Help pls this is 5th grade math

Help Pls This Is 5th Grade Math

Answers

Answer 1

Answer:

2 is scalene

3 is right

4 is right

5 is equalatirel

6 is scalene

7 is isocoles

8 is equalatirel

9 is right

Step-by-step explanation:

Answer 2

Answer:

2: scalene

3: right

4: right

5: equilateral

6: scalene

7: isosceles

8: equilateral

9: right

Step-by-step explanation:

2: A scalene triangle has no congruent sides

3: A right triangle has a 90 degree angle

4: A right triangle has a 90 degree angle

5: An equilateral triangle has 3 congruent sides

6: A scalene triangle has no congruent sides

7: An isosceles triangle has 2 congruent sides

8: An equilateral triangle has 3 congruent sides

9: A right triangle has a 90 degree angle


Related Questions

Jake studied
z
hours for a big test. Julie studied half as long.

Write an algebraic expression for long Julie studied.

Answers

Answer:

(1/2)z

Step-by-step explanation:

Find the volume of the cone. Round your answer to the nearest hundredth.

Answers

Answer:

I believe the answer is 1.36

What is the area of the figure? NO LINKS!!

Answers

Answer:

Area of the figure is 88 square inches

equations equivalent to x/4+1/3=5/6

Answers

If I rewrite this it would be
3x/12+4/12=10/12
3x=6
So your answer would be
2/4+1/3=5/6
Or
1/2+1/3=5/6
X=2

University of Florida researchers in the Department of Materials Science and Engineering have invented a technique that rapidly detects traces of TNT (Today, Spring 2005). The method, which involves shining a laser on a potentially contaminated object, provides instantaneous results and gives no false positives. In this application, a false positive would occur if the laser detected traces of TNT when, in fact, no TNT were actually present on the object. Let A be the event that the laser light detects traces of TNT. Let B be the event that the object contains no traces of TNT. The probability of a false positive is 0.

Required:
Write this probability in terms of A and B using symbols such as U, ∩ and |.

Answers

Answer:

P(A n B) = 0

Step-by-step explanation:

Given

[tex]A \to[/tex] Traces of TNT detected

[tex]B \to[/tex] No traces of TNT

Required

Probability of false positive

From the question, we understand that A and B must occur to get a positive and the result is 0.

The probability of A and B is represented as: P(A n B)

Include the result (0), we get:

P(A n B) = 0

What's the answer to this? I thought it was -138 apparently it's not? :(

Answers

The answer is 78 because if you substitute with the x=3 it changes the outcome of the answer:)

67-2x+89/2+7-8x=0
help me please​

Answers

Answer:

x = 11.85

Step-by-step explanation:

[tex]67 - 2x + \frac{89}{2} + 7 -8x = 0\\\\67 + \frac{89}{2}+7 = 8x + 2x\\\\\frac{134 + 89 +14}{2} = 10x\\\\10x = 118.5\\\\x = 11.85[/tex]

Answer:

[tex]x = 11 \frac{17}{20}[/tex] or [tex]\frac{237}{20}[/tex]

Step-by-step explanation:

Isolate the variable by dividing each side by factors that don't contain the variable.

Dan spent 0.125 of his money in snacks, 1/4 on travelling and saved the
rest. If he saved $65, how much money did he have at first?​

Answers

Answer:

89.38

Step-by-step explanation:

65 times 0.125 = 8.125

65 times 0.25 = 16.25

16.25 plus 8.125 plus 65 = 89.38 dollars

Find the equation (in terms of x ) of the line through the points (-3,4) and (1,-8)

Answers

Answer:

A(-3,4) B(1,-8)

y-y1/x-x1 =y2-y1/x2-x1

y-4/x--3 = -8-4/1--3

y-4/x+3 = -12/1+3

y-4/x+3 =-12/4

y-4/x+3 = -3

y-4 = -3(x+3)

y-4=-3x-9

y+3x +9-4=

y+3x+5=0

Answer:

y = -3x - 5

Step-by-step explanation:

-3, 4 and 1, -8

1 - -3 = 4

-8 - 4 = -12

[tex]\frac{-12}{4}[/tex] = [tex]\frac{-3}{1}[/tex] = -3

gradient/slope = -3

now substituting in the point -3, 4 to find the y intercept:

4= -3 x -3 + c

4 = 9 + c

-5 = c

y intercept = -5

equation is y = -3x - 5

The price of an item has been reduced by 70% the original price was $20 what is the price of the item now

Answers

Just find 70 % of $20 and that’s the price.

20 x 0.7 = 14
20 - 14 = 6

The price of the item is $6

PLEASE HELP IM BEING TIMED

Answers

Answer:

1

Step-by-step explanation:

Any number to the 0 power is equal to 1.

Hope that this helps!

Answer:

1 is correct

Any number that is raised to the power of 0 is 1, and any number that’s raised to the power of 1 is itself


PLS ANSWER RN

What is the area of AJKL?

Answers

Answer:

8.5

Step-by-step explanation:

slope of the line that contains KL

(y2 - y1)/(x2-x1)

(0-1)/(7-3)

m = -1/4

slope of the line that contains JK

(5-1)/(4-3)

m = 4

the linea are perpendicular so triangle is right

area = (leg1 x leg2)/2

KL = [tex]\sqrt{(7-3)^2 + (0-1)^2} = \sqrt{16 + 1} = \sqrt{17}[/tex]

KJ = [tex]\sqrt{(4-3)^2 + (5-1)^2}= \sqrt{1 + 16} = \sqrt{17}[/tex]

area = (√17)^2/2 = 17/2 = 8.5

8.5



….hope this helps!

A survey of 35 people was conducted to compare their self-reported height to their actual height. The difference between reported height and actual height was calculated. You're testing the claim that the mean difference is greater than 0.7. From the sample, the mean difference was 0.95, with a standard deviation of 0.44. Calculate the test statistic, rounded to two decimal places

Answers

Answer:

The test statistic is t = 3.36.

Step-by-step explanation:

You're testing the claim that the mean difference is greater than 0.7.

At the null hypothesis, we test if it is 0.7 or less, that is:

[tex]H_0: \mu \leq 0.7[/tex]

At the alternate hypothesis, we test if it is greater than 0.7, that is:

[tex]H_1: \mu > 0.7[/tex]

The test statistic is:

[tex]t = \frac{X - \mu}{\frac{s}{\sqrt{n}}}[/tex]

In which X is the sample mean, [tex]\mu[/tex] is the value tested at the null hypothesis, s is the standard deviation and n is the size of the sample.

0.7 is tested at the null hypothesis:

This means that [tex]\mu = 0.7[/tex]

Survey of 35 people. From the sample, the mean difference was 0.95, with a standard deviation of 0.44.

This means that [tex]n = 35, X = 0.95, s = 0.44[/tex]

Calculate the test statistic

[tex]t = \frac{X - \mu}{\frac{s}{\sqrt{n}}}[/tex]

[tex]t = \frac{0.95 - 0.7}{\frac{0.44}{\sqrt{35}}}[/tex]

[tex]t = 3.36[/tex]

The test statistic is t = 3.36.

Find the mean of the following data set: 8.9, 7.2, 3.3, 2.5, 9.4, 3.9, 4.5, 5.4, 8.9

Answers

the mean if the following set is 6

In the given figure, which angle is complementary to <4

Answers

Answer: The definition of a complementary angle is "Either of two angles whose sum is 90°." Thus the complementary angle for 4 is angle 5.

P.S. if you feel this answer is satisfactory I would appreciate it if you would mark it brainiest.

PLEASE HELP



what's x
cos(x+pi)-sin(x-pi)=0

please show work​

Answers

sin(x+pi)=-sin(x)=sin(-x)=cos(pi/2)

cos (x+pi)=-cos(x)

So according to the question:

cos(pi/2 +x)=cos(x)

Using the solution of cos, obtain:

(pi/2) + x = 2pi +- (x)

case#1: (pi/2) + x = 2pi + (x)

But here, the value of x is canceled, just

case#2: (pi/2) + x = 2pi - (x)

answer------------>>>>>>>>> x=pi-pi/4

Write the inverse function for the function, ƒ(x) =1/2 x + 4. Then, find the value of ƒ -1(4). Type your answers in the box.

ƒ -1(x) =

ƒ -1(4) =

Answers

Answer:

0

Step-by-step explanation:

Given that f(x) = 1/2x + 4

Let y = f(x)

y = 1/2 x + 4

Replace y with x

x = 1/2 y + 4

Make y the subject of the formula

1/2y = x - 4

y = 2(x-4)

If x = 3

y = 2(4-4)

y = 2(0)

y = 0

Hence ƒ -1(4) is 0

I only need help on number six

Answers

Answer:

288 inches = 8 yards

Step-by-step explanation:

Answer:

[tex]6 . \: 8 \: yards \: = \: 288 \: inches[/tex]

[tex]8. \: 18 \: feets \: = \: 216 \: inches[/tex]

[tex]10. \: \frac{1}{3} \: yards \: = 12 \: inches[/tex]

Step-by-step explanation:

6. 1 yard = 36 inches

8 yards = 36 × 8

= 288

8. 1 feet = 12 inches

18 feets = 12 × 18

= 216 inches

10. 1/3 into decimal = 0.33333333333

1/3 yards = 0.33333333333 × 36

= 12 inches

Hope it is helpful....

The expression 4x* represents 144​

Answers

Answer:

x=36

Step-by-step explanation:

because 4x36=144

Answer:

4x = 144

4 • 36 = 144

The answer to the equation is 36

Q.6.
Lisa wanted to paint her ugly brown flower box
red. Using the given dimensions, how many square
inches will she have to paint? (remove the top
base)

Answers

Answer:

10x22x8

Step-by-step explanation:

1760 is the answer

△JKL has vertices at J(−2, 4), K(1, 6), and L(4, 4). Determine whether △JKL is a right triangle

Answers

Answer:

Not a right triangle

Obtuse isosceles triangle.

Sides: J = 3.606   K = 6   L = 3.606

Step-by-step explanation:

hope helps you

have a nice day

For the data in the table, does y vary directly with x? If it does, write an equation for the direct variation.

TABLE

x y
-------
2 10
4 24
6 36​

Answers

Answer:

y does not vary directly with x

Step-by-step explanation:

The equation for direct variation is

y = kx ← k is the constant of variation

If k is constant for all ordered pairs in the table then direct variation.

k = [tex]\frac{y}{x}[/tex]

(2, 10 ) → k = [tex]\frac{10}{2}[/tex] = 5

(4, 24 ) → k = [tex]\frac{24}{4}[/tex] = 6

(6, 36 ) → k = [tex]\frac{36}{6}[/tex] = 6

Since k is not constant for all pairs then y does not vary directly with x

PLS HELP ASAP!! need the answer

Answers

Answer:

60 degrees

Step-by-step explanation:

Encuentre el volumen de 35 kg de oro

Answers

Speak in English so that I can understand

Hi plz help, if you can ill mark you 5 starz! :)

Answers

Answer:

12 kg, 1200 mm, 1200 ml (twice), 12 m, and 120 mm

Answer:

12,000 is 12

120 is 120

1.2 L is 1200

1200 is 120

0.12 is 12

Match each tool with how we used it in class

Answers

Answer:

1 - b

2 - a

3 - c

Step-by-step explanation:

1. B
2.a
3.c
Hope this helps

Can someone help me please?

Answers

the answer is 0.62

62/100 = 0.62

Answer:

0.62

Step-by-step explanation:

the 62 is the number you're mainly working with and the 100 represents the place value! so the 100 means you need to place the top number in the hundredths place (0.62)

Hope this helps! Good luck with your math work!

Omar, Amare, and Jack paid a total of $68.25 for dinner and tickets to a concert. The concert
tickets cost $9.75 each. If the 3 friends split the dinner bill equally, how much did each friend
spend on dinner?

Answers

Answer:

32.5

Step-by-step explanation:

I I divided ot then added it together

the given tables shows the number of shirts and pants different people own. what number correctly completes the table so that each person has the same ratio of pants to shirts​

Answers

Answer:

He needs 15 shirts

Step-by-step explanation:

We can use a ratio to solve

4 pants             6 pants

--------------- = -------------

10 shirts            x shirts

Using cross products

4x = 10 *6

4x = 60

Divide each side by 4

4x/4 = 60/4

x = 15

He needs 15 shirts

What is the range of y= sec-'(x)? PreCal, send help please!!

Answers

Given:

The function is:

[tex]y=\sec^{-1}(x)[/tex]

To find:

The range of the given function.

Solution:

We have,

[tex]y=\sec^{-1}(x)[/tex]

The range of secant inverse function is:

[tex]Range=\{y|0\leq y\leq \pi , y\neq \dfrac{\pi}{2}\}[/tex]

The range of the given function in interval notation is:

[tex]Range=\left[0,\dfrac{\pi}{2}\right)\text{ and }\left( \dfrac{\pi}{2}, \pi\right ][/tex]

Therefore, the correct option is C.

Other Questions
What was it about Darry that made him different from the rest of the greasers? Help me pleaseeee due a 3 will mark branliest Guys I really need help, - how do I change my age on a webtoon account -I'm 13 but I still have a children's privacy policy. I put in 100 points, pleasssssseeee help, me!!!!!!!!!!!!!! a small chocolate sundae costs $3. each topping you add costs $0.50. how much would it cost to get a small sundae with P toppings added? if two rectangles have the same area what do u know abt the measures of their sides please help I'll be your best friend Texas rebels under the leadership of ___ surprises and defeats a larger force of Mexicans, capturing the Mexican leader Santa Anna. How to find Co factor of elements of Determinant plz help me by answering these questions The water tank in your school holds 20 liters of water. One day it was 34 full. That day, 14 liters of tank capacity was used up. How many liters of water remained in the tank at the end of the day 4 If angle A = x + 5, angle B = 2x 35, and angle C = 3x,what is the value of x write an open letter addressed to drivers and motorists. Make an appeal to them to follow speed limits and explain to them the comsequences.of not following such. Calculate percentage change in mass for chip 5 HELP, 66% because of you beauty's! CAN WE GET TO 80, tho?Pwease Which answer is correct? SOMEONE PLEASE HELP MEA pyramid has a base that is a right triangle with legs measuring 10 cm and 14 cm. The height of the pyramid is 9 cm.The volume of the pyramid is ___ cubic cm. What events caused problems for George H.W. Bush during his presidency? 2-4 sentences. Jamal is reading his friend's report about space shuttles. He wants to know where his friend got the information about the first shuttle launch. Where should Jamal look?A. the title pageB. the bibliographyC. the last paragraphD. the introduction -x if x siFind f(7) for f(x) = 3 x + 5 if 15x Choose the options below that are true of standard reduction potential. (select all that apply) Select all that apply: All standard reduction potentials are measured against that of the reduction of hydrogen ions to H2 gas. The standard reduction potential of a cell is determined by subtracting the standard reduction for the reaction at the anode from the standard reduction potential for the reaction at the cathode. Standard reduction potentials are dependent on reaction stoichiometry. The standard reduction potential for a cell is determined by adding the standard reduction potential for the reaction at the anode to the standard reduction potential for the reaction at the cathode.