Please help !!!!!!!!

1) Write the equation for the reaction between the hydrocarbon and bromine using fully displayed formulae for the hydrocarbon and the organic product.

2) The reaction between methane and bromine gas in the presence of UV light also causes the bromine to lose color.

(a) Write an equation for this reaction

(b) This reaction is described as a substitution reaction. whereas the reaction between X and bromine is an addition reaction. Using the equations you have already written , explain the difference between addition and substitution

Answers

Answer 1
1) CH2 (gas) + Br (solid) -> BrC (solid) + H2 (gas)
2) a) CH4 + Br2 -> CH3Br + HBr
2) b) methane + bromine is substitution because one hydrogen atom from methane is replaced by one bromine atom. addition reaction takes place when one molecule combines with another to form a larger molecule so therefore a molecule from X and bromine combine to form XBr.

Related Questions

Knowing that the solubility of a salt at 80°C is 45g/100 g of H,O, calculate the mass of water required for dissolve 250 g of this salt at 80º C.​

Answers

The mass of water required will be approximately [tex] \bf = 555.6\: g [/tex].

To solve this question, just make a simple rule of three between the amount of salt dissolved at 80ºC and the mass of water:

[tex]\qquad[/tex] 45g of salt [tex] \sf \longrightarrow[/tex] 100g of H₂O

[tex]\qquad[/tex] 250g of salt [tex] \sf \longrightarrow[/tex] x g of H₂O

[tex]\qquad[/tex] [tex]\red{\twoheadrightarrow\bf45\times x = 250\times 100}[/tex]

[tex]\qquad[/tex] [tex]\twoheadrightarrow\sf45x=25000[/tex]

[tex]\qquad[/tex] [tex]\twoheadrightarrow\sf x=\cancel{\dfrac{25000}{45}}[/tex]

[tex]\qquad[/tex] [tex]\red{\twoheadrightarrow\bf x = 555.6\:g}[/tex]

Therefore, knowing that the solubility of a salt at 80ºC is 45g/100g of water (H₂O), the mass of water needed to dissolve 250g of this salt at 80ºC will be [tex] \red{\bf = 555.6\: g }[/tex]

__________________________________________________

How many moles is 2.50 grams of oxygen?

Answers

Answer:

Mole is a number that connects mass of a substance with its number of particles. 2500 g of O2 = 1/32 x 2500 = 78.125 moles

Explanation:

have a great day

PLEASE HELP!!


Explain the physical and chemical properties of water, including its different phase changes. Why is water so critical for human life?

Submission

Answers

The physical properties of water is that it is clear, it has no taste. No odour. It freezes at 0 degrees Celsius and boils at 100 degrees Celsius. The different stages of water is liquid, solid and gas. It is liquid at normal state. Ice when solid and steam when it is a gas state.

It is essential for human life because majority of the human body is made out of water. The water in the body allows certain parts and organs to function properly. Without water humans are most like to become I’ll and even dehydrate causing major injuries. It is also essential for the brain to function

how does the number of valence electrons change as you move to the right across the periodic table?

Answers

Answer:

The number of valence electrons goes up by one each time you move

______= Speed / Wavelength

Answers

Answer:

Frequency

Explanation:

It’s kinda self-explanatory but bascially speed=wavelength times frequency

Answer:

Frequency is Speed divided by Wavelength

Step-by-step explanation:

Don't think there needs to be an explanation for the formula, unless you want the conceptual understanding

50 points for anyone who answeres properly. How does a structure of a triglyceride differ from the reaction of fructose?

Triglycerides and fructose are both monomers, but they differ in how they bond to other monomers.

Fructose forms large polymers by the process of hydrolysis, while a triglyceride forms monomers by the process of dehydration.

Fructose is a form of carbohydrate, while a triglyceride is a lipid.

A triglyceride is a polymer, while fructose is a monomer.

Answers

Answer:

Fatty Acids

A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.

Saturated Fatty Acids

In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.

Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.

Unsaturated Fatty Acids

In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.

Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.

Lipids and Diet

Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.

Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.

What are triglycerides and fructose?

Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.

Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.

Therefore, option C. fructose is sugar and triglyceride is fat is correct.

Learn more about triglycerides and fats here:

https://brainly.com/question/17576593

#SPJ2

Write the charges for each part of this equation. ​

Answers

Answer:

the Aluminium Al have +3 charges and idion have I) have - 2 charges

how can knowledge of percent composition help you as a consumer ? how can you promote responsible consumerism ?​

Answers

Answer:

it is a nice question....my mind tells me that the first is it use me as a good vibes and can use to anything the second i will do my best too absorbe it.

Explanation:

Hope this help...

Students in Mr. Garcia's class were having a race! No, not running. Instead they rolled tennis balls down a wooden track. The tennis balls have the same mass and diameter. Using the data table, decide which ball had the MOST kinetic energy.

Answers

Answer:

it's entertaining. Energy though is the answer

Mercury is an environmental pollutant that is produced by the burning of
fossil fuels and can be toxic to wildlife and humans. What does this show
about the impact of chemicals on the environment?
A. The harm chemicals could have on the environment outweighs the
benefits that people get from the chemicals.
B. People cannot control the negative effects of chemicals on the
environment.
C. All chemicals that people introduce into the environment are
harmful.
D. The beneficial effects people get from chemicals may have
unintended harmful effects on the environment,

Answers

C! I just took the test :) good luck

Helpp you will get a brainly

Answers

HC= Hydrocarbon

CH=benzene

Explanation:

HC is Hydrocarbon, how? -- Hydrocarbon, a category of substances consisting only of hydrogen and carbon.

CH is benzene, how? -- benzene is represented by the empirical formula CH, which indicates that a typical sample of the compound contains one atom of carbon (C) to one atom of hydrogen (H).

----(Is this what you meant???)

How can one determine if a compound is ionic or covalent?

Answers

Answer:

If a compound is made from a metal and a non-metal, its bonding will be ionic. If a compound is made from two non-metals, its bonding will be covalent.

25.0g of iron is heated to 100.0 and then placed in 50.0 g of water in a insulated calorimeter. the initial temperature of the water is 38.00. the specific heat of water is 4.181j/g and the specific heat if iron is 0.45j/g. what is the final temp of the water and the iron?

Answers

Answer:

Approximately [tex]41.2\; {\rm ^{\circ} C}[/tex].

Explanation:

Let [tex]t\; {\rm ^{\circ} C}[/tex] be the final temperature of the water and the iron.

Temperature of the water would be increase by [tex](t - 38.00)\; {\rm ^{\circ} C}[/tex].

Temperature of the iron would be reduced by [tex](100.0 - t)\; {\rm ^{\circ} C}[/tex].

Let [tex]c[/tex] denote the specific heat of each material. Let [tex]m[/tex] denote the mass of the material. For a temperature change of [tex]\Delta t[/tex], the energy change involved would be:

[tex]Q = c\, m \, \Delta t[/tex].

The energy that the water need to absorb would be:

[tex]\begin{aligned}& Q(\text{water, absorbed}) \\ =\; & c(\text{water}) \, m(\text{water})\, \Delta t (\text{water}) \\ =\; & 4.181\; {\rm J \cdot g^{-1} \cdot K^{-1}} \times 50\; {\rm g} \times (t - 38.00)\; {\rm ^{\circ} C} \\ =\; & (209.05\, t - 7943.9)\; {\rm J} \end{aligned}[/tex].

The energy that the iron would need to release would be:

[tex]\begin{aligned}& Q(\text{iron, released}) \\ =\; & c(\text{iron}) \, m(\text{iron})\, \Delta t (\text{iron}) \\ =\; & 0.45\; {\rm J \cdot g^{-1} \cdot K^{-1}} \times 25.0\; {\rm g} \times (100.0 - t)\; {\rm ^{\circ} C} \\ =\; & (1125 - 11.25 \, t)\; {\rm J} \end{aligned}[/tex].

Since this calorimeter is insulated, the energy that the iron had released would be equal to the energy that the water had absorbed:

[tex]Q(\text{water, absorbed}) = Q(\text{iron, released})[/tex].

[tex]209.05\, t - 7943.9 = 1125 - 11.25\, t[/tex].

[tex]t \approx 41.2[/tex].

Thus, the final temperature of the water and the iron would be approximately [tex]41.2\; {\rm ^{\circ} C}[/tex].

Select the correct answer. In which situation is chemical energy being converted to another form of energy? A. a lamp plugged into the electric grid B. a fluttering flag C. a floating wooden log D. a burning candle

Answers

Answer:

D. A burning candle. (chemical energy into energy of heat and light, i.e. thermal and wave)

Explanation:

comment and tell me if it right.

The situation in which chemical energy being converted to another form of energy is a burning candle.

So, option D is correct one.

What is chemical energy?

The energy produce by the chemical reaction is called chemical energy.

Example: burning of candle.

Give the example of energy conversion.When lamp plugged into electric grid then electrical energy is converted into light energy.When candle is burn then chemical energy is converted into light energy.No energy takes place during a fluttering flag and a floating wooden log.

learn more about chemical energy,

https://brainly.com/question/1371184

#SPJ2

how much usable energy is extracted from one glucose molecule

Answers

We can extract 3×3 power 3 from glucose molecules

A group of students were asked to design a device that converts light energy into heat. They built a small solar oven using a tin can and aluminum foil. The device reflects light into the can, warming up its contents.
Which action would most improve the design of the solar oven?
O A. Add a mirror to reflect light away from the can.
O B. Use hand lenses to focus the light into the can.
O c. Add a fan to make sure the food is evenly warmed.
O D. Change the tin can to a box with a lid to Increase cooking space.

Answers

Answer:

answer is b

Explanation:

I think it is b. I don't know what land lenses are but focusing light on the can would heat it up more.

What role does each type of chemical play in the firework

Answers

Answer:  Antimony: Antimony is used to create firework glitter effects. Barium: Barium is used to create green colors in fireworks,

Explanation:

Answer:

Explanation:Antimony: Antimony is used to create firework glitter effects. Barium: Barium is used to create green colors in fireworks, 

XTRA POINTS 4 CHRISTMAS
What is an empirical formula?

Answers

Explanation:

a formula giving the proportions of the elements present in a compound but not the actual numbers or arrangement of atoms.

Answer:

The answer is A

Explanation:

its is the chemical formula in which the subscripts are given in the smallest ratio

How many atoms are in 11.5g of Hg

Answers

5. is your answer thank you!

Different isotopes of an element have different numbers of:

Answers

Explanation:

Different isotopes of an element have different numbers of mass number

HELP PLSS ASAP PLEASE

Answers

Answer:

5.24 x 10^23

Explanation:

Avogadro's constant is 6.02 x 10^23

1 mol = 6.02 x 10^23

0.87 mol = 6.02 x 10^23 x 0.87 = 5.24 x 10^23 (2.d.p)

Almost 99% of the Earth's atmosphere is made up of two gases. What ere the two gases and the percents of each?

Answers

Answer:

21% oxygen and 78%nitrogen

Explanation:

Answer:

Nitrogen and Oxygen

Explanation:

nitrogen - 78 %

oxygen - 21%

Helppp plzzzz!!!!!!1Asappppp

Answers

Answer:

0.178M

Explanation:

The question can immediately be understood as comparing two states.

- The initial state M1 , V1.

- The Final state M2 , V2.

M - Molarity.

V - Volume (in mili liters/ml/ in this case).

The formula is stated as:

M1 * V1 = M2 * V2

Given- Required

M1 = 0.125M V1 = 265ml M2 = ?

V2 = 186ml

Plug these values into the formula above and divide V2 to get M2.

rearranged formula - M2 = M1 * V1 / V2 = 0.125M * 265ml / 186ml

= 0.178091397 M ~ ~ 0.178M.

(iii) Give two reasons why the electrolyte contains cryolite​

Answers

Answer:

The mixture of cryolite and aluminum oxide has a lower melting point than pure aluminum oxide. This means a lower amount of energy is required to establish effective conditions for electrolysis and thus makes it more cost effective.

Explanation:

report the elements half life. if we start with 100g of your element (platinum) how long will it take to have 6.26g?

Answers

Answer:

did u get the answer yet

Explanation:

A student is trying to classify an unidentified, solid gray material as a metal or a nonmetal. Which question will best help the student classify the material?.

Answers

Whether it conducts heat or electricity,if it is attracted by a magnet , high density high melting point

The question that will best help the student to classify the material is; "is the material malleable or ductile?"

Generally, materials can be classified as metals or non metals. There are properties that are particular to metals and there are properties that are particular to nonmetals and these properties can be used to identify each one of the materials.

The question that will best help the student to classify the material is; "is the material malleable or ductile?" These metallic properties.

Learn more:

https://brainly.com/question/1659592

Missing parts;

A student is trying to classify an unidentified, solid gray material as a metal or a nonmetal. Which question will best help the student classify the material? A. Is the material malleable or ductile? B. Does the material feel hard to the touch? C. Will the material float in water? D. Does the material feel rough or smooth?

Is mercury an electrolyte at room temperature?​

Answers

Answer:

No

Explanation:

Despite mercury being a metal, it is a liquid at room temperature. It cannot be an electrolyte. This is because most of the liquids that can conduct electricity or acids bases and salts whereas mercury is a metal.

no, mercury is a liquid at room temperature it is a metal. it cannot be an electrolyte

pls help :)))))))pop

Answers

Answer:

c-a-b

Explanation:

It’s the B) the c,a,b

The amount of energy involved when an electron is acquired by a neutral gaseous atom is what?

Answers

Electron gain enthalpy of the atom - if im not wrong

why do you think polar aprotic solvents increase the rate of an sn2 reaction

Answers

Polar protic solvents actually speed up the rate of the unimolecular substitution reaction because the large dipole moment of the solvent helps to stabilize the transition state. The highly positive and highly negative parts interact with the substrate to lower the energy of the transition state.
Other Questions
Alfred Wegner proposed the theory of plate tectonics. Explain the theory and what evidence has been found to support his theory. help me with this answer (20 Brainly Points / 2) A runner of mass 80 kg is moving at 8.0 m/s. Calculate her kinetic energy. Which graph best represents the solution to this system of inequalities? A. B. C. D. 100 points!Will report if fake answerA more wordy and complex way to say "we are cringe" A graph, a table and equation are shown below. Please help! DNA contains all the traits that we inherit from our parents.True or false how does a change in demographics change a population? the wind pushes a paper cup along the sand at a beach. the cup has a mass of 0.025 kg and accelerates at a rate of 5 m/s2. how much force is the wind exerting on the cup What would happen if there would be no judiciary Can someone plz help me? :( FREEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEEPOINTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTTSSSSSSSSSSSSSSSSSS JUST KIDDING OKAY DONT STEAL Y POINTS ANSWER THIS LZ Who here is in k12 online school 7th 2021 PLEASE DONT answer if ur not plz? please help finals study guide find the equation of a circle concentric with the circle x^2+y^2-2x-10y+1=0 passing through the point (2,-3) can u guys help me... an easy way to borrow money to buy goods is? What is the good news-bad news situation which happened to allow the familys wish to come true in the Monkeys Paw? if l||m, find the value of x. Advertising began with:The rise of the penny press in the 1800sThe rise of motion pictures in the 1930sThe rise of colonization in the 1600sThe rise of the Roman Empire in the 1st century A family of 6 used 5400l of water in 7 days. Each member of the family used the same amount of water each day. How many litres of water did each person use in a day?