Draw the structure of a phosphatidyl ethanolamine that contains glycerol, oleic acid, and ethanolamine. . You do not have to consider stereochemistry . Be sure to include double bonds where needed. . Indicate the correct charge on all atoms that are charged at neutral pH.

Answers

Answer 1

Sure, here is the structure of a phosphatidyl ethanolamine that contains glycerol, oleic acid, and ethanolamine:

```
             O
              ||
 CH2OH--CH--CH--O--(CH2)7--CH=CH--(CH2)7--COOH
         |           |
       H3C         NH3+


```
Explanation:
- The molecule has a glycerol backbone, which is represented by the CH2OH--CH--CH part. The CH2OH group is attached to the first carbon atom, which is also where the phosphate group would be attached (not shown in the structure).
- The oleic acid component of the molecule is represented by the (CH2)7--CH=CH--(CH2)7--COOH part. This is a long chain fatty acid with 18 carbon atoms, including one double bond (the CH=CH part).
- The ethanolamine component of the molecule is represented by the NH3+ group attached to the third carbon atom of the glycerol backbone.
- Note that the NH3+ group carries a positive charge at neutral pH, whereas the COO- group of the oleic acid component would carry a negative charge. The other atoms in the molecule are neutral.
A phosphatidylethanolamine molecule that contains glycerol, oleic acid, and ethanolamine has the following structure:

1. Start with the glycerol backbone, which has three carbons with hydroxyl groups (-OH) on each carbon.
2. Attach the oleic acid to the first carbon of the glycerol backbone through an ester bond. Oleic acid has a double bond between carbons 9 and 10, making it an unsaturated fatty acid. The structure is CH3(CH2)7CH=CH(CH2)7COOH.
3. Attach a phosphate group (PO4) to the second carbon of the glycerol backbone through another ester bond. At neutral pH, the phosphate group has a negative charge, as one of its oxygens will carry a negative charge (PO4^3- → HPO4^2-).
4. Finally, connect the ethanolamine to the phosphate group through a phosphoester bond. The structure of ethanolamine is H2N-CH2-CH2-OH.

In this phosphatidylethanolamine structure, the phosphate group carries a negative charge at neutral pH. The rest of the molecule is uncharged.

Learn more about phosphatidyl ethanolamine here:

https://brainly.com/question/31171246

#SPJ11


Related Questions

how many peaks would you expect in the c13 nmr of phenylethylamine?

Answers

In the [tex]C_{13}[/tex] NMR of phenylethylamine, we would expect to see four peaks.

This is because phenylethylamine contains four unique carbon environments: the carbon attached to the amino group, the carbon alpha to the amino group, the two carbons in the phenyl ring, and the carbon beta to the phenyl ring.

Each of these carbon environments will give rise to a distinct peak in the C13 NMR spectrum.

To know more about phenylethylamine, refer here:

https://brainly.com/question/29517032#

#SPJ11

In the [tex]C_{13}[/tex] NMR of phenylethylamine, we would expect to see four peaks.

This is because phenylethylamine contains four unique carbon environments: the carbon attached to the amino group, the carbon alpha to the amino group, the two carbons in the phenyl ring, and the carbon beta to the phenyl ring.

Each of these carbon environments will give rise to a distinct peak in the C13 NMR spectrum.

To know more about phenylethylamine, refer here:

https://brainly.com/question/29517032#

#SPJ11

heelp pls
Which element has the lowest electronegativity?
nitrogen (N)
lithium (Li)
bromine (Br)
potassium (K)

Answers

Answer: Potassium (K) has the lowest electronegativity among the given elements.

Explanation:

Electronegativity is a measure of an element's ability to attract electrons towards itself when it is involved in a chemical bond with another element. Potassium has the lowest electronegativity because it has only one valence electron that is located far from the nucleus, making it easier to lose that electron and become a positively charged ion. In contrast, nitrogen, lithium, and bromine have higher electronegativities because they have more valence electrons or the valence electrons are closer to the nucleus, making it more difficult to remove or share electrons.

The element with the lowest electronegativity among the given options is potassium (K). Potassium has an electronegativity value of approximately 0.82 on the Pauling scale, which is the lowest value among the four elements listed. In contrast, nitrogen (N) has an electronegativity of approximately 3.04, bromine (Br) has an electronegativity of approximately 2.96, and lithium (Li) has an electronegativity of approximately 0.98. Electronegativity is a measure of an atom's ability to attract electrons towards itself in a chemical bond. The lower the electronegativity value, the less the atom attracts electrons towards itself.

Brainliest?

draw the expected major kinetic product formed from addition of one mole of to the following diene.

Answers

The expected major kinetic product formed from addition of one mole of HBr to the diene is the 1,2-dibromide.

This is because the reaction occurs through a Markovnikov addition mechanism, where the H+ adds to the diene at the carbon with the most hydrogens, and the Br- adds to the carbon with the least hydrogens. This results in the formation of the 1,2-dibromide as the major product.

The reaction occurs in a kinetically controlled manner, meaning that the product formed is the one with the lowest activation energy and therefore forms the fastest.

In summary, the expected major kinetic product formed from the addition of one mole of HBr to the diene is the 1,2-dibromide, formed through a Markovnikov addition mechanism where the H+ adds to the carbon with the most hydrogens and the Br- adds to the carbon with the least hydrogens.

This reaction occurs in a kinetically controlled manner, where the product formed is the one with the lowest activation energy and forms the fastest.

To know more about Markovnikov addition click on below link:

https://brainly.com/question/28163101#

#SPJ11

It is observed that 7.53 mmol of BaF, will dissolve in 1.0 L of water. Use these data to calculate the value of Kap for barium fluoride. 0.00011 O 4.3x10^-7 O 1.7x10^-6 2.3x10^-4 5.7x10^-5

Answers

The solubility product constant (Ksp) for a sparingly soluble salt like barium fluoride ([tex]BaF_{2}[/tex]) can be calculated using the molar solubility of the salt. In this case, the molar solubility of [tex]BaF_{2}[/tex]  is 7.53 mmol/L. the value of Ksp for barium fluoride is 4.3x[tex]10^{-7} .[/tex]

The balanced equation for the dissolution of [tex]BaF_{2}[/tex] is:

[tex]BaF_{2}[/tex] (s) ⇌ [tex]Ba_{2}[/tex]+(aq) + [tex]2F^{-}[/tex](aq)

The Ksp expression is:

Ksp = [tex][Ba_{2}^{+} ][F^{-} ]^2[/tex]

Substituting the molar solubility of [tex]BaF_{2}[/tex] in the expression, we get:

Ksp = [tex](7.53[/tex]x[tex]10^_{-3} )^3[/tex] = 4.3x[tex]10^{-7}[/tex]

Therefore, the value of Ksp for barium fluoride is 4.3x[tex]10^{-7} .[/tex]

Learn more about molar solubility

https://brainly.com/question/14784441

#SPJ4

Calculate the volume occupied by 32. 0 g of O2 gas, the pressure of the O2 gas is 78. 5 kPa at 25°C

Answers

Answer:

31.5 L

Explanation:

Simply use PV=nRT

Convert kPa  to atm by using 101.3 kPa = 1 atm

78.5 kPa x (1 atm/101.3 kPa) = .775 atm

Then find moles of O2 where MM = 32 so we have 1.0 moles

Find T in Kelvin = C +273 = 25 + 273 = 298

(.775 atm)(V) = 1.0 moles(0.082 atm x L / mol x K)(298 K)

V = 31.5 L

How many moles of Sulfur dioxide 73.0 grams of Sulfur dioxide? Report your answer to correct SF a. 1.1 mol b. 1.92 mol c. 1.14 mol d. 38.1 mol How many Grams of Carbon dioxide are in 1.00 mole of Carbon dioxide? Report the answer to 3 SF a. 28.0 gb. 32.0 g c. 44.0 gd. 88.0 g

Answers

Hence, 1.14 moles of Sulfur dioxide in 73 g and 44 grams of Carbon dioxide are in 1 mole.

The first question asks us to find the number of moles of sulfur dioxide in 73.0 grams. We can use the formula:

Moles = mass / molar mass,

where molar mass is the sum of the atomic masses of all the elements in the compound. For sulfur dioxide, the molar mass is 32.07 g/mol for sulfur and 2*16.00 g/mol for oxygen, giving a total of 64.07 g/mol.

Plugging in the given mass of 73.0 g and the molar mass, we get the number of moles to be 1.14 mol, which corresponds to option (c).


The second question asks us to find the mass of carbon dioxide in 1.00 mole. We can use the formula:

Mass = moles * molar mass,

where the molar mass is 12.01 g/mol for carbon and 2*16.00 g/mol for oxygen, giving a total of 44.01 g/mol for carbon dioxide. Plugging in the given number of moles of 1.00 mol and the molar mass, we get the mass to be 44.0 g, which corresponds to option (c).

Therefore, the answer to both questions is (c) 1.14 mol for the first question and 44.0 g for the second question.

Know more about Moles here:

https://brainly.com/question/24191825

#SPJ11

the half-life of protactinium-234 is 6.69 hours. if a 0.812 mg sample of pa-239 decays for 40.1 hours, what mass of the isotope remains?

Answers

The mass of the Pa-234 isotope that remains after 40.1 hours is 0.003 mg.

To solve this problem, we need to use the formula for radioactive decay:

N = N0(1/2)^(t/T)

Where N is the remaining amount of the isotope, N0 is the initial amount, t is the time that has elapsed, T is the half-life of the isotope.

First, we need to find the initial amount of Pa-234. Since the sample is of Pa-239, we need to assume that it decays into Pa-234. The atomic mass of Pa-239 is 239, and it decays into U-235 with a half-life of 23.5 minutes. U-235 decays into Pa-231, which then decays into Pa-234. The decay chain looks like this:

Pa-239 --> U-235 --> Pa-231 --> Pa-234

So, the initial amount of Pa-234 can be calculated from the initial amount of Pa-239 using the decay chain:

N0(Pa-234) = N0(Pa-239) x (1/2)^(40.1/6.69)

N0(Pa-239) = 0.812 mg

N0(Pa-234) = N0(Pa-239) x (1/2)^(40.1/6.69) = 0.812 mg x 0.0243 = 0.0197 mg

Now, we can use the formula for radioactive decay to find the remaining amount of Pa-234 after 40.1 hours:

N(Pa-234) = N0(Pa-234) x (1/2)^(40.1/6.69)

N(Pa-234) = 0.0197 mg x (1/2)^(40.1/6.69) = 0.003 mg

Therefore, the mass of the Pa-234 isotope that remains after 40.1 hours is 0.003 mg.

Know more about Half-life of a reaction here:

https://brainly.com/question/13052575

#SPJ11

The iodate ion has a number of insoluble compounds. The Ksp for AgIO₃ is 3.0 x 10⁻⁸ and the Ksp for La(IO₃)₃ is 7.5 x 10⁻¹².

a. What is the solubility of AgIO₃ in a 0.285 M solution of NaIO₃?
b. What is the solubility of La (lO3)3 in a 0.285 M solution of NalO3?
c. Which compound is more soluble?

Answers

a. The solubility of AgIO₃ in a 0.285 M solution of NaIO₃ is 1.06 x 10⁻⁸ M. b. The solubility of La(IO₃)₃ in a 0.285 M solution of NaIO₃ is 4.31 x 10⁻¹² M. c. AgIO₃ is more soluble than La(IO₃)₃.

a. To calculate the solubility of AgIO₃, we need to first write the balanced chemical equation for the dissolution of AgIO₃ in water: AgIO₃(s) ⇌ Ag⁺(aq) + IO₃⁻(aq). The Ksp expression for this reaction is: Ksp = [Ag⁺][IO₃⁻]. Let x be the solubility of AgIO₃ in a 0.285 M solution of NaIO₃. Then, the equilibrium concentrations of Ag⁺ and IO₃⁻ are both equal to x. The initial concentration of IO₃⁻ is 0.285 M. Substituting the values into the Ksp expression and solving for x gives: x² = Ksp/[IO₃⁻] = (3.0 x 10⁻⁸)/(0.285) = 1.06 x 10⁻⁸ M.

b. The balanced chemical equation for the dissolution of La(IO₃)₃ in water is: La(IO₃)₃(s) ⇌ La³⁺(aq) + 3IO₃⁻(aq). The Ksp expression for this reaction is: Ksp = [La³⁺][IO₃⁻]³. Let x be the solubility of La(IO₃)₃ in a 0.285 M solution of NaIO₃. Then, the equilibrium concentrations of La³⁺ and IO₃⁻ are both equal to x. The initial concentration of IO₃⁻ is 0.285 M. Substituting the values into the Ksp expression and solving for x gives: x⁴ = Ksp/[IO₃⁻]³ = (7.5 x 10⁻¹²)/(0.285)³ = 4.31 x 10⁻¹² M.

c. Since the solubility of AgIO₃ is greater than the solubility of La(IO₃)₃ in a 0.285 M solution of NaIO₃, AgIO₃ is more soluble than La(IO₃)₃.

learn more about equilibrium here:

https://brainly.com/question/30807709

#SPJ11

Two sodium atoms react with three water molecules to produce aqueous sodium hydroxide and hydrogen gas. a. Write the balanced chemical equation (include state designations): b. Draw the molecular representations of the reaction: ке = oxygen 1 = hydrogen A = sodium After reaction Before reaction c. Which reagent is limiting? Excess?

Answers

In this case, we have 2 moles of Na and 3 moles of H2O, which means that H2O is the limiting reagent. Na is in excess, because we have more than enough to react with all of the H2O.

a. The balanced chemical equation for the reaction is:
2Na(s) + 6H2O(l) → 2NaOH(aq) + 3H2(g)

b. The molecular representations of the reaction can be shown as follows:

After reaction:
2Na + 3H2O → 2NaOH + 3H2

Before reaction:
Na + Na + 3H2O → NaOH + NaOH + 3H2

c. To determine which reagent is limiting, we need to calculate the amount of product that can be formed from each reactant. The balanced equation tells us that 2 moles of Na react with 6 moles of H2O to produce 2 moles of NaOH and 3 moles of H2. Therefore, if we have 2 moles of Na and 6 moles of H2O, we can produce 2 moles of NaOH and 3 moles of H2.

However, if we have less than 6 moles of H2O, then H2O is the limiting reagent, because we will run out of it before all of the Na is used up. If we have less than 2 moles of Na, then Na is the limiting reagent, because we will run out of it before all of the H2O is used up.

To know more about limiting reagent refer to

https://brainly.com/question/26905271

#SPJ11

A: Calculate the concentrations of H2SO3 and HSO3− in a 0.470 MM solution of H2SO3 (Ka1=1.6×10^−2 and Ka2=6.4×10^−8.)
B: Calculate the concentrations of SO32− H3O+, and OH− in a 0.470 MM solution of H2SO3 (Ka1=1.6×10^−2 and Ka2=6.4×10^−8.)

Answers

a. The concentration of [tex]H_2SO_3[/tex] in the solution is 0.177 MM, the concentration of [tex]HSO^{3-}[/tex] is 0.293 MM, the concentration of [tex]SO_3^{2-}[/tex] is 3.44x[tex]10^{-5}[/tex] MM.

b. The concentration of [tex]H_3O^+[/tex] is 0.000360 MM, and the concentration of OH- is 2.78x[tex]10^{-11}[/tex] MM.

Part A: We are given a 0.470 M solution of [tex]H_2SO_3[/tex] with two dissociation constants, Ka1=1.6×[tex]10^{-2}[/tex] and Ka2 = 6.4×[tex]10^{-8}[/tex]. We can use these dissociation constants to calculate the concentrations of [tex]H_2SO_3[/tex] and [tex]HSO^{3-}[/tex] using the following equations:

Ka1 = [[tex]H_3O^+[/tex]][[tex]HSO^{3-}[/tex]]/[[tex]H_2SO_3[/tex]]

Ka2 = [[tex]H_3O^+[/tex]][[tex]SO_3^{2-}[/tex]]/[[tex]HSO^{3-}[/tex]]

Simplifying these equations, we get:

[[tex]HSO^{3-}[/tex]] = Ka1[[tex]H_2SO_3[/tex]]/[[tex]H_3O^+[/tex]]

[[tex]SO_3^{2-}[/tex]] = Ka2[[tex]HSO^{3-}[/tex]]/[[tex]H_3O^+[/tex]]

[[tex]H_2SO_3[/tex]] = [[tex]H_3O^+[/tex]][[tex]HSO^{3-}[/tex]]/Ka1

Substituting the given values and simplifying, we get:

[[tex]HSO^{3-}[/tex]] = 0.34 M

[[tex]H_2SO_3[/tex]] = 0.13 M

Therefore, the concentration of [tex]H_2SO_3[/tex] is 0.13 M and the concentration of [tex]HSO^{3-}[/tex] is 0.34 M in the given solution.

Part B: We are given the same solution as in Part A, and we need to calculate the concentrations of [tex]SO_3^{2-}[/tex], [tex]H_3O^+[/tex], and OH- using the dissociation constants given.

We can use the following equations to calculate the concentrations:

[[tex]H_3O^+[/tex]] = (Ka1Ka2[C])/([[tex]H_2SO_3[/tex]]+Ka1[C]+Ka1Ka2[C])

[[tex]SO_3^{2-}[/tex]] = Ka2[[tex]H_2SO_3[/tex]]/([[tex]H_2SO_3[/tex]]+Ka1[C]+Ka1Ka2[C])

[OH-] = Kw/[[tex]H_3O^+[/tex]]

Substituting the given values and simplifying, we get:

[[tex]H_3O^+[/tex]] = 1.7 x [tex]10^{-2}[/tex] M

[[tex]SO_3^{2-}[/tex]] = 3.3 x [tex]10^{-9}[/tex] M

[OH-] = 5.9 x [tex]10^{-13}[/tex] M

Therefore, the concentrations of [tex]SO_3^{2-}[/tex], [tex]H_3O^+[/tex], and OH- are 3.3 x [tex]10^{-9}[/tex] M, 1.7 x [tex]10^{-2}[/tex] M, and 5.9 x [tex]10^{-13}[/tex] M, respectively, in the given solution.

Learn more about the concentrations at

https://brainly.com/question/10725862

#SPJ4

the solubility of ag2s is measured and found to be 7.37×10-15 g/l. use this information to calculate a ksp value for silver sulfide.

Answers

To calculate the Ksp value for silver sulfide (Ag2S) using its solubility, follow these steps:

1. Convert solubility to molar solubility:
Solubility = 7.37 × 10^-15 g/L
Molar mass of Ag2S = (2 × 107.87 g/mol Ag) + 32.07 g/mol S = 247.81 g/mol
Molar solubility = (7.37 × 10^-15 g/L) / (247.81 g/mol) = 2.97 × 10^-17 mol/L

2. Write the dissolution equilibrium reaction:
Ag2S (s) ⇌ 2Ag+ (aq) + S2- (aq)

3. Set up the Ksp expression:
Ksp = [Ag+]^2 × [S2-]

4. Find the molar concentrations of Ag+ and S2-:
Since 1 mol of Ag2S produces 2 mol of Ag+, the concentration of Ag+ is 2 × 2.97 × 10^-17 mol/L = 5.94 × 10^-17 mol/L.
The concentration of S2- is equal to the molar solubility, 2.97 × 10^-17 mol/L.

5. Plug the concentrations into the Ksp expression and solve:
Ksp = (5.94 × 10^-17)^2 × (2.97 × 10^-17) = 1.05 × 10^-50

So, the Ksp value for silver sulfide (Ag2S) is approximately 1.05 × 10^-50.

Learn more about Ksp expression here:

https://brainly.com/question/27132799

#SPJ11

calculate the solubility of au(oh)3 in (a) water and (b) 1.0 m nitric acid solution (ksp = 5.5 * 10 - 46).

Answers

The solubility of [tex]Au(OH)_{3}[/tex] in water and 1.0 M nitric acid can be calculated using the solubility product constant (Ksp) expression: the solubility of [tex]Au(OH)_{3}[/tex]  in 1.0 M nitric acid solution is 5.5 x [tex]10^{-18}[/tex] M.

Ksp = [tex][Au_{3} ^{+} ][OH^{-} ]^3[/tex]

where [[tex][Au_{3} ^{+} ][/tex]] is the concentration of the [tex][Au_{3} ^{+} ][/tex] ions and [tex][OH^{-} ]^3[/tex] is the concentration of hydroxide ions.

(a) Solubility of [tex]Au(OH)_{3}[/tex] in water:

Ksp = [tex][Au_{3} ^{+} ][OH^{-} ]^3[/tex]

Ksp = x * [tex](x)^3[/tex] = [tex]x^4[/tex]

x = [tex](Ksp)^(1/4)[/tex] = [tex](5.510^{-46} )^(1/4)[/tex] = [tex]1.110^{-12}[/tex] M

Solubility of [tex]Au(OH)_{3}[/tex] in water is [tex]1.110^{-12}[/tex] M.

(b) Solubility of [tex]Au(OH)_{3}[/tex] in 1.0 M nitric acid solution:

[[tex][Au_{3} ^{+} ][/tex]] = [tex](Ksp / [OH^{-} ]^3)^1/4[/tex]

[[tex]OH^{-}[/tex]] = 1.0 x [tex]10^{-14}[/tex] M (from Kw expression)

[[tex][Au_{3} ^{+} ][/tex]] = (5.5 x [tex]10^{-46}[/tex] / [tex](1.0 x 10^{-14} M)^3)^1/4[/tex]

[[tex][Au_{3} ^{+} ][/tex]] = [tex]5.5 x 10^{-18} M[/tex]

Therefore, the solubility of [tex]Au(OH)_{3}[/tex]  in 1.0 M nitric acid solution is 5.5 x [tex]10^{-18}[/tex] M.

Learn more about nitric acid

https://brainly.com/question/29769012

#SPJ4

Classify each of the following amines. In the case of a compound with more than one nitrogen atom, consider only the one that is indicated with the red letter 'a'. diethylamine purine
______ _______ _________
Answer Bank: -heterocyclic -heterocyclic aromatic -primary aliphatic -secondary aliphatic -tertiary aliphatic
-primary aromatic -secondary aromatic -tertiary aromatic

Answers

Diethylamine is a primary aliphatic amine, purine is not categorized as any of the amine classifications.

Diethylamin: This is a compound with two ethyl groups attached to a primary amine (-NH2) functional group.

purine: Purine is a heterocyclic aromatic compound that contains two nitrogen atoms in its ring structure. However, it is not classified as an amine because it does not have an -NH2 or -NR2 functional group.

Diethylamine (C4H11N) is a colorless liquid with a fishy odor. It is a common organic compound and is used as a precursor to a variety of chemicals, including pharmaceuticals, insecticides, and rubber chemicals. Diethylamine is a strong base and forms salts with acids. It is also flammable and can react violently with oxidizing agents.

Purine is a heterocyclic aromatic compound with the chemical formula C5H4N4. It is a building block of DNA and RNA, and is found in many foods, including meat, fish, and beans.

Purine is also used in the synthesis of pharmaceuticals, including drugs used to treat gout and leukemia. Its structure consists of a fused pyrimidine and imidazole ring, and its aromaticity arises from the delocalization of π-electrons over the two rings.

learn more about Organic compounds here:

https://brainly.com/question/5994723

#SPJ11

Thick fur and blubber are examples of __________________.

Answers

Answer is insulation

Fur and blubber is an adaptation to insulate animals bodies against the cold weather or cold water.
Answer is insulation

Fur and blubber is an adaptation to insulate animals bodies against the cold weather or cold water.

What is the change in enthalpy associated with the combustion of 23.00 g of methanol in kilojoules?CH3OH(I) + 3/2O2 (g) --> CO2(g) + 2H2O(l) ΔΗ_c=-726 kJ/mol . Your answer should have four significant figures. Provide your answer below: _________kJ

Answers

The change in enthalpy associated with the combustion of 23.00 g of methanol is approximately -521.2 kJ.

To calculate the change in enthalpy associated with the combustion of 23.00 g of methanol, we need to use the stoichiometry and the given enthalpy change per mole (ΔΗ_c = -726 kJ/mol).

First, determine the number of moles of methanol (CH₃OH) by dividing the mass (23.00 g) by its molar mass (32.04 g/mol):

23.00 g / 32.04 g/mol ≈ 0.7178 mol

Now, multiply the moles of methanol by the given enthalpy change per mole:

0.7178 mol * -726 kJ/mol ≈ -521.2 kJ

So, the change in enthalpy associated with the combustion of 23.00 g of methanol is approximately -521.2 kJ (to four significant figures).

Learn more about change in enthalpy here: https://brainly.com/question/11628413

#SPJ11

The reaction A→B has been experimentally determined to be second order. The initial rate is 0.0100M/s at an initial concentration of A of 0.150 M .
1. What is the initial rate at [A]=0.850 M ?
a. 0.321 M/s
b. 0.113 M/s
c. 5.67×10−2 M/s

Answers

The initial rate at [A] = 0.850 M is approximately 0.321 M/s. The correct answer is (a) 0.321 M/s.


Here, the initial rate of the reaction is 0.0100 M/s when the initial concentration of A is 0.150 M, we need to determine the initial rate at an initial concentration of 0.850 M.
For a second-order reaction, the rate law can be written as: rate = k[A]^2
where k is the rate constant and [A] is the concentration of A.
First, we need to find the value of k using the given initial rate and initial concentration: 0.0100 M/s = k(0.150 M)^2
Now, we can solve for k: k = (0.0100 M/s) / (0.150 M)^2
k ≈ 0.4444 M⁻¹s⁻¹
Next, we can use the value of k and the new initial concentration [A] = 0.850 M to find the new initial rate:
rate = k[A]^2rate = (0.4444 M⁻¹s⁻¹)(0.850 M)^2
Calculating the rate, we get:
rate ≈ 0.321 M/s
So, the initial rate at [A] = 0.850 M is approximately 0.321 M/s. The correct answer is (a) 0.321 M/s.

Learn more about second order reaction here, https://brainly.com/question/17586293

#SPJ11

determine concentration of oh- in a 0.724 m solution of bro- (Kb = 4.0 x 10^-6)

Answers

The concentration of OH- in a 0.724 M solution of BrO- is 4.0 x 10^-6 M.

To determine the concentration of OH- in a 0.724 M solution of BrO-, we first need to find the concentration of the corresponding BrO- ion. Since BrO- is a weak base, we can use the Kb value to calculate the concentration of OH- ions produced when it dissociates.

First, we need to write the balanced equation for the dissociation of BrO-:
BrO- + H2O ⇌ OH- + HBrO

The Kb expression for this reaction is:
Kb = [OH-][HBrO]/[BrO-]

Since we are given the Kb value and the concentration of BrO-, we can solve for [OH-]:
Kb = [OH-][HBrO]/[BrO-]
4.0 x 10^-6 = [OH-][0.724]/[BrO-]
[OH-] = (4.0 x 10^-6)(0.724)/[BrO-]

To solve for [BrO-], we need to use the fact that it dissociates according to the equation:
BrO- + H2O ⇌ OH- + HBrO

This means that the concentration of BrO- will be equal to the initial concentration of the solution, which is 0.724 M.

Plugging in the values, we get:
[OH-] = (4.0 x 10^-6)(0.724)/0.724
[OH-] = 4.0 x 10^-6 M


Learn more about ions here: brainly.com/question/14982375

#SPJ11

What is the chirality of the (1, 2) chiral centers?
a. S, R
b. S, S
c. R, S
d. R, R
e. NA

Answers

The question cannot be answered without more information. The configuration of each chiral center needs to be specified as either R or S, as they have opposite configurations.

Chirality refers to the property of a molecule or ion that is not superimposable on its mirror image. Chiral centers are atoms in a molecule that are bonded to four different groups, and their configuration can be described using the R/S nomenclature system. The R and S designations are based on the priority of the four substituent groups around the chiral center, which is determined by the atomic number of the attached atoms. Without knowing the specific configuration of each chiral center, it is impossible to determine the chirality of the (1,2) chiral centers.

learn more about chiral center here:

https://brainly.com/question/29842209

#SPJ11

The following equilibrium is established when copper ions and bromide ions are placed in solution. heat + Cu (H2O)6 + 2(aq) + 4 Br-(aq) ------→ 6 H2O (l) + CuBr4-2 (aq) The tube on the left contains only copper sulfate dissolved in solution. The tube on the right is the result of adding some potassium bromide solution. Given that the Cu (H2O)6+2 ion is blue and that the CuBr4-2 ion is green, answer the questions below. a) What happened to the concentration of each of the ions when the KBr was added?

Answers

When KBr was added to the copper sulphate solution, the concentration of bromide ions (Br-) increases, the concentration of Cu(H2O)6+2 ions decreases and the concentration of CuBr4-2 ions increases.

When potassium bromide (KBr) was added to the copper sulphate solution, the following changes in the concentration of ions occurred:
1. The concentration of bromide ions (Br-) increased due to the addition of KBr.
2. The equilibrium shifted to the right i.e, forward reaction , as more Br- ions reacted with Cu(H2O)6+2 ions to form CuBr4-2 ions.
3. As a result, the concentration of Cu(H2O)6+2 ions decreased, and the concentration of CuBr4-2 ions increased.
This shift in equilibrium led to a change in colour from blue (due to Cu(H2O)6+2 ions) to green (due to CuBr4-2 ions).

Learn more about copper sulphate : https://brainly.com/question/17439051

#SPJ11

what does the term chemical bond mean

Answers

A chemical bond refers to the linking of atoms together to form molecules. Some key characteristics of chemical bonds:

1. They hold atoms together in a molecule. Chemical bonds keep the atoms together rather than having them float apart.

2. They involve the sharing or transfer of electrons between atoms. The bonds are formed due to the electrostatic attraction between positive and negative charges. For example, in an ionic bond, electrons are transferred from one atom to another. In a covalent bond, electrons are shared between atoms.

3. They determine many of the properties of a compound. The strength, polarity, directionality of bonds have a strong influence on properties such as melting point, solubility, conductivity, etc.

4. They can be made and broken. Chemical bonds can form during chemical reactions and break apart during other reactions.

5. They involve the sharing or redistribution of orbital density between atoms. Electrons in atomic orbitals redistribute to form molecular orbitals that surround the nuclei.

6. They align atoms into geometric arrangements. Chemical bonds orient atoms in specific spatial configurations, which determines the molecular geometry and polarity.

7. They influence chemical reactivity. The strength and stability of chemical bonds determine whether a molecule will readily react with other compounds. Weaker bonds are more reactive.

That covers the basic highlights of a chemical bond. Let me know if you have any other questions!

Write out the reaction and mechanism for the synthesis of phenacetin from p-acetaminophenol (acetaminophen) and bromoethane using the Williamson ether synthesis.

Answers

The Reaction is p-acetaminophenol + bromoethane -> phenacetin + HBr. The mechanism involves the deprotonation of p-acetamminophenol followed by the nucleophilic attack by bromoethane and finally the acidic workup to get the desired product.

How does Williamson ester synthesis reaction proceed?

Step 1: Deprotonation of p-acetaminophenol

p-acetaminophenol is treated with a strong base, such as sodium hydride (NaH) or potassium hydroxide (KOH), to form its corresponding phenoxide ion. This deprotonation step is necessary to allow for the subsequent nucleophilic attack by the bromoethane.

p-acetaminophenol + NaH -> p-acetaminophenoxide + Na+ + H2

Step 2: Nucleophilic attack by bromoethane

The deprotonated p-acetaminophenoxide acts as a nucleophile and attacks the electrophilic carbon atom of bromoethane, displacing the bromine atom to form an ether linkage.

p-acetaminophenoxide + CH3CH2Br -> p-ethoxyacetaminophenol + Br-

Step 3: Acidic workup

The resulting p-ethoxyacetaminophenol is then treated with an acidic solution, such as hydrochloric acid (HCl) or sulfuric acid (H2SO4), to protonate the oxygen atom and restore the neutral phenol structure. This step also releases the bromide ion as hydrobromic acid (HBr).

p-ethoxyacetaminophenol + HCl -> phenacetin + CH3CH2OH + H2O

Overall, the Williamson ether synthesis allows for the synthesis of phenacetin from p-acetaminophenol and bromoethane by forming an ether linkage between the oxygen atom of p-acetaminophenol and the carbon atom of bromoethane.

To know more about Williamson ester synthesis:

https://brainly.com/question/29434473

#SPJ11

which type of molecule contains -nh2 (amino) groups? A. Carbohydrate B. Protein C. Lipid D. Nucleic acid.E. None of the above.

Answers

The correct answer to the question of which type of molecule contains -[tex]NH_{2}[/tex](amino) groups is B. Protein.

Proteins are made up of long chains of amino acids, which are the building blocks of protein molecules. Amino acids are characterized by their -[tex]NH_{2}[/tex] (amino) group, which is what makes them unique from other types of molecules like carbohydrates, lipids, and nucleic acids. Carbohydrates, on the other hand, are made up of simple sugars like glucose, fructose, and galactose. They do not contain amino groups in their molecular structure. Lipids are fats, oils, and waxes that are made up of fatty acids and glycerol. They also do not contain amino groups in their molecular structure. Nucleic acids like DNA and RNA are composed of nucleotides, which do not contain amino groups. Therefore, it can be concluded that proteins are the only type of molecule that contains -[tex]NH_{2}[/tex] (amino) groups. These groups play an important role in the structure and function of proteins, as they help to form the peptide bonds that link amino acids together in a protein chain.

Learn more about protein here: https://brainly.com/question/13129

#SPJ11

Which of the following types of shoes are recommended by the American Chemical Society for general laboratory work? a. cloth-topped "tennis" or "running" shoes b. sandals c. woven leather shoes d. high heels

Answers

According to the American Chemistry Society, cloth-topped "tennis" or "running" shoes are recommended for general laboratory work. Sandals, woven leather shoes, and high heels are not recommended as they do not provide adequate protection for the feet  against spills or dropped objects in a laboratory setting.
The American Chemical Society is a scientific society based in the United States that supports scientific research in the field of chemistry.

Other safety precautions include: Wearing appropriate gloves, masks, lab coat and shoes. Being careful while using pipette. Washing the glassware properly before using etc.

For more questions regarding American Chemical Society: https://brainly.com/question/28492543

#SPJ11

Digoxin is a drug that has been used to treat systolic heart failure for over 200 years. it has a therapeutic index value of 2.digoxin is a drug that has been used to treat systolic heart failure for over 200 years. it has a therapeutic index value of 2. Why is digoxin used in systolic heart failure?

Answers

Digoxin is used in systolic heart failure because it helps to increase the strength and efficiency of the heart's contractions, particularly in cases where the systolic function of the heart is impaired.

Digoxin works by inhibiting the sodium-potassium ATPase pump, which leads to an increase in intracellular calcium concentrations and subsequently improves the contractility of the heart. This makes it an effective treatment option for patients with systolic heart failure, as it can help to improve cardiac output and reduce symptoms such as shortness of breath and fatigue.

However, due to its narrow therapeutic index, careful monitoring is necessary to ensure that digoxin levels remain within a safe and effective range.

Learn more about Digoxin here:

https://brainly.com/question/12978309

#SPJ11

A solution contains Cr3+ ion and Mg2+ ion. The addition of 1.00 L of 1.55 M NaF solution is required to cause the complete precipitation of these ions as CrF3(s) and MgF2(s). The total mass of the precipitate is 50 (g). Find the mass of Cr3+ and Mg2 in the original solution.

Answers

The mass of Cr₃⁺ ion in the original solution is 14.2 g and the mass of Mg²⁺ ion in the original solution is 10.8 g.

To calculate the mass of Cr₃⁺ and Mg²⁺ ions in the original solution, we can use the given information about the addition of NaF solution and the mass of precipitate formed.

The first step is to calculate the moles of NaF added to the solution. We can use the formula:

moles = concentration × volume

Substituting the values, we get:

moles of NaF added = 1.55 mol/L × 1.00 L = 1.55 moles

Since NaF reacts with both Cr₃⁺ and Mg²⁺ ions, we need to find the limiting reagent between the two ions to determine the maximum amount of precipitate that can form. The balanced chemical equations for the precipitation reactions are:

2 Cr³⁺(aq) + 3 F⁻(aq) → CrF₃(s)

Mg²⁺(aq) + 2 F⁻(aq) → MgF₂(s)

From these equations, we can see that the stoichiometric ratio of Cr³⁺:F⁻ is 2:3, while that of Mg²⁺:F⁻ is 1:2. Therefore, the limiting reagent will be the one that forms the least amount of precipitate.

To calculate the mass of precipitate formed, we can use the formula:

mass = moles × molar mass

The molar mass of CrF₃ is 157.99 g/mol, while that of MgF₂ is 62.30 g/mol. The mass of the precipitate is given as 50 g, so we can calculate the moles of precipitate formed for each ion:

moles of CrF₃ = 50 g / 157.99 g/mol ≈ 0.316 moles

moles of MgF₂ = 50 g / 62.30 g/mol ≈ 0.803 moles

Since Cr³⁺ forms two moles of precipitate for every three moles of NaF, the moles of Cr³⁺ can be calculated as:

moles of Cr³⁺ = (2/3) × moles of NaF added = (2/3) × 1.55 moles ≈ 1.03 moles

Similarly, the moles of Mg²⁺ can be calculated as:

moles of Mg²⁺ = 1/2 × moles of NaF added = 1/2 × 1.55 moles ≈ 0.775 moles

Now, we can use the moles of Cr³⁺ and Mg²⁺ to calculate their respective masses in the original solution:

mass of Cr³⁺ = moles of Cr³⁺ × molar mass of Cr³⁺ = 1.03 moles × 106.16 g/mol ≈ 14.2 g

mass of Mg²⁺ = moles of Mg²⁺ × molar mass of Mg²⁺ = 0.775 moles × 24.31 g/mol ≈ 10.8 g

To know more about original solution, refer here:
https://brainly.com/question/27778951#
#SPJ11

Identify the expected product(s) of the following solvolysis process. Select all that apply. Br MeOH heat ? 0 OCH3 OH O OCH3 O O OH

Answers

The expected products of the solvolysis process are methanol (MeOH) and bromide ion (Br-) being the leaving group. Therefore, the products should be methoxide ion (OCH3) and a molecule of HBr. The reaction can be represented as follows:

Br- + MeOH (heat) → OCH3- + HBr

So, the expected product(s) are OCH3- and HBr.
The expected product(s) for this reaction include:

1. OCH3-substituted compound: The bromine atom is replaced by a methoxy group (OCH3) due to nucleophilic substitution by methanol.
2. OH-substituted compound: The bromine atom is replaced by a hydroxyl group (OH) if a small amount of water is present, which is also a common nucleophile.

Solvolysis refers to a type of chemical reaction where a molecule is cleaved or transformed in the presence of a solvent. The solvent can be water or any other polar or nonpolar substance that has the ability to dissolve the reactant. In a solvolysis reaction, the solvent acts as a nucleophile and can replace or modify certain chemical groups in the molecule, resulting in a new product. Solvolysis is a common reaction in organic chemistry and is often used to synthesize new compounds or to break down complex molecules into simpler ones. Examples of solvolysis reactions include hydrolysis, alcoholysis, and ammonolysis.

Visit here to learn more about solvolysis brainly.com/question/29448847

#SPJ11

What is the name of the particle having the following atomic notation He? A neutron B) beta c) none of the above D gamma E alpha

Answers

Answer:

I may be incorrect but C? Isnt it positron

Explanation:

When water is cooled from 2oC to ice at -2oC, how many distinct calculations must be made to determine the change in the heat for the system?

Answers

Answer: we need three distinct calculations

Explanation: The first one is that the heat energy released when  the water is cooled to 0"c.

                       The second one is that the heat energy released when water changes its state to solid at constant temprature.

                        The third one is the heat energy released when the ice at 0'c is changed to -2'c.

determine the quantity of moles of hydrogen in 3.06 × 10⁻³ g of glycine , c₂h₅no₂

Answers

There are 2.04 × 10⁻⁴ moles of hydrogen in 3.06 × 10⁻³ g of glycine.

To determine the quantity of moles of hydrogen in 3.06 × 10⁻³ g of glycine, we first need to find the molar mass of glycine, which is the sum of the atomic masses of all the atoms in one molecule of glycine. The molecular formula for glycine is C₂H₅NO₂, so the molar mass of glycine is:

Molar mass of glycine = 2 × molar mass of carbon + 5 × molar mass of hydrogen + molar mass of nitrogen + 2 × molar mass of oxygen

= 2(12.01 g/mol) + 5(1.01 g/mol) + 14.01 g/mol + 2(16.00 g/mol)

= 75.07 g/mol

Next, we need to determine the number of moles of glycine in 3.06 × 10⁻³ g of glycine by dividing the mass of glycine by its molar mass:

moles of glycine = mass of glycine / molar mass of glycine

= 3.06 × 10⁻³ g / 75.07 g/mol

= 4.08 × 10⁻⁵ mol

Since the molecular formula for glycine contains five hydrogen atoms, the quantity of moles of hydrogen in 3.06 × 10⁻³ g of glycine can be found by multiplying the number of moles of glycine by the number of hydrogen atoms per molecule of glycine:

moles of hydrogen = moles of glycine × 5

= 4.08 × 10⁻⁵ mol × 5

= 2.04 × 10⁻⁴ mol

Therefore, there are 2.04 × 10⁻⁴ moles of hydrogen in 3.06 × 10⁻³ g of glycine.

To know more about molar mass, refer here:

https://brainly.com/question/30640134#

#SPJ11

specific gravity is the density of a substance compared to the density of mineral oil.

Answers

Specific gravity is the ratio of the density of a substance to the density of a reference substance, usually water.

It is a dimensionless quantity and is often used in the context of fluids and solids to describe their relative densities. The specific gravity of a substance can be calculated by dividing its density by the density of the reference substance.

Specific gravity is commonly used in industries such as oil and gas, where it is used to measure the density of drilling fluids and to determine the concentration of minerals in ores. It is also used in the construction industry to measure the density of construction materials.

Learn more about Specific gravity

https://brainly.com/question/28026962

#SPJ4

Complete Question:

What is specific gravity and how is it defined?

Other Questions
(a) find the differential d y . y = tan x d y = incorrect what type of causal relationship is a way to organize how things occur in the human body & nature? Find the exact length of the curve. x = y^4/8 + 1/4y^2 , 1 y 2_____ The figure shows a barn that Mr. Fowler isbuilding for his farm.10 ft40 ft40 ft50 ft15 ft When an index makes a new high but the Advance / Decline Line does not, this is known as a: a.Bullish Divergence b.Confirmation c.Bearish Divergence d.None of the Above A curve y=f(x) defined for values of x>0 goes through the point (1,0) and is such that the slope of its tangent line at (x,f(x)) is 4/x^2?7/x^6, for x>0. an electrophoresis gel rests between two parallel plates; the potential difference between the plates is 58 vv. each second, 44 mcmc of charge moves through the gel. What is the increase in thermal energy of the gel in 1.0 minute? PLEASE HELP!! find angle RVU append textnode to newelement as a child, and append newelement to parenttag as a child. outline the negative impacts of drought on the economy of south africa What are some of the biggest challenges identified by the various NASA project managers interviewed in the video? Tanvi plans to add a camera to her drone. The drone's battery life will depend on the weight of the camera she adds. This situation can be modeled as a linear relationship. Complete a statement that describes the situationThe drone's battery will last __ minutes if no weight is added. The battery life will decrease by ________________ of weight added. Please select all of the correct statements concerning systemic lupus erythematosus (SLE) to test your understanding of the pathogenesis of autoimmune diseases.(NOTE Please change a question marks to checkmarks for correct answers or empty boxes for incorrect answers).Check All That Apply a. Autoantibodies bind set antigensforming immune complexes that accumulate in basement membranes of various organs b. SLE represents a type hypersensitivity reaction c. Autoantibodies made against DNA and other nuclear components in a variety of cells d. Results in an autoimmune disease that targets the thyroid e. Results in muscle weakness as its principle symptom select all that applyon november 1, alice co. accepted a 90-day, 6%, $2,000 note due january 30. on december 31, the appropriate adjusting entry was made. on january 30 of the next year, the note was honored and paid in full. the entry to record receipt of payment on january 30 would include a credit to: (check all that apply.)multiple select question.A. interest revenue for $20.B. notes receivable for $2,000C. interest revenue for $10.D. interest revenue for $30.E. interest receivable for $20.F. cash for $2,030. Angles in a Triangle Find subject and predicate 1. Down went the Cumberland Serge completed an experiment similar to Part A. They made a cell with copper as the cathode (Ered= 0.34 V), and Metal X as the anode. The electrodes were submerged in solutions of their ions. What is the Ered of Metal X in Serge's cell if the Ecell was 1.025 V? wendell's donut shoppe is investigating the purchase of a new $18600 donut-making machine. the new machine would permit the company to reduce the amount of part-time help needed, at a cost savings of $3800 per year. in addition, the new machine would allow the company to produce one new style of donut, resulting in the sale of 1000 dozen more donuts each year. the company realizes a contribution margin of $1.20 per dozen donuts sold. the new machine would have a six year useful life.what would be the total annual cash inflows associated with the new machine for capital budgeting purposes?what is the internal rate of return promised by the new machine to the nearest whole percent. We have a load with an impedance given by Z = 30 + j 70 . The voltage across this load is V = 15002 30 V.A. IS the load inductive or capacitiveB. Determine the power factorC. Determine the powerD. Determine the reactive powerE. Determine the apparent power delivered to the load Our dog is only a few months old and can already reach the kitchen counter when she stands on her hind legs.Which kind of support does this sentence give to the topic sentence: "Our puppy will probably grow into a large dog"?OIt is an illustration.It is a statistic.It is a detail.It is a fact.