}{6}+x[/tex]

[tex]-3\frac{3}{4}=-6\frac{1}{6}+x[/tex]

Add -6¹/₆ to both sides of the equation:

[tex]-3\frac{3}{4}+6\frac{1}{6}=-6\frac{1}{6}+x+6\frac{1}{6}[/tex]

[tex]-3\frac{3}{4}+6\frac{1}{6}=x[/tex]

Swap sides:

[tex]x=6\frac{1}{6}-3\frac{3}{4}[/tex]

Rewrite the mixed numbers as improper fractions by multiplying the whole number by the denominator of the fraction, adding this to the numerator of the fraction, and placing the answer over the denominator:

[tex]x=\dfrac{6 \times6+1}{6}-\dfrac{3 \times 4+3}{4}[/tex]

[tex]x=\dfrac{36+1}{6}-\dfrac{12+3}{4}[/tex]

[tex]x=\dfrac{37}{6}-\dfrac{15}{4}[/tex]

When subtracting fractions, we must ensure that they have the same denominator.  To do this, find the least common multiple (LCM) of the two denominators.

As 6 and 4 are factors of 12, then 12 is the LCM.

Rewrite the fractions as their equivalent fractions (with a denominator of 12) by multiplying the numerator and denominator by the same number.

[tex]x=\dfrac{37\times 2}{6\times 2}-\dfrac{15\times3}{4\times3}[/tex]

[tex]x=\dfrac{74}{12}-\dfrac{45}{12}[/tex]

Now the fractions all have the same denominator, we can simply subtract the numerators:

[tex]x=\dfrac{74-45}{12}[/tex]

[tex]x=\dfrac{29}{12}[/tex]

Finally, convert the improper fraction into a mixed number:

[tex]x=\dfrac{24+5}{12}[/tex]

[tex]x=\dfrac{24}{12}+\dfrac{5}{12}[/tex]

[tex]x=2+\dfrac{5}{12}[/tex]

[tex]x=2\frac{5}{12}[/tex]

HELP PLEASEE!!!
Whoever answers right gets brainliest!!

Answers

The average rate of change of the given function between the two given values is: 0.82

How to find the average rate of change of a function?

The Average Rate of Change of a function is one that is defined as the average rate at which one quantity is changing with respect to another thing changing. Thus, an average rate of change function is basically a process that helps to calculate the amount of change in one item divided by the corresponding amount of change in another.

It is given by the formula:

f'(x) = [f(b) - f(a)]/(b - a)

We are given the function:

f(x) = √(3x - 11)

Thus from x1 = 4 to x2 = 6, we will have:

f(4) = √(3*4 - 11) = 1

f(6) = √(3*6 - 11) = √7

Thus:

f'(x) = ((√7) - 1)/(6 - 4)

f'(x) = 0.82

Read more about Average Rate of Change at: https://brainly.com/question/8728504

#SPJ1

In January, the amount of snowfall was 5 2/3 feet. In February, the amount of snowfall was 3 1/5 feet. What was the amount of snowfall in the two months combined? Write your answer as a mixed number in simplest form.

Answers

Answer:

Step-by-step explanation:

To add these fractions, we need a common denominator. The smallest common multiple of 3 and 5 is 15.

Converting 2/3 to fifteenths:

2/3 = 10/15

Converting 1/5 to fifteenths:

1/5 = 3/15

Now, we can add:

5 10/15 + 3 3/15 = 8 13/15

Therefore, the amount of snowfall in the two months combined was 8 13/15 feet.

The answer is 8 13/15 so yeah hope this helps a lot

42 SING A chef makes batches of dumpling wrappers for shrimp dumplings. She uses 2 cups of flour for each batch and a total of an additional § cup of flour to keep the dough from sticking. She uses 21 cups of flour to make n batches of dumpling wrappers. How many batches of dumpling wrappers does the chef make?

Answers

The chef makes 11 batches of dumpling wrappers.

What is dumpling wrapper?

Dumpling wrappers are thin pieces of dough that are used to wrap around fillings to make dumplings. They are a staple in many Asian cuisines, including Chinese, Japanese, Korean, and Thai. The dough is typically made with flour, water, and salt, and is rolled out into thin circles or squares. The size and thickness of the wrappers can vary depending on the type of dumpling being made and the regional cuisine. Dumpling wrappers can be used to make a variety of dumplings, such as pork and cabbage dumplings, shrimp dumplings, potstickers, and gyoza.

Let's assume that the chef makes "n" batches of dumpling wrappers.

For each batch of dumpling wrappers, the chef uses 2 cups of flour.

So, the total amount of flour used for making "n" batches of dumpling wrappers is 2n cups of flour.

In addition to the 2 cups of flour for each batch, the chef also uses an additional § cup of flour to keep the dough from sticking. So, the total amount of flour used for "n" batches is 2n + § cups of flour.

According to the problem statement, the chef uses a total of 21 cups of flour to make "n" batches of dumpling wrappers. So, we can set up the following equation 2n + § = 21

To solve for "n," we need to first convert the § cup of flour to a decimal. § is equivalent to 0.25 cups of flour.

So, the equation becomes 2n + 0.25 = 21

Subtracting 0.25 from both sides,

2n = 20.75

Dividing both sides by 2,

n = 10.375

Since we can't have a fraction of a batch, we can round up to the nearest whole number. Therefore, the chef makes 11 batches of dumpling wrappers.

Learn more dumpling wrappers here,

https://brainly.com/question/25421984

#SPJ1

The chef makes 11 batches of dumpling wrappers.

What is dumpling wrapper?

Dumpling wrappers are thin pieces of dough that are used to wrap around fillings to make dumplings. They are a staple in many Asian cuisines, including Chinese, Japanese, Korean, and Thai. The dough is typically made with flour, water, and salt, and is rolled out into thin circles or squares. The size and thickness of the wrappers can vary depending on the type of dumpling being made and the regional cuisine. Dumpling wrappers can be used to make a variety of dumplings, such as pork and cabbage dumplings, shrimp dumplings, potstickers, and gyoza.

Let's assume that the chef makes "n" batches of dumpling wrappers.

For each batch of dumpling wrappers, the chef uses 2 cups of flour.

So, the total amount of flour used for making "n" batches of dumpling wrappers is 2n cups of flour.

In addition to the 2 cups of flour for each batch, the chef also uses an additional § cup of flour to keep the dough from sticking. So, the total amount of flour used for "n" batches is 2n + § cups of flour.

According to the problem statement, the chef uses a total of 21 cups of flour to make "n" batches of dumpling wrappers. So, we can set up the following equation 2n + § = 21

To solve for "n," we need to first convert the § cup of flour to a decimal. § is equivalent to 0.25 cups of flour.

So, the equation becomes 2n + 0.25 = 21

Subtracting 0.25 from both sides,

2n = 20.75

Dividing both sides by 2,

n = 10.375

Since we can't have a fraction of a batch, we can round up to the nearest whole number. Therefore, the chef makes 11 batches of dumpling wrappers.

Learn more dumpling wrappers here,

https://brainly.com/question/25421984

#SPJ1

2/9 ÷2/8_____ reduce the answer to the lowest terms

Answers

To divide fractions, we multiply the first fraction by the reciprocal of the second fraction. Thus, 2/9 ÷ 2/8 is equivalent to 2/9 * 8/2, which simplifies to 16/18. To reduce this fraction to lowest terms, we can divide both the numerator and denominator by their greatest common factor, which is 2. Therefore, 16/18 reduces to 8/9.

Esports the Titian determined that the probability of a certain rugby team winning its next match is 11/23. Find the odds of the next match

Answers

The odds of the next match from the probability of 11/23 is 11 : 12

Finding the odds of the next match

From the question, we have the following parameters that can be used in our computation:

Probability = 11/23

For a probability represented as a/b, the odds is

Odds = a : b - a

In this case

a = 11 and b = 23

Using the above as a guide, we have the following:

Odds = 11 : 23 - 11

Evaluate the difference

So, we have

Odds = 11 : 12

Hence, the value of the odds is 11 : 12

Read more about probability at

https://brainly.com/question/24756209

#SPJ1

URGENT!! ILL GIVE
BRAINLIEST! AND 100 POINTS

Answers

The frequency table that summarizes the data by the biologist and the additional plants is c. third table.

How to find the frequency table?

From the data by the biologist and the additional plants, we see that there are 11 plants with flowers and 7 with caterpillars.

The number of flowering plants with caterpillars is 6 plants. Those without flowers would then be:

= 11 - 6

= 5 plants

This is shown by the second frequency table.

In conclusion, the correct frequency table showing the data by the biologist is the second frequency table.

Find out more on frequency tables at https://brainly.com/question/16148316

#SPJ1

Calculate the height of the pole​

Answers

Step-by-step explanation:

See image

Change 14,277 s to h, min, and s.

Answers

Answer:

3hours 237 minutes 5700 seconds

14277 seconds = 3 hours 237 minutes and 5700 seconds.
Step-by-step explanation:
Given : Number of seconds 14277 seconds.
To find : Change the seconds into h,min and second?
Solution :
We know that,
1 hour = 3600 seconds
1 second = hour
14277 seconds = hour
14277 seconds = 3.96583 hour
Now, in minutes
1 hour = 60 minutes

Now, in seconds
1 minute = 60 seconds

Therefore, 14277 seconds = 3 hours 237 minutes and 5700 seconds.
#Learn more

brainly.in/question/7252763

Please help me im struggling with my test

Answers

The y-intercept is (0, 10) and the values of x that make sense are x > 0

The graph of the function

From the question, we have the following parameters that can be used in our computation:

y = 10(2)^x

The graph is added as an attachment

The y-intercept

This is the point of intersection with the y-axis

From the graph, it is (0, 10)

The values of x that make sense

These are the values whose corresponding y values are not negative

In other words, the values are x > 0

Read more about exponential function at

https://brainly.com/question/2456547

#SPJ1

Determine the value(s) for which the rational expression −6a−10−5a−8 is undefined. If there's more than one value, list them separated by a comma, e.g. a=2,3.

Answers

Since the rational expression is incorrectly constructed, I am unable to determine what it actually means.

I'll attempt to respond to this in a general approach so that you may try to apply it to the specific issue.

Let's say that this is our expression of reason:

              [tex]\frac{-6a-10}{-5a-8}[/tex]

There is no undefined value because the numerator is -12d and this component is unaffected by any value of d.

-5a-8 is the denominator.

Any rational expression that has a denominator equal to zero is now undefined. (we can not divide by zero)

Thus, a value that is undefined will be when

-5a-8 = 0

d = 8/5

This means that the number d = 8/5 is invalid because it would cause the denominator to be equal to 0.

to understand more about rational expression visit:

brainly.com/question/17064258

#SPJ1

Plot the numbers -1 1/2 and 2 3/4 on the number line below.

Answers

Answer:

Step-by-step explanation:

ok, so for the -1 1/2 your going to find the -1 point on the left of 0. Then from there you will count to the second small point (or small line intersecting through the number line) to the right of -1. It will be this one right here

Now for the second number 2 3/4 you will find the 2 point, to the right from 0. Now count three small points to the left to get the 3/4 part. It will be right here.

Hope this helps!!

Find the vertex and the axis of symmetry of the parabola given by the equation.
y = −x2 + 16x − 65

Answers

The axis of symmetry of the parabola is 8.

The vertex of the parabola is (8, -1).

How to find the vertex and the axis of symmetry of a parabola?

The vertex of a parabola in standard form, y = ax² + bx + c, is given by:

Vertex, (h, k) = (-b/2a, c - b²/4a)

For y = -x² + 16x − 65:

a = -1, b = 16 and c = -65

-b/2a = -16/2(-1)

-b/2a = 8

c - b²/4a = -65 -  (16)²/4(-1)

c - b²/4a = -65 + 64

c - b²/4a = -1

Vertex, (h, k) = (8, -1)

For a parabola in standard form, y = ax² + bx + c, the axis of symmetry of the parabola is given by:

x = -b/2a

For y = -x² + 16x − 65:

a = -1 and b = 16

Thus, the axis of symmetry of the parabola is:

x =  -16/2(-1)

x = 8

Learn more about parabola on:

https://brainly.com/question/29635857

#SPJ1

Classify the following triangle as right or not. Explain why it is or is not.
24
27
15

Answers

This triangle is not a right triangle.

A right triangle is a triangle that has a right angle (90 degrees).

To check if a triangle is a right triangle, we can use the Pythagorean theorem, which states that in a right triangle, the sum of the squares of the lengths of the two shorter sides is equal to the square of the length of the longest side (the hypotenuse).

If we apply this theorem to this triangle, we get:

24^2 + 15^2 = 576 + 225 = 801
27^2 = 729

Since 801 is not equal to 729, this triangle does not satisfy the Pythagorean theorem and is not a right triangle.

What is mHI?
mHI
I
=
H
O
120°
120°
J

Answers

The calculated value of the measure of the arc HI is 55 degrees

Calculating the measure of the arc HI

From the question, we have the following parameters that can be used in our computation:

The circle

The sum of angles at a point is 360

So, we have

∠HAI + 60 + 100 + 145 = 360

When the like terms are evaluated, we have

∠HAI = 55

The angle subtended by the arc equals the angle at the center

This means that

mHI = ∠HAI

By substitution, we have

mHI = 55 degrees

Hence, the arc HI is 55 degrees

Read more about angles at

https://brainly.com/question/25215131

#SPJ1

6. Social Security numbers are of the form XYZ - MN - ABCD.
a. The first three digits XYZ are referred to as the area number. The number is associated
with where you registered for your social security card. X is a number 1 - 7. Y and Z can
be any number 0 - 9. Also the area code 666 has never been used. How many area code
numbers are possible?
b. The middle two digits MN are referred to as the group number. The group number can
be any number from 01 to 99 (it cannot be 00). The last 4 digits ABCD are the serial
number. The serial number can be any from 0001 to 9999 (it cannot be 0000).
Additionally, the social security number 123-45-6789 is only used in advertisements.
How many social security numbers are possible?

Answers

a) The number of possible area code numbers is: 69,299. b) the number of possible social security numbers is: 68,665,031,401

How to determine the  How many area code numbers are possible

a. The first three digits can be any number from 001 to 999, except for 666. Since X can be any number from 1 to 7, there are 7 choices for X. For Y and Z, there are 10 choices each (0-9). Therefore, the number of possible area code numbers is:

(7 choices for X) x (10 choices for Y) x (10 choices for Z) - 1 (for 666) = 69,299

b. The middle two digits can be any number from 01 to 99, which gives 99 choices. The last 4 digits can be any number from 0001 to 9999, which gives 9999 - 1 (for 0000) = 9998 choices. Therefore, the number of possible social security numbers is:

(69,299 choices for the area number) x (99 choices for the group number) x (9998 choices for the serial number) - 1 (for 123-45-6789) = 68,665,031,401

Learn more about combinations at https://brainly.com/question/4658834

#SPJ1

Write about plane of contact , pole and polar plane ?
Explain all briefly!

Answers

The concepts of plane of contact, pole, and polar plane are related to the study of conic sections in geometry.

Plane of Contact:

The plane of contact is a plane that passes through the points of intersection of a cone and a plane. In other words, when a plane intersects a cone, the points where the plane and cone touch determine a plane of contact. This plane is important in determining the properties of the conic section that is formed by the intersection.

Pole:

The pole is a point that is used to define a polar plane. It is a point that is not on the plane and is located on the axis of the cone. When a plane passes through the pole, it intersects the cone in a conic section. The pole is a useful concept in determining the properties of the conic section.

Polar Plane:

The polar plane is a plane that passes through the pole and is perpendicular to the plane of contact. It is the plane that contains the polar axis, which is the axis of the cone passing through the pole. The polar plane is important in determining the properties of the conic section that is formed by the intersection of the cone and the plane of contact.

In summary, the plane of contact, pole, and polar plane are all concepts that are used in the study of conic sections. The plane of contact is a plane that passes through the points of intersection of a cone and a plane. The pole is a point on the axis of the cone that is used to define a polar plane. The polar plane is a plane that passes through the pole and is perpendicular to the plane of contact. These concepts are important in determining the properties of conic sections and are used in various applications, including optics, astronomy, and engineering.

Answer:

Step-by-step explanation:

Sure! Let's start with the plane of contact.


Plane of Contact:

The plane of contact is a term commonly used in geometry and physics. When two objects come into contact with each other, their surfaces touch at a particular area. This area of contact is known as the plane of contact. It is a two-dimensional surface that represents the point of contact between the two objects.


Imagine two books placed on a table. The area where the bottom surface of each book touches the table is the plane of contact. It is like a flat sheet that separates the objects and defines the region where they interact with each other.


Pole and Polar Plane:

The concepts of pole and polar plane are closely related to the plane of contact. Let's explore them:


Pole:

In geometry, the pole is a point that represents the point of contact between a line and a plane. When a line is in contact with a plane, the point of contact is called the pole. It is the specific point where the line intersects the plane.


For example, if you have a line placed on a tabletop, the point where the line touches the surface is its pole.


Polar Plane:

The polar plane is the plane that contains all the lines passing through a specific point called the pole. In other words, the polar plane is a plane that is perpendicular to the line at its pole.


Continuing with the previous example, if you have a line touching the tabletop at a certain point, the polar plane would be a plane that is perpendicular to the line at that point. It includes all the lines passing through that point.


The pole and polar plane are connected in such a way that every line passing through the pole lies on the polar plane, and the polar plane contains the pole.


In summary, the plane of contact represents the area where two objects touch each other, while the pole represents the point of contact between a line and a plane. The polar plane is a plane that contains all the lines passing through the pole.


Hope it helps!!

5. a. A box contains 20 pens of which m are red. If 5 more pens of which 3 are red are added, the probability of selecting two red pens at random without replacement is 7/20 Find the value of m. b. The first four consecutive terms of a linear sequence are x,y, (2x + 1), (2y-3). i. Show that S4= 3(x+y) - 2. ii. Find the fifth term, U5​

Answers

a. There are 4 red pens in the box.

b i. Simplifying, we get:

S₄ = 3(x + y) - 2

ii. The fifth term is 4y - 2x + 1.

What is probability?

The chance of an event occurring is called the probability of the event happening. It tells us how likely it is for an event to happen; it does not tell us what is going to happen. There is an even chance of an event happening (happen/not happen).

a. Let the number of non-red pens be n, then we have m + n = 20. Also, after adding 5 more pens, we have m + 3 red pens and n + 2 non-red pens. The probability of selecting two red pens at random without replacement from these 25 pens is given by:

(m + 3)/(20 + 5) * (m + 2)/(20 + 4) = 7/20

Simplifying this equation, we get:

(m + 3)(m + 2) = 14 * 5

Expanding the left side and simplifying, we get:

m² + 5m - 36 = 0

Factoring this equation, we get:

(m + 9)(m - 4) = 0

Since m cannot be negative, we have:

m = 4

Therefore, there are 4 red pens in the box.

b. i. The sum of the first n terms of an arithmetic sequence can be given by:

Sₙ = n/2[2a + (n - 1)d]

where a is the first term, d is the common difference, and n is the number of terms. Using this formula, we can find S₄ as follows:

S₄ = 4/2[x + y + (2x + 1) + (2y - 3)]

= 2(3x + 3y - 1)

= 6(x + y) - 6 - 2

Simplifying, we get:

S₄ = 3(x + y) - 2

ii. The common difference of the sequence is given by:

d = y - x

Therefore, the fifth term can be expressed as:

U₅ = (2x + 1) + 4d

= (2x + 1) + 4(y - x)

= 4y - 2x + 1

Therefore, the fifth term is 4y - 2x + 1.

Learn more about probability on:

https://brainly.com/question/13604758

#SPJ9

a. There are 4 red pens in the box.

b i. Simplifying, we get:

S₄ = 3(x + y) - 2

ii. The fifth term is 4y - 2x + 1.

What is probability?

The chance of an event occurring is called the probability of the event happening. It tells us how likely it is for an event to happen; it does not tell us what is going to happen. There is an even chance of an event happening (happen/not happen).

a. Let the number of non-red pens be n, then we have m + n = 20. Also, after adding 5 more pens, we have m + 3 red pens and n + 2 non-red pens. The probability of selecting two red pens at random without replacement from these 25 pens is given by:

(m + 3)/(20 + 5) * (m + 2)/(20 + 4) = 7/20

Simplifying this equation, we get:

(m + 3)(m + 2) = 14 * 5

Expanding the left side and simplifying, we get:

m² + 5m - 36 = 0

Factoring this equation, we get:

(m + 9)(m - 4) = 0

Since m cannot be negative, we have:

m = 4

Therefore, there are 4 red pens in the box.

b. i. The sum of the first n terms of an arithmetic sequence can be given by:

Sₙ = n/2[2a + (n - 1)d]

where a is the first term, d is the common difference, and n is the number of terms. Using this formula, we can find S₄ as follows:

S₄ = 4/2[x + y + (2x + 1) + (2y - 3)]

= 2(3x + 3y - 1)

= 6(x + y) - 6 - 2

Simplifying, we get:

S₄ = 3(x + y) - 2

ii. The common difference of the sequence is given by:

d = y - x

Therefore, the fifth term can be expressed as:

U₅ = (2x + 1) + 4d

= (2x + 1) + 4(y - x)

= 4y - 2x + 1

Therefore, the fifth term is 4y - 2x + 1.

Learn more about probability on:

https://brainly.com/question/13604758

#SPJ9

Mai is jogging from her house to school. Her school is 2 5/6 miles from her house. She has gone 1 3/5 miles so far. How many miles does Mai still have to jog? Write your answer as a mixed number in simplest form.

Answers

Step-by-step explanation:

[tex]2 \times \frac{5}{6} = \frac{17}{6} [/tex]

[tex]1 \times \frac{3}{5} = \frac{8}{5} [/tex]

[tex] \frac{17}{6} - \frac{8}{5} [/tex]

[tex] \frac{17}{6} \times 5 = \frac{85}{30} [/tex]

[tex] \frac{8}{5} \times 6 = \frac{48}{30} [/tex]

[tex] \frac{85}{30} - \frac{48}{30} = \frac{37}{30} [/tex]

[tex]37 \div 30 = 7 \times \frac{1}{30} [/tex]

so 7 1/30

Other Questions
What would be the major product of the following reaction? i) NaBH4 ii) NaH, Et20 A O=S=0 OCH2CH3 1) CH3CH2OCH(CH3)CH2CH2CH2CH3 II) (CH3CH20)2CHCHOHCH2CH2CH3 III) (CH3CH2)2CHOHCH2CH2CHOHCH3 IV) CH3OCH(C2H5)CH2CH2CH2CH3 V CH3CH2CH(OCH3)CH2CH2CHOHCH3 (I NEED THIS RIGHT NOW!! PLEASE GIVE EXPLANATION!!) Millie and her brother, Jack, sold candy baes for the band fund-raiser. Millie sold three times as many candy bars as Jack. If Jack sold 30 candy bars, which equation and solution can be used to represent y, the number of candy bars Millie sold?A. 3y = 30; y = 10B. 30 = y/3; y = 103C. 30 = y/3; y = 90D. 3y = 30; y = 90 What are the risks and advantages of praising people publicly, such as in news headlines, for making good moral choices? Use evidence from the text to support your answer. true or false the smallest kinetic energy that an electron in a box (an infinite well) can have is zero. A client is admitted with a tentative diagnosis of congestive heart failure (CHF). Which assessment finding, consistent with this diagnosis, would the nurse expect?Inspiratory cracklesCyanosisChest painHeart murmur Identify the law illustrated by the following: 4bracket(3x-7) is equivalent to 12x-28. Consider the joint PDF of two random variables X, Y given by fx,y (x, y) = C, where 0 need the answers for the proofs both 13 and 14 Talisa plans a 36-foot deep pond. While digging, she hits rock 30 feet down. How can Talisa modify the radius to maintain the original volume of the pond?Talisa should make the radius ___ ft pls help bro ima fail 1. For parts of the free response question that require calculations, clearly show the method used and the steps involved in arriving at your answers. You must show your work to receive credit for your answer. Examples and equations may be included in your answers where appropriate. Answer the following questions related to CO2. 30-C=0 0=c=0 Diagram X Diagram z (a) Two possible Lewis electron-dot diagrams for CO2 are shown above. Explain in terms of formal charges why diagram 2 is the better diagram. (b) Identify the hybridization of the valence orbitals of the Catom in the CO2 molecule represented in diagram 2 (c) A 0.1931 mol sample of dry ice, CO2(s), is added to an empty balloon. After the balloon is sealed, the CO2(8) sublimes and the CO2(g) in the balloon eventually reaches a temperature of 21.0C and pressure of 0.998 atm. The physical change is represented by the following equation. CO2(8) + CO2(9) AHyublimation =? (1) What is the sign (positive or negative) of the enthalpy change for the process of sublimation? Justify your answer. (11) List all the numerical values of the quantities, with appropriate units, that are needed to calculate the volume of the balloon. (iii) Calculate the final volume, in liters, of the balloon. calculate the concentration of c6h5nh3 c6h5nh3 and clcl in a 0.215 mm c6h5nh3clc6h5nh3cl solution. Determine the drag coefficient for a smooth golf ball at standard sea-level conditions with a velocity of100mph, noting it has a diameter of1.68in. Make use of Figure 4-34 from the text. Video observations on the deceleration on a dimpled golf ball provide an estimated drag force of0.080lb, at the same conditions noted above. Determine the drag coefficient for the dimpled golf ball and use Figure4.34to make a statement on the condition of the boundary layer between the two surface conditions and the effective Reynolds number. A factory makes two products, puzzle cubes and puzzle spheres. Unfortunately, 1.5% of the cubes are defective and 2% of the spheres are defective. They make four times as many cubes as spheres. What percent of their products are defective? Suppose that you are told that the Taylor series of f(x) = x^4ex^3 about x = 0 is x^4 + x^7 + x^10/2! + x^13/3! + x^16/4! + ... Find each of the following: d/dx (x^4 e^x^3)|_x=0 = d^10/dx^10(x^4 e^x^3)|_x=0 = show that if n is a power of 2, say , then i=0klg(n2i)=(lg2n) TJs offers a $1,000 face value, zero coupon bond with a yield to maturity of 11.3 percent, given annual compounding. The bond matures in 16 years. What is the current price?A. $178.78B. $180.33C. $188.36D. $190.09E. $192.18 Draw all of the expected products for each of the following solvolysis reactions: Get help answering Molecular Drawing questions. X Your answer is incorrect. Try again. (a) Br ? E1OH heat Edit Get help answering Molecular Drawing questions. X Your answer is incorrect. Try again. (b) ? H heat CI (c) Br ? heat Edit Get help answering Molecular Drawing questions. Your answer is incorrect. Try again. (d) CI ? heat Edit Which city is closer to the Tropic of Cancer: a. Miami, FL b. Monterrey, MX c. Guadalajara, MX Labor contracts that include so-called COLA provisionsA) tend to link money wages to price increasesB) serve to preserve the purchasing power of workersC) are a common form of wage indexation in many labor marketsD) often tie nominal wages to a specific price indexE) all of the abov